![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/unknown.gif) | 2024_01_06_08_30_01_Christopher Parkening, guitar_Carol of the Birds.aac | 2024-01-06 10:28 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2024_01_06_08_30_01_Hilary Field, guitar_Guitar Suite- For an Old Friend at Christmas- III. Lento.aac | 2024-01-06 10:26 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2024_01_06_08_30_01_Les Arts Florissants_Noels Sur Les Instruments- Laissez paitre vos betes.aac | 2024-01-06 10:23 | 1.0M | |
![[ ]](/icons/unknown.gif) | 2024_01_06_08_30_01_Voices of Ascension_Missa Papae Marcelli- Agnus Dei.aac | 2024-01-06 10:22 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2024_01_06_08_30_01_Trinity Coll. Cambr. Choir_Hodie Christus natus est.aac | 2024-01-06 10:19 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2024_01_06_08_30_01_Anonymous 4_Behold, here is the best morning.aac | 2024-01-06 10:16 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2024_01_06_08_30_01__.aac | 2024-01-06 10:13 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2024_01_06_08_30_01_Hollywood Bowl Orchestra_Away In A Manger.aac | 2024-01-06 10:10 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2024_01_06_08_30_01_Katherine Murdock, viola; Nathaniel Rosen, cello_Angels' Carol.aac | 2024-01-06 10:06 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2024_01_06_08_30_01_Pro Arte Singers_Sweete was the song the Virgine soong.aac | 2024-01-06 10:03 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2024_01_06_08_30_01_Seattle Pro Musica_Ave Maria.aac | 2024-01-06 10:00 | 2.4M | |
![[ ]](/icons/unknown.gif) | 2024_01_06_08_30_01_Chris Thile, mandolin; Bryan Sutton, guitar_One Winter's Night.aac | 2024-01-06 09:57 | 3.3M | |
![[ ]](/icons/unknown.gif) | 2024_01_06_08_30_01_Camerata Vocale Freiburg_Schlaf mein Kindelein (Sleep, My Child).aac | 2024-01-06 09:52 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2024_01_06_08_30_01_Ensemble Galilei_What is This Lovely Fragrance-.aac | 2024-01-06 09:49 | 2.6M | |
![[ ]](/icons/unknown.gif) | 2024_01_06_08_30_01_Royal Philharmonic Orchestra with London Voices_Hansel and Gretel- 'Abends will ich schlafen gehn'.aac | 2024-01-06 09:45 | 2.3M | |
![[ ]](/icons/unknown.gif) | 2024_01_06_08_30_01_Aulos Ensemble_Noel en Trio et en Dialogue.aac | 2024-01-06 09:41 | 2.4M | |
![[ ]](/icons/unknown.gif) | 2024_01_06_08_30_01__ (5).aac | 2024-01-06 09:38 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2024_01_06_08_30_01_City of London Sinfonia_Dormi Jesu.aac | 2024-01-06 09:35 | 3.1M | |
![[ ]](/icons/unknown.gif) | 2024_01_06_08_30_01_University of British Columbia Singers_Little Child in a Manger.aac | 2024-01-06 09:31 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2024_01_06_08_30_01_Grex Vocalis_Ave Maris Stella.aac | 2024-01-06 09:28 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2024_01_06_08_30_01_Cologne Chamber Orchestra_Christmas Concerto, Opus 6-8- Pastorale.aac | 2024-01-06 09:25 | 2.6M | |
![[ ]](/icons/unknown.gif) | 2024_01_06_08_30_01_Chamber Orchestra Kremlin_The Seasons- December- Christmas.aac | 2024-01-06 09:21 | 3.1M | |
![[ ]](/icons/unknown.gif) | 2024_01_06_08_30_01_Chicago Symphony_Messiah- -I know that my Redeemer liveth-.aac | 2024-01-06 09:17 | 4.0M | |
![[ ]](/icons/unknown.gif) | 2024_01_06_08_30_01_RIAS Chamber Choir_Let us rock the little child.aac | 2024-01-06 09:11 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2024_01_06_08_30_01_La Pieta_The Bells of Christmas (adapt. Antoine Bareil).aac | 2024-01-06 09:09 | 3.0M | |
![[ ]](/icons/unknown.gif) | 2024_01_06_08_30_01__ (4).aac | 2024-01-06 09:05 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2024_01_06_08_30_01_The Bekova Sisters_The Christmas Tree- Waltz.aac | 2024-01-06 09:00 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2024_01_06_08_30_01_24 Cellos of the London Sound_Introit- Once in Royal David's City.aac | 2024-01-06 08:57 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2024_01_06_08_30_01__ (3).aac | 2024-01-06 08:54 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2024_01_06_08_30_01_Akiko Ebi, piano_Snow.aac | 2024-01-06 08:51 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2024_01_06_08_30_01__ (2).aac | 2024-01-06 08:47 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2024_01_06_08_30_01_Julius Drake, piano_The Snowman- Walking In The Air.aac | 2024-01-06 08:45 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2024_01_06_08_30_01_NordWest Deutsche Philharmonie_Der Schneemann (The Snowman)- Prelude-Serenade.aac | 2024-01-06 08:43 | 3.1M | |
![[ ]](/icons/unknown.gif) | 2024_01_06_08_30_01_Northern Lights Orchestra_Frosty the Snowman.aac | 2024-01-06 08:38 | 3.5M | |
![[ ]](/icons/unknown.gif) | 2024_01_06_08_30_01__ (1).aac | 2024-01-06 08:33 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2024_01_05_08_30_01_Schwerin Brass Player Collegium_Kommet, ihr Hirten (Come, ye shepherds).aac | 2024-01-05 10:28 | 1.4M | |
![[ ]](/icons/unknown.gif) | 2024_01_05_08_30_01_City of London Sinfonia_Candlelight Carol.aac | 2024-01-05 10:25 | 3.7M | |
![[ ]](/icons/unknown.gif) | 2024_01_05_08_30_01_Arthur Haas, harpsichord_Coventry Carol.aac | 2024-01-05 10:20 | 5.3M | |
![[ ]](/icons/unknown.gif) | 2024_01_05_08_30_01_Baroque Players of Hamilton_Third Symphony of Noels.aac | 2024-01-05 10:12 | 3.4M | |
![[ ]](/icons/unknown.gif) | 2024_01_05_08_30_01_Synergy Brass Quintet_Joy To The World.aac | 2024-01-05 10:08 | 2.6M | |
![[ ]](/icons/unknown.gif) | 2024_01_05_08_30_01_Katherine Murdock, viola; Nathaniel Rosen, cello_Gaudeamus (string quartet).aac | 2024-01-05 10:04 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2024_01_05_08_30_01__.aac | 2024-01-05 10:01 | 1.4M | |
![[ ]](/icons/unknown.gif) | 2024_01_05_08_30_01_American Boy Choir_Lullay, Thou Tiny Little Child.aac | 2024-01-05 09:59 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2024_01_05_08_30_01_Capricorn_Jesu, Joy Of Man's Desiring.aac | 2024-01-05 09:57 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2024_01_05_08_30_01_Voces 8_Lux Aeterna- O Nata Lux.aac | 2024-01-05 09:54 | 3.0M | |
![[ ]](/icons/unknown.gif) | 2024_01_05_08_30_01_BBC Concert Orchestra_A Musical Sleigh Ride.aac | 2024-01-05 09:49 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2024_01_05_08_30_01__ (5).aac | 2024-01-05 09:46 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2024_01_05_08_30_01_Royal Philharmonic Orchestra_Ave Maria.aac | 2024-01-05 09:44 | 3.0M | |
![[ ]](/icons/unknown.gif) | 2024_01_05_08_30_01_Royal Ballet Sinfonia_Waltz for Strings.aac | 2024-01-05 09:40 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2024_01_05_08_30_01_Vienna Boys Choir_Entre le boeuf et l'ane gris.aac | 2024-01-05 09:38 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2024_01_05_08_30_01_Ola Gjeilo, piano, and 12 Ensemble_Away in a Manger (arr. Ola Gjeilo).aac | 2024-01-05 09:34 | 2.7M | |
![[ ]](/icons/unknown.gif) | 2024_01_05_08_30_01_Stuttgart Chamber Choir_Es ist ein Ros entsprungen.aac | 2024-01-05 09:31 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2024_01_05_08_30_01__ (4).aac | 2024-01-05 09:28 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2024_01_05_08_30_01_Eteri Andjaparidze, piano_Weihnachtsbaum (Christmas Tree)- In dulci jubilo.aac | 2024-01-05 09:25 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2024_01_05_08_30_01_Bournemouth Symphony Orchestra_Traditional Slavic Christmas Music.aac | 2024-01-05 09:21 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2024_01_05_08_30_01_Empire Brass_Sleepers Wake (Cantata BWV 140).aac | 2024-01-05 09:18 | 3.0M | |
![[ ]](/icons/unknown.gif) | 2024_01_05_08_30_01_New York Polyphony_There is no Rose.aac | 2024-01-05 09:14 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2024_01_05_08_30_01__ (3).aac | 2024-01-05 09:11 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2024_01_05_08_30_01_In Mulieribus (Portland ens.)_Ave Maria.aac | 2024-01-05 09:09 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2024_01_05_08_30_01_Ensemble 94_Une jeune pucelle (A young virgin of noble heart...).aac | 2024-01-05 09:07 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2024_01_05_08_30_01_Tafelmusik Baroque Orchestra_Messiah- Rejoice greatly, O daughter of Zion.aac | 2024-01-05 09:05 | 3.2M | |
![[ ]](/icons/unknown.gif) | 2024_01_05_08_30_01__ (2).aac | 2024-01-05 09:00 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2024_01_05_08_30_01_Polyphony_Lullay (from Stella Natalis - Star of the Nativity).aac | 2024-01-05 08:58 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2024_01_05_08_30_01_Cantus_Awed by the Beauty.aac | 2024-01-05 08:54 | 3.0M | |
![[ ]](/icons/unknown.gif) | 2024_01_05_08_30_01_St. Paul's Cathedral Choir_Hark! The Herald Angels Sing.aac | 2024-01-05 08:49 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2024_01_05_08_30_01_Foothills Brass Quintet_Jesu Bambino.aac | 2024-01-05 08:46 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2024_01_05_08_30_01_The King's Noyse_The New Year's gift.aac | 2024-01-05 08:43 | 754K | |
![[ ]](/icons/unknown.gif) | 2024_01_05_08_30_01__ (1).aac | 2024-01-05 08:42 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2024_01_05_08_30_01_Pavao String Quartet_Christmas Medley (arr. Carlo Martelli).aac | 2024-01-05 08:40 | 4.4M | |
![[ ]](/icons/unknown.gif) | 2024_01_05_08_30_01_Malle Babbe Women's Choir_Ave Maria (16th century setting).aac | 2024-01-05 08:34 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2024_01_05_08_30_01_RIAS Chamber Choir_Schlaf, mein Kindelein (Sleep, my little child).aac | 2024-01-05 08:32 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2024_01_04_08_30_01_Baltimore Consort_Wir singen dir, Immanuel (We sing unto You, Emmanuel).aac | 2024-01-04 10:27 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2024_01_04_08_30_01_Boston Pops Orchestra_Sleigh Ride.aac | 2024-01-04 10:25 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2024_01_04_08_30_01_Harrington String Quartet; Phoenix Chorale_The Ground (adapted from Sunrise Mass).aac | 2024-01-04 10:22 | 3.1M | |
![[ ]](/icons/unknown.gif) | 2024_01_04_08_30_01_Sistine Chapel Choir_Adoramus te, Christe (We Adore Thee, Christ).aac | 2024-01-04 10:18 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2024_01_04_08_30_01_RIAS Chamber Choir_Ich lag in tiefster Todesnacht.aac | 2024-01-04 10:15 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2024_01_04_08_30_01_Monteverdi Choir_Alma Redemptoris Mater (16th century).aac | 2024-01-04 10:13 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2024_01_04_08_30_01_New York Pops_Merry Christmas.aac | 2024-01-04 10:09 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2024_01_04_08_30_01_Paul O'Dette, lute_Tous les bourgeois de Chartres.aac | 2024-01-04 10:06 | 2.9M | |
![[ ]](/icons/unknown.gif) | 2024_01_04_08_30_01_Luc Beausejour, organ_Trumpet Sonata in D- Third Movement- Allegro.aac | 2024-01-04 10:02 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2024_01_04_08_30_01_St. Paul's Cathedral Choir_There Is No Rose.aac | 2024-01-04 09:59 | 1.4M | |
![[ ]](/icons/unknown.gif) | 2024_01_04_08_30_01__.aac | 2024-01-04 09:57 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2024_01_04_08_30_01_De Organographia_God Rest You Merry, Gentlemen.aac | 2024-01-04 09:56 | 854K | |
![[ ]](/icons/unknown.gif) | 2024_01_04_08_30_01_Sinfonia Cymru_A Gaelic Blessing- Meditation.aac | 2024-01-04 09:54 | 3.3M | |
![[ ]](/icons/unknown.gif) | 2024_01_04_08_30_01_Anonymous 4_A New Year Carol.aac | 2024-01-04 09:50 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2024_01_04_08_30_01_Vienna Boys Choir_Heiligste Nacht (Holiest Night).aac | 2024-01-04 09:47 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2024_01_04_08_30_01_Robert Shaw Festival Singers_Glory to God in the Highest.aac | 2024-01-04 09:45 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2024_01_04_08_30_01_Musica Intima_Venez, mes enfants (Come, my children).aac | 2024-01-04 09:42 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2024_01_04_08_30_01_Netherlands Bach Society_Christmas Oratorio (Pt. 2)- Sinfonia.aac | 2024-01-04 09:40 | 3.6M | |
![[ ]](/icons/unknown.gif) | 2024_01_04_08_30_01_Robert Groslot, piano_Children's Suite- Romance- Andantino.aac | 2024-01-04 09:35 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2024_01_04_08_30_01_Piano4te_Merry Christmas Mr. Lawrence (arr. H. Otakara).aac | 2024-01-04 09:33 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2024_01_04_08_30_01__ (2).aac | 2024-01-04 09:31 | 3.1M | |
![[ ]](/icons/unknown.gif) | 2024_01_04_08_30_01_Die Singphoniker_Nu zijt wellekome (You are Welcome).aac | 2024-01-04 09:26 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2024_01_04_08_30_01_Taverner Consort, Choir & Players_O Jesulein suss (O Sweet Jesus).aac | 2024-01-04 09:24 | 2.6M | |
![[ ]](/icons/unknown.gif) | 2024_01_04_08_30_01_Oklahoma Woodwind Quintet_Christmas Carol Medley.aac | 2024-01-04 09:20 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2024_01_04_08_30_01_Royal Philharmonic Orchestra with London Voices_He shall feed His flock.aac | 2024-01-04 09:18 | 3.6M | |
![[ ]](/icons/unknown.gif) | 2024_01_04_08_30_01_London Symphony Brass_Canzon II a 4 for brass.aac | 2024-01-04 09:12 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2024_01_04_08_30_01_Canadian Brass_Joy to the World.aac | 2024-01-04 09:09 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2024_01_04_08_30_01_The American Boychoir_Missa Brevis- Veni Redemptor.aac | 2024-01-04 09:07 | 1.0M | |
![[ ]](/icons/unknown.gif) | 2024_01_04_08_30_01_Pittsburgh Symphony Low Brass_Petites Litanies de Jesus.aac | 2024-01-04 09:06 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2024_01_04_08_30_01_Sinfonia Cymru_The Lord Bless You and Keep You- Meditation.aac | 2024-01-04 09:04 | 2.6M | |
![[ ]](/icons/unknown.gif) | 2024_01_04_08_30_01_Schwerin Brass Collegium_Quem pastores laudavere (The shepherds praised).aac | 2024-01-04 09:00 | 3.2M | |
![[ ]](/icons/unknown.gif) | 2024_01_04_08_30_01__ (1).aac | 2024-01-04 08:55 | 2.3M | |
![[ ]](/icons/unknown.gif) | 2024_01_04_08_30_01_Academy of St Martin in Fields_Still, Still, Still.aac | 2024-01-04 08:52 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2024_01_04_08_30_01_Arsys Bourgogne_Les anges dans nos campagnes.aac | 2024-01-04 08:49 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2024_01_04_08_30_01_University of British Columbia Singers_Lo in a Manger.aac | 2024-01-04 08:46 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2024_01_04_08_30_01_Arion_Noels- Amoroso.aac | 2024-01-04 08:43 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2024_01_04_08_30_01_Santa Fe Guitar Quartet_Terpsichore- Ballet (Guitar Quartet).aac | 2024-01-04 08:41 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2024_01_04_08_30_01_Bengt Forsberg, piano_Villancico Vasco (Basque Carol).aac | 2024-01-04 08:39 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2024_01_04_08_30_01_Boston Pops Orchestra_L'Enfance du Christ- Shepherd's Chorus.aac | 2024-01-04 08:37 | 3.1M | |
![[ ]](/icons/unknown.gif) | 2024_01_03_08_30_01_Katherine Murdock, viola; Nathaniel Rosen, cello_When Christmas Morn Was Dawning.aac | 2024-01-03 10:26 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2024_01_03_08_30_01_London Baroque_Canon in D.aac | 2024-01-03 10:24 | 2.7M | |
![[ ]](/icons/unknown.gif) | 2024_01_03_08_30_01_24 Cellos of the London Sound_Introit- Once in Royal David's City.aac | 2024-01-03 10:21 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2024_01_03_08_30_01_Stuttgart Chamber Choir_Und unser lieben Frauen (And our Blessed Lady).aac | 2024-01-03 10:17 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2024_01_03_08_30_01_Lords of the Chords_Zu Bethlehem geboren (A child born in Bethlehem).aac | 2024-01-03 10:15 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2024_01_03_08_30_01_Westminster Choir, Rider University, NY_Dans cette etable.aac | 2024-01-03 10:13 | 1.4M | |
![[ ]](/icons/unknown.gif) | 2024_01_03_08_30_01_Brent Mason, guitar; Mark Casstevens, guitar_The Cherry Tree Carol (arr. O'Connor).aac | 2024-01-03 10:11 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2024_01_03_08_30_01_Orpheus Vocal Ensemble_Freu dich, Erd und Sternenzelt (Rejoice, Earth & Firmament).aac | 2024-01-03 10:07 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2024_01_03_08_30_01_BBC Singers_Here is the Little Door.aac | 2024-01-03 10:04 | 2.3M | |
![[ ]](/icons/unknown.gif) | 2024_01_03_08_30_01_Portland Revels_Comes the Morning.aac | 2024-01-03 10:01 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2024_01_03_08_30_01_Gabrieli Consort & Players_Christmas Mass- Sonata.aac | 2024-01-03 09:59 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2024_01_03_08_30_01_Slovak State Philharmonic Orchestra_The Skaters Waltz (Les Patineurs), Opus 183.aac | 2024-01-03 09:56 | 5.4M | |
![[ ]](/icons/unknown.gif) | 2024_01_03_08_30_01_Philharmonia Virtuosi_A Musical Sleigh Ride.aac | 2024-01-03 09:48 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2024_01_03_08_30_01_Portland State Chamber Choir_O Salutaris Hostia.aac | 2024-01-03 09:46 | 2.6M | |
![[ ]](/icons/unknown.gif) | 2024_01_03_08_30_01_Orpheus Vocal Ensemble; Ars Antiqua Austria_Ave maris stella (Hail, queen of the stars).aac | 2024-01-03 09:42 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2024_01_03_08_30_01_The Choral Project_Caroling, Caroling.aac | 2024-01-03 09:39 | 1.0M | |
![[ ]](/icons/unknown.gif) | 2024_01_03_08_30_01_West Edge String Quartet_A La Media Noche-De Tierra Lajana Venimos.aac | 2024-01-03 09:37 | 3.5M | |
![[ ]](/icons/unknown.gif) | 2024_01_03_08_30_01_Chanticleer_The Three Kings.aac | 2024-01-03 09:32 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2024_01_03_08_30_01_Rome Sinfonietta Orchestra_Maria, che dolce nome (Mary, how sweet a name).aac | 2024-01-03 09:29 | 2.7M | |
![[ ]](/icons/unknown.gif) | 2024_01_03_08_30_01_Prague Philharmonic Orchestra_Bethlehem Down.aac | 2024-01-03 09:25 | 2.9M | |
![[ ]](/icons/unknown.gif) | 2024_01_03_08_30_01_Grex Vocalis_Kling no klokka (The bells ring, they sound).aac | 2024-01-03 09:21 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2024_01_03_08_30_01_Kampin Laulu Chamber Choir_Ecce novum gaudium (Behold the new Joy).aac | 2024-01-03 09:19 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2024_01_03_08_30_01__.aac | 2024-01-03 09:17 | 3.2M | |
![[ ]](/icons/unknown.gif) | 2024_01_03_08_30_01_Carolina Chamber Chorale_Hannerot Hallalu (Hanukkah song).aac | 2024-01-03 09:12 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2024_01_03_08_30_01__ (2).aac | 2024-01-03 09:10 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2024_01_03_08_30_01_Oregon Ballet Theatre Orchestra_The Nutcracker- Waltz of the Flowers.aac | 2024-01-03 09:07 | 4.9M | |
![[ ]](/icons/unknown.gif) | 2024_01_03_08_30_01_Schwerin Brass Player Collegium_Schlaf wohl, du Himmelsknabe (Sleep well, Child from Heaven).aac | 2024-01-03 09:00 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2024_01_03_08_30_01_New York Polyphony_Nowell- Arise and Wake.aac | 2024-01-03 08:58 | 2.4M | |
![[ ]](/icons/unknown.gif) | 2024_01_03_08_30_01_The Choral Project_A Christmas Carol.aac | 2024-01-03 08:55 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2024_01_03_08_30_01_Seraphic Fire_Once As I Remember (arr. Charles Wood).aac | 2024-01-03 08:52 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2024_01_03_08_30_01_Die Singphoniker_Canco de hadal (Catalan Christmas song).aac | 2024-01-03 08:50 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2024_01_03_08_30_01_Debra Torok & Marylene Dosse, piano_Christmas Music for piano 4-hands- God Rest You Merry....aac | 2024-01-03 08:47 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2024_01_03_08_30_01_West Edge String Quartet_The Bells of Christmas- A Medley of Two Modern Carols.aac | 2024-01-03 08:46 | 4.1M | |
![[ ]](/icons/unknown.gif) | 2024_01_03_08_30_01_Eaken Piano Trio_Winter Wonderland.aac | 2024-01-03 08:40 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2024_01_03_08_30_01__ (1).aac | 2024-01-03 08:38 | 2.7M | |
![[ ]](/icons/unknown.gif) | 2024_01_03_08_30_01_Czech Radio Symphony Orchestra_The Seasons- Winter- Frost, snow, ice.aac | 2024-01-03 08:36 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2024_01_02_08_30_01__.aac | 2024-01-02 10:27 | 2.4M | |
![[ ]](/icons/unknown.gif) | 2024_01_02_08_30_01_Utah Symphony Orchestra_Ave Maria.aac | 2024-01-02 10:24 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2024_01_02_08_30_01_Baltimore Consort_Wir singen dir, Immanuel (We sing unto You, Emmanuel).aac | 2024-01-02 10:21 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2024_01_02_08_30_01_Boston Pops Orchestra_Sleigh Ride.aac | 2024-01-02 10:18 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2024_01_02_08_30_01_Harrington String Quartet; Phoenix Chorale_The Ground (adapted from Sunrise Mass).aac | 2024-01-02 10:16 | 3.0M | |
![[ ]](/icons/unknown.gif) | 2024_01_02_08_30_01_Sistine Chapel Choir_Adoramus te, Christe (We Adore Thee, Christ).aac | 2024-01-02 10:11 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2024_01_02_08_30_01_New York Pops_Merry Christmas.aac | 2024-01-02 10:09 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2024_01_02_08_30_01_Scholars Baroque Ensemble_Messiah- Pifa (Pastoral Symphony).aac | 2024-01-02 10:06 | 742K | |
![[ ]](/icons/unknown.gif) | 2024_01_02_08_30_01_Paul O'Dette, lute_Tous les bourgeois de Chartres.aac | 2024-01-02 10:05 | 2.9M | |
![[ ]](/icons/unknown.gif) | 2024_01_02_08_30_01_Luc Beausejour, organ_Trumpet Sonata in D- Third Movement- Allegro.aac | 2024-01-02 10:01 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2024_01_02_08_30_01_Monteverdi Choir_Alma Redemptoris Mater (16th century).aac | 2024-01-02 09:59 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2024_01_02_08_30_01_RIAS Chamber Choir_Ich lag in tiefster Todesnacht.aac | 2024-01-02 09:55 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2024_01_02_08_30_01_Westminster Choir College of Rider University_O Magnum Mysterium.aac | 2024-01-02 09:52 | 4.1M | |
![[ ]](/icons/unknown.gif) | 2024_01_02_08_30_01__ (2).aac | 2024-01-02 09:46 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2024_01_02_08_30_01_Sinfonia Cymru_A Gaelic Blessing- Meditation.aac | 2024-01-02 09:44 | 3.3M | |
![[ ]](/icons/unknown.gif) | 2024_01_02_08_30_01_Anonymous 4_A New Year Carol.aac | 2024-01-02 09:40 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2024_01_02_08_30_01_Vienna Boys Choir_Heiligste Nacht (Holiest Night).aac | 2024-01-02 09:38 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2024_01_02_08_30_01_Robert Shaw Festival Singers_Glory to God in the Highest.aac | 2024-01-02 09:35 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2024_01_02_08_30_01_Netherlands Bach Society_Christmas Oratorio (Pt. 2)- Sinfonia.aac | 2024-01-02 09:33 | 3.8M | |
![[ ]](/icons/unknown.gif) | 2024_01_02_08_30_01_Robert Groslot, piano_Children's Suite- Romance- Andantino.aac | 2024-01-02 09:27 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2024_01_02_08_30_01_Piano4te_Merry Christmas Mr. Lawrence (arr. H. Otakara).aac | 2024-01-02 09:25 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2024_01_02_08_30_01__ (1).aac | 2024-01-02 09:23 | 3.2M | |
![[ ]](/icons/unknown.gif) | 2024_01_02_08_30_01_Die Singphoniker_Nu zijt wellekome (You are Welcome).aac | 2024-01-02 09:18 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2024_01_02_08_30_01_Taverner Consort, Choir & Players_O Jesulein suss (O Sweet Jesus).aac | 2024-01-02 09:16 | 1.4M | |
![[ ]](/icons/unknown.gif) | 2024_01_02_08_30_01_Oklahoma Woodwind Quintet_Christmas Carol Medley.aac | 2024-01-02 09:14 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2024_01_02_08_30_01_Royal Philharmonic Orchestra with London Voices_He shall feed His flock.aac | 2024-01-02 09:11 | 3.6M | |
![[ ]](/icons/unknown.gif) | 2024_01_02_08_30_01_London Symphony Brass_Canzon II a 4 for brass.aac | 2024-01-02 09:06 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2024_01_02_08_30_01_Canadian Brass_Joy to the World.aac | 2024-01-02 09:03 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2024_01_02_08_30_01_The American Boychoir_Missa Brevis- Veni Redemptor.aac | 2024-01-02 09:01 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2024_01_02_08_30_01_Arion_Noels- Amoroso.aac | 2024-01-02 08:58 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2024_01_02_08_30_01_Santa Fe Guitar Quartet_Terpsichore- Ballet (Guitar Quartet).aac | 2024-01-02 08:56 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2024_01_02_08_30_01_Bengt Forsberg, piano_Villancico Vasco (Basque Carol).aac | 2024-01-02 08:54 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2024_01_02_08_30_01_The Sixteen_Salve Regina (Plainchant).aac | 2024-01-02 08:52 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2024_01_02_08_30_01_Monteverdi Choir_Gloria in excelsis Deo (16th century).aac | 2024-01-02 08:49 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2024_01_02_08_30_01_Musica Fiata_Jubiliret Frohlich (Canzona in 8 parts).aac | 2024-01-02 08:47 | 3.3M | |
![[ ]](/icons/unknown.gif) | 2024_01_02_08_30_01_Eduard Laurel, piano_Toy Soldier March.aac | 2024-01-02 08:42 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2024_01_02_08_30_01_Taverner Consort_Christmas Eve.aac | 2024-01-02 08:40 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2024_01_01_08_30_01_Royal Ballet Sinfonia_Old Christmas Music- The First Mercy (after Peter Warlock).aac | 2024-01-01 10:28 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2024_01_01_08_30_01__.aac | 2024-01-01 10:26 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2024_01_01_08_30_01_Musica Sacra_I Wonder As I Wander.aac | 2024-01-01 10:23 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2024_01_01_08_30_01_La Pieta_Sleep Holy Infant - Lullaby.aac | 2024-01-01 10:20 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2024_01_01_08_30_01_Royal Philharmonic Orchestra with London Voices_L'Enfance du Christ, Opus 25- 'L'adieu des bergers'.aac | 2024-01-01 10:15 | 2.9M | |
![[ ]](/icons/unknown.gif) | 2024_01_01_08_30_01_Arthur Haas, harpsichord_Coventry Carol.aac | 2024-01-01 10:11 | 2.3M | |
![[ ]](/icons/unknown.gif) | 2024_01_01_08_30_01__ (7).aac | 2024-01-01 10:08 | 1.0M | |
![[ ]](/icons/unknown.gif) | 2024_01_01_08_30_01_1st Presb. Ft. Thomas Bell Choir_Angels We Have Heard on High.aac | 2024-01-01 10:06 | 646K | |
![[ ]](/icons/unknown.gif) | 2024_01_01_08_30_01_The Cambridge Singers_Blessed Be That Maid Mary.aac | 2024-01-01 10:05 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2024_01_01_08_30_01_Kansas City Chorale_Sweet Was the Song the Virgin Sung.aac | 2024-01-01 10:02 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2024_01_01_08_30_01_Choir of King's College, Cambridge_Quem pastores laudevere.aac | 2024-01-01 10:00 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2024_01_01_08_30_01__ (6).aac | 2024-01-01 09:58 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2024_01_01_08_30_01_Sonos Handbell Choir_Bring a Torch, Jeanette, Isabella.aac | 2024-01-01 09:56 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2024_01_01_08_30_01_Smithsonian Chamber Players_Von Himmel hoch.aac | 2024-01-01 09:53 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2024_01_01_08_30_01_Westminster Concert Bell Choir_We Three Kings.aac | 2024-01-01 09:52 | 1.4M | |
![[ ]](/icons/unknown.gif) | 2024_01_01_08_30_01_The Queen's Six_Corpus Christi Carol.aac | 2024-01-01 09:50 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2024_01_01_08_30_01__ (5).aac | 2024-01-01 09:47 | 1.0M | |
![[ ]](/icons/unknown.gif) | 2024_01_01_08_30_01_Emory Symphonic Winds_Greensleaves (arr. Alfred Reed).aac | 2024-01-01 09:46 | 3.9M | |
![[ ]](/icons/unknown.gif) | 2024_01_01_08_30_01_Eaken Piano Trio_El Noi de la Mare (The Song of Mary).aac | 2024-01-01 09:40 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2024_01_01_08_30_01_West Edge String Quartet_Carol of the Bells.aac | 2024-01-01 09:37 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2024_01_01_08_30_01_City of London Sinfonia_Candlelight Carol.aac | 2024-01-01 09:35 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2024_01_01_08_30_01_American Boy Choir_Lullay, Lullay- As I lay on Yoolis Night.aac | 2024-01-01 09:31 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2024_01_01_08_30_01_In Mulieribus_Es ist ein' Ros' entsprungen.aac | 2024-01-01 09:29 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2024_01_01_08_30_01_Los Angeles Guitar Quartet_Nutcracker Suite, Opus 71a- Waltz of the Flowers.aac | 2024-01-01 09:26 | 3.6M | |
![[ ]](/icons/unknown.gif) | 2024_01_01_08_30_01_New York Polyphony_Nowell- Arise and Wake.aac | 2024-01-01 09:21 | 2.4M | |
![[ ]](/icons/unknown.gif) | 2024_01_01_08_30_01__ (4).aac | 2024-01-01 09:17 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2024_01_01_08_30_01_Sinfonia Cymru_Lullaby for Ana Gwen.aac | 2024-01-01 09:15 | 3.1M | |
![[ ]](/icons/unknown.gif) | 2024_01_01_08_30_01_Christopher Parkening, guitar_Infant Holy, Infant Lowly (Polish Carol).aac | 2024-01-01 09:11 | 2.3M | |
![[ ]](/icons/unknown.gif) | 2024_01_01_08_30_01__ (3).aac | 2024-01-01 09:08 | 1.4M | |
![[ ]](/icons/unknown.gif) | 2024_01_01_08_30_01_Eyal Vilner Big Band_Oh Hanukkah.aac | 2024-01-01 09:06 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2024_01_01_08_30_01__ (2).aac | 2024-01-01 09:01 | 2.3M | |
![[ ]](/icons/unknown.gif) | 2024_01_01_08_30_01_Seraphic Fire_Once As I Remember (arr. Charles Wood).aac | 2024-01-01 08:58 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2024_01_01_08_30_01_Die Singphoniker_Canco de hadal (Catalan Christmas song).aac | 2024-01-01 08:56 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2024_01_01_08_30_01_Oklahoma Woodwind Quintet_Rise, Come and See The King.aac | 2024-01-01 08:54 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2024_01_01_08_30_01_Pioneer Brass_The Holly and the Ivy.aac | 2024-01-01 08:52 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2024_01_01_08_30_01_Pittsburgh Symphony Brass_Volte.aac | 2024-01-01 08:50 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2024_01_01_08_30_01__ (1).aac | 2024-01-01 08:48 | 4.2M | |
![[ ]](/icons/unknown.gif) | 2024_01_01_08_30_01_Slovak Radio Symphony Orchestra_The Seasons- Winter- Ice.aac | 2024-01-01 08:41 | 918K | |
![[ ]](/icons/unknown.gif) | 2024_01_01_08_30_01_Ola Gjeilo, piano, and 12 Ensemble_First Snow.aac | 2024-01-01 08:40 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_16_30_01_La Pieta_Noel Nouvelet (arr. Claude Gagnon).aac | 2023-12-31 20:27 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_16_30_01_Nicolaus Esterhazy Sinfonia_Angels We Have Heard on High.aac | 2023-12-31 20:25 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_16_30_01_Anonymous 4_A Virgin Unspotted.aac | 2023-12-31 20:22 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_16_30_01_Chanticleer_Beautiful Star of Bethlehem.aac | 2023-12-31 20:19 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_16_30_01_St. Paul's Cathedral Choir_Gaudete! (medieval melody).aac | 2023-12-31 20:16 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_16_30_01_Baltimore Consort_In dir ist Freude (In you is Joy).aac | 2023-12-31 20:14 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_16_30_01_The Queen's Six_Corpus Christi Carol.aac | 2023-12-31 20:12 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_16_30_01_Bengt Forsberg, piano_English Folk Song- So Blest A Sight.aac | 2023-12-31 20:10 | 3.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_16_30_01_Singscape_Quem pastores.aac | 2023-12-31 20:04 | 1.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_16_30_01_Royal Philharmonic_El Noi de la Mare (Son of the Virgin).aac | 2023-12-31 20:02 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_16_30_01_The Carillon Brass_European Carol Medley (arr. Arthur Frackenpohl).aac | 2023-12-31 19:59 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_16_30_01__.aac | 2023-12-31 19:55 | 3.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_16_30_01_The Cambridge Singers_Once As I Remember (Italian Carol).aac | 2023-12-31 19:50 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_16_30_01_Seattle Pro Musica_Das Roslein, das ich meine.aac | 2023-12-31 19:47 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_16_30_01_Vienna Boys Choir_Stille, Stille, Stille (Austrian).aac | 2023-12-31 19:46 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_16_30_01_City of Prague Orchestra_O Holy Night.aac | 2023-12-31 19:44 | 3.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_16_30_01_West Edge String Quartet_Carol of the Bells.aac | 2023-12-31 19:39 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_16_30_01_Renaissonics_Fum, Fum, Fum.aac | 2023-12-31 19:37 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_16_30_01_24 Cellos of the London Sound_Introit- Once in Royal David's City.aac | 2023-12-31 19:35 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_16_30_01_London Baroque_Canzona - Aria.aac | 2023-12-31 19:32 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_16_30_01_Die Singphoniker_Still, o Himmel (Hush o Heaven - Bavarian carol).aac | 2023-12-31 19:29 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_16_30_01_Musica Sacra_Did Mary Know-.aac | 2023-12-31 19:26 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_16_30_01__ (7).aac | 2023-12-31 19:22 | 4.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_16_30_01_Portland Brass Quintet_Il est bel et bon (French chanson).aac | 2023-12-31 19:16 | 846K | |
![[ ]](/icons/unknown.gif) | 2023_12_31_16_30_01_Christopher Parkening, guitar_Infant Holy, Infant Lowly (Polish Carol).aac | 2023-12-31 19:15 | 2.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_16_30_01__ (6).aac | 2023-12-31 19:12 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_16_30_01_Aulos Ensemble_When Christ Was Born On Earth.aac | 2023-12-31 19:08 | 2.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_16_30_01__ (5).aac | 2023-12-31 19:04 | 3.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_16_30_01_City of London Sinfonia_Christmas Night (French Carol).aac | 2023-12-31 18:59 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_16_30_01_The Choir of Royal Holloway_Coventry Carol (arr. Ola Gjeilo).aac | 2023-12-31 18:55 | 2.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_16_30_01_Lahti Symphony Orchestra_The Bells of Christmas.aac | 2023-12-31 18:52 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_16_30_01_Brent Mason, guitar; Mark Casstevens, guitar_The Cherry Tree Carol (arr. O'Connor).aac | 2023-12-31 18:48 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_16_30_01__ (4).aac | 2023-12-31 18:44 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_16_30_01_St. Paul's Cathedral Choir_O Come, All Ye Faithful (arr. David Willcocks).aac | 2023-12-31 18:41 | 2.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_16_30_01_Oregon Bach Festival Chorus_Lo, How A Rose E'er Blooming.aac | 2023-12-31 18:37 | 3.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_16_30_01_Oklahoma Woodwind Quintet_Good Christian Men Rejoice.aac | 2023-12-31 18:32 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_16_30_01__ (3).aac | 2023-12-31 18:29 | 1.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_16_30_01_Gloriae Dei Cantores_A Child's Welcome (From A Celebration Of Carols).aac | 2023-12-31 18:28 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_16_30_01_La Pieta_Laissez Paitre Vos Betes (Noel Bressan) (arr. Claude Gagnon).aac | 2023-12-31 18:25 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_16_30_01_Baltimore Consort_Christmas Day in the Morning.aac | 2023-12-31 18:23 | 2.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_16_30_01_ICAN Holiday_Cinnamon Bear- Chapter 13 - The Wintergreen Witch.aac | 2023-12-31 18:19 | 8.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_16_30_01__ (2).aac | 2023-12-31 18:07 | 1.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_16_30_01_Portland Symphonic Choir_Vespers, Op 37- The Troparion- Today Salvation Has Come.aac | 2023-12-31 18:05 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_16_30_01_The Cambridge Singers_Tomorrow Shall Be My Dancing Day.aac | 2023-12-31 18:02 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_16_30_01_Oklahoma Woodwind Quintet_Christmas Spiritual Medley.aac | 2023-12-31 18:00 | 3.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_16_30_01_Chanticleer_The Three Kings.aac | 2023-12-31 17:56 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_16_30_01_Seattle Pro Musica_Marienlieder (Songs of Mary)- The Annunciation.aac | 2023-12-31 17:52 | 2.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_16_30_01_Renaissonics_Joseph, lieber Joseph mein.aac | 2023-12-31 17:49 | 2.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_16_30_01_Ensemble Galilei_God Rest Ye Merry, Gentlemen; Good King Wenceslas.aac | 2023-12-31 17:45 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_16_30_01_Musica Sacra_Saw You Never In The Twilight.aac | 2023-12-31 17:41 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_16_30_01_The Carillon Brass_Personent Hodie (arr. Don Hart).aac | 2023-12-31 17:39 | 2.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_16_30_01__ (1).aac | 2023-12-31 17:36 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_16_30_01_Die Singphoniker_Vom Himmel hoch (From Heaven on High I come to you).aac | 2023-12-31 17:33 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_16_30_01_By Ezra Jack Keats; Narration and sound by Napoleon Maddox_The Snowy Day.aac | 2023-12-31 17:31 | 3.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_16_30_01_Northern Lights Orchestra_Frosty the Snowman.aac | 2023-12-31 17:26 | 3.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_16_30_01_Kansas City Chorale_The Holy Infant's Lullaby.aac | 2023-12-31 17:21 | 16M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_16_30_01_Sistine Chapel Choir_Jubilate Deo (Sing Joyfully to God).aac | 2023-12-31 16:58 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_16_30_01_St. Paul's Cathedral Choir_Coventry Carol (Lully, Lulla, Lullay).aac | 2023-12-31 16:57 | 3.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_16_30_01_West Edge String Quartet_A La Media Noche-De Tierra Lajana Venimos.aac | 2023-12-31 16:52 | 3.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_16_30_01_Renaissonics_Quando nascette Ninno.aac | 2023-12-31 16:47 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_16_30_01_Raymond Mase, trumpet; Fred Sherry, cello; Anne-Marie McDerm_A Christmas Medley (Joy to the World, & more).aac | 2023-12-31 16:44 | 4.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_16_30_01_Choir of King's College, Cambridge_I Saw a Maiden.aac | 2023-12-31 16:38 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_16_30_01_In Mulieribus (Portland ens.)_Ther is no rose of swych vertu (15th c.).aac | 2023-12-31 16:35 | 2.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_07_30_01_Robert Groslot, piano_Children's Suite- Romance- Andantino.aac | 2023-12-31 09:27 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_07_30_01_Piano4te_Merry Christmas Mr. Lawrence (arr. H. Otakara).aac | 2023-12-31 09:25 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_07_30_01__.aac | 2023-12-31 09:23 | 3.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_07_30_01_Die Singphoniker_Nu zijt wellekome (You are Welcome).aac | 2023-12-31 09:18 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_07_30_01_Taverner Consort, Choir & Players_O Jesulein suss (O Sweet Jesus).aac | 2023-12-31 09:15 | 2.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_07_30_01_Oklahoma Woodwind Quintet_Christmas Carol Medley.aac | 2023-12-31 09:12 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_07_30_01_Royal Philharmonic Orchestra with London Voices_He shall feed His flock.aac | 2023-12-31 09:09 | 3.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_07_30_01_London Symphony Brass_Canzon II a 4 for brass.aac | 2023-12-31 09:04 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_07_30_01_Canadian Brass_Joy to the World.aac | 2023-12-31 09:01 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_07_30_01_Tafelmusik Baroque Chorus & Orchestra_Messiah- Hallelujah Chorus.aac | 2023-12-31 08:59 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_07_30_01_The American Boychoir_Missa Brevis- Veni Redemptor.aac | 2023-12-31 08:55 | 1.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_07_30_01_Pittsburgh Symphony Low Brass_Petites Litanies de Jesus.aac | 2023-12-31 08:54 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_07_30_01_University of British Columbia Singers_Lo in a Manger.aac | 2023-12-31 08:51 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_07_30_01_Bournemouth Sinfonietta_St. Paul's Suite, Opus 29 no 2- Mvmt 4 Finale (The Dargason).aac | 2023-12-31 08:48 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_07_30_01_Arion_Noels- Amoroso.aac | 2023-12-31 08:45 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_07_30_01_Santa Fe Guitar Quartet_Terpsichore- Ballet (Guitar Quartet).aac | 2023-12-31 08:43 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_07_30_01_Bengt Forsberg, piano_Villancico Vasco (Basque Carol).aac | 2023-12-31 08:41 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_07_30_01_The Christmas Chapter read by Jeffrey_Storynory- The Wind in the Willows.aac | 2023-12-31 08:39 | 23M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_07_30_01_Canadian Brass_Or Let the Merry Bells Ring 'Round.aac | 2023-12-31 08:06 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_07_30_01_The Muddy River Morris Team_Constant Billy.aac | 2023-12-31 08:03 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_07_30_01_Los Angeles Guitar Quartet_Nutcracker Suite, Opus 71a- Waltz of the Flowers.aac | 2023-12-31 08:01 | 3.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_07_30_01_Robert Shaw Festival Singers_Four Motets for Christmas- Seeing the Star.aac | 2023-12-31 07:56 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_07_30_01_Musica Intima_Huron Carol.aac | 2023-12-31 07:53 | 2.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_07_30_01_Seattle Pro Musica_Ave Maria.aac | 2023-12-31 07:50 | 2.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_07_30_01_Members of the Vienna Philharmonic_It Came Upon a Midnight Clear.aac | 2023-12-31 07:46 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_07_30_01_De Organographia_Hark! The Herald Angels Sing (4 trombones).aac | 2023-12-31 07:44 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_07_30_01_Royal Ballet Sinfonia_Waltz for Strings.aac | 2023-12-31 07:42 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_07_30_01_Bournemouth Symphony Orchestra_Traditional Slavic Christmas Music.aac | 2023-12-31 07:40 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_07_30_01__ (1).aac | 2023-12-31 07:37 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_31_07_30_01_City of London Choir_There is no Rose, Opus 14.aac | 2023-12-31 07:35 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_30_16_30_02_Robert Shaw Chamber Singers_Alleluia.aac | 2023-12-30 20:26 | 3.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_30_16_30_02_The Choir of Queens College, Cambridge_The Holly And The Ivy.aac | 2023-12-30 20:22 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_30_16_30_02__.aac | 2023-12-30 20:17 | 3.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_30_16_30_02_Eric Robertson, organ_O Come, All Ye Faithful & Joy to the World.aac | 2023-12-30 20:13 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_30_16_30_02_Mainstreet Brass_Joseph lieber, Joseph mein (Brass Quintet).aac | 2023-12-30 20:10 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_30_16_30_02__ (9).aac | 2023-12-30 20:07 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_30_16_30_02_Royal Philharmonic Orchestra with London Voices_He shall feed His flock.aac | 2023-12-30 20:05 | 4.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_30_16_30_02__ (8).aac | 2023-12-30 19:59 | 1.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_30_16_30_02_The Cambridge Singers_Blessed Be That Maid Mary.aac | 2023-12-30 19:57 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_30_16_30_02_City of London Sinfonia_Love Came Down At Christmas.aac | 2023-12-30 19:54 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_30_16_30_02_University of Portland Singers_Austrian Carol Medley (arr. Michael Connolly).aac | 2023-12-30 19:52 | 5.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_30_16_30_02_24 Cellos of the London Sound_The Nutcracker - Pas de Deux.aac | 2023-12-30 19:43 | 3.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_30_16_30_02_Pittsburgh Symphony Brass_Volte.aac | 2023-12-30 19:39 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_30_16_30_02_Empire Brass_Sheep May Safely Graze (Cantata BWV 208).aac | 2023-12-30 19:37 | 3.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_30_16_30_02__ (7).aac | 2023-12-30 19:31 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_30_16_30_02_Young People's Chorus of New York_Silent Night.aac | 2023-12-30 19:30 | 2.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_30_16_30_02_The King's Singers_Lux Aurumque (Light and Gold).aac | 2023-12-30 19:26 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_30_16_30_02_Vienna Boys Choir_Auf dem Berge, da wehet der Wind (Wind Blows on the Mountain.aac | 2023-12-30 19:23 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_30_16_30_02_Oregon Ballet Theatre Orchestr_The Nutcracker- Overture.aac | 2023-12-30 19:21 | 2.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_30_16_30_02_Capella Istropolitana_German Dances, K.605- No.3 -Sleigh Ride-.aac | 2023-12-30 19:18 | 2.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_30_16_30_02_Los Angeles Guitar Quartet_Nutcracker Suite, Opus 71a- Waltz of the Flowers.aac | 2023-12-30 19:14 | 3.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_30_16_30_02_Empire Brass_Make a Joyful Noise.aac | 2023-12-30 19:09 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_30_16_30_02__ (6).aac | 2023-12-30 19:05 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_30_16_30_02_Portland Symphonic Choir_Vespers, Op 37- (6) Rejoice, O Virgin.aac | 2023-12-30 19:02 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_30_16_30_02_Katherine Murdock, viola; Nathaniel Rosen, cello_Angels' Carol.aac | 2023-12-30 19:00 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_30_16_30_02_Seattle Pro Musica_Deustches (German) Magnificat.aac | 2023-12-30 18:56 | 4.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_30_16_30_02_Cantus_Coventry Carol.aac | 2023-12-30 18:50 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_30_16_30_02_New York Pops_Carol of the Drum.aac | 2023-12-30 18:47 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_30_16_30_02_Baltimore Consort_Drive the Cold Winter Away.aac | 2023-12-30 18:44 | 2.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_30_16_30_02_Chicago Symphony_Messiah- -I know that my Redeemer liveth-.aac | 2023-12-30 18:41 | 4.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_30_16_30_02__ (5).aac | 2023-12-30 18:34 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_30_16_30_02_The Queen's Six_Gabriel's Message.aac | 2023-12-30 18:31 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_30_16_30_02_The Cambridge Singers_All My Heart This Night Rejoices.aac | 2023-12-30 18:28 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_30_16_30_02_Die Singphoniker_Canco de hadal (Catalan Christmas song).aac | 2023-12-30 18:26 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_30_16_30_02_ICAN Holiday_Cinnamon Bear- Chapter 12 - Rhyming Rabbit.aac | 2023-12-30 18:24 | 11M | |
![[ ]](/icons/unknown.gif) | 2023_12_30_16_30_02_Musica Sacra_Of The Father's Love Begotten.aac | 2023-12-30 18:08 | 3.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_30_16_30_02_Taylor Festival Choir & Players_This Evenfall 'tis Snowing.aac | 2023-12-30 18:03 | 2.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_30_16_30_02_Empire Brass_Three Chorales.aac | 2023-12-30 17:59 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_30_16_30_02_Pavao String Quartet_Shepherd's Farewell (arr. Carlo Martelli).aac | 2023-12-30 17:55 | 3.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_30_16_30_02_Pro Arte Singers_Give good gifts to one another.aac | 2023-12-30 17:51 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_30_16_30_02_De Organographia_Hark! The Herald Angels Sing (4 trombones).aac | 2023-12-30 17:49 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_30_16_30_02_Christopher Parkening, guitar_Gesu Bambino.aac | 2023-12-30 17:47 | 2.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_30_16_30_02_City of London Sinfonia_What Is This Fragrance.aac | 2023-12-30 17:43 | 2.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_30_16_30_02_Vasari Singers_The Christ-child.aac | 2023-12-30 17:40 | 3.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_30_16_30_02_Seattle Pro Musica_So singen wir all Amen.aac | 2023-12-30 17:35 | 906K | |
![[ ]](/icons/unknown.gif) | 2023_12_30_16_30_02__ (4).aac | 2023-12-30 17:33 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_30_16_30_02_Cologne Chamber Orchestra_Christmas Concerto, Opus 6-8- Pastorale.aac | 2023-12-30 17:29 | 3.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_30_16_30_02_Canadian Brass_Little Fantasy on -The Twelve Days of Christmas-.aac | 2023-12-30 17:25 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_30_16_30_02__ (3).aac | 2023-12-30 17:22 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_30_16_30_02_The Queen's Six_Pastime With Good Company.aac | 2023-12-30 17:19 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_30_16_30_02_The Cambridge Singers_Lute-Book Lullaby.aac | 2023-12-30 17:18 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_30_16_30_02_New York Polyphony_Un Flambeau, Jeanette, Isabelle (arr. Alexander Craig).aac | 2023-12-30 17:16 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_30_16_30_02__ (2).aac | 2023-12-30 17:14 | 1.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_30_16_30_02_Sarahz_Storytime- Dragon After Its Winter Sleep.aac | 2023-12-30 17:12 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_30_16_30_02_Cincinnati Pops Orchestra_Angel's Dance.aac | 2023-12-30 17:10 | 3.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_30_16_30_02__ (1).aac | 2023-12-30 17:05 | 2.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_30_07_30_01_Stuttgart Chamber Choir_Es ist ein Ros entsprungen.aac | 2023-12-30 09:26 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_30_07_30_01__.aac | 2023-12-30 09:23 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_30_07_30_01_Eteri Andjaparidze, piano_Weihnachtsbaum (Christmas Tree)- In dulci jubilo.aac | 2023-12-30 09:20 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_30_07_30_01_Bournemouth Symphony Orchestra_Traditional Slavic Christmas Music.aac | 2023-12-30 09:17 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_30_07_30_01_Empire Brass_Sleepers Wake (Cantata BWV 140).aac | 2023-12-30 09:14 | 3.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_30_07_30_01_New York Polyphony_There is no Rose.aac | 2023-12-30 09:09 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_30_07_30_01__ (3).aac | 2023-12-30 09:07 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_30_07_30_01_In Mulieribus (Portland ens.)_Ave Maria.aac | 2023-12-30 09:04 | 1.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_30_07_30_01_Ensemble 94_Une jeune pucelle (A young virgin of noble heart...).aac | 2023-12-30 09:02 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_30_07_30_01_Cantus_Awed by the Beauty.aac | 2023-12-30 09:00 | 3.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_30_07_30_01_St. Paul's Cathedral Choir_Hark! The Herald Angels Sing.aac | 2023-12-30 08:56 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_30_07_30_01_Foothills Brass Quintet_Jesu Bambino.aac | 2023-12-30 08:53 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_30_07_30_01_The King's Noyse_The New Year's gift.aac | 2023-12-30 08:50 | 754K | |
![[ ]](/icons/unknown.gif) | 2023_12_30_07_30_01__ (2).aac | 2023-12-30 08:49 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_30_07_30_01_Pavao String Quartet_Christmas Medley (arr. Carlo Martelli).aac | 2023-12-30 08:47 | 4.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_30_07_30_01_Malle Babbe Women's Choir_Ave Maria (16th century setting).aac | 2023-12-30 08:41 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_30_07_30_01_RIAS Chamber Choir_Schlaf, mein Kindelein (Sleep, my little child).aac | 2023-12-30 08:39 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_30_07_30_01_The American Boychoir_Missa Brevis- Gloria.aac | 2023-12-30 08:37 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_30_07_30_01_West Edge String Quartet_The Wexford Carol.aac | 2023-12-30 08:34 | 2.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_30_07_30_01__ (1).aac | 2023-12-30 08:31 | 4.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_30_07_30_01_Czech Radio Symphony Orchestra_Gaelic Lullaby.aac | 2023-12-30 08:25 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_30_07_30_01_Choir of Gonville & Caius College, Cambridge_Ave Maria.aac | 2023-12-30 08:22 | 3.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_30_07_30_01_Gary_Storytime- The Gingerbread Man.aac | 2023-12-30 08:18 | 7.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_30_07_30_01_Voces 8_Locus iste.aac | 2023-12-30 08:07 | 2.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_30_07_30_01_Choir of King's College, Cambridge_Angels from the Realms of Glory.aac | 2023-12-30 08:02 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_30_07_30_01_Mainstreet Brass_Gloucestershire Wassail (arr. Brass Quintet).aac | 2023-12-30 07:59 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_30_07_30_01_Katherine Murdock, viola; Nathaniel Rosen, cello_Good King Wenceslas.aac | 2023-12-30 07:57 | 622K | |
![[ ]](/icons/unknown.gif) | 2023_12_30_07_30_01_Kay Johannsen, organ_Wie soll ich dich empfangen (How shall I receive thee).aac | 2023-12-30 07:56 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_30_07_30_01_Philharmonia Orchestra_O Holy Night.aac | 2023-12-30 07:53 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_30_07_30_01_Monteverdi Choir_O Maria vernans rosa.aac | 2023-12-30 07:49 | 3.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_30_07_30_01_Westminster Choir, Rider University, NY_Ave maria.aac | 2023-12-30 07:44 | 3.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_30_07_30_01_Vienna Boys Choir_Huron Carol.aac | 2023-12-30 07:39 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_16_30_01_La Pieta_Noel Nouvelet (arr. Claude Gagnon).aac | 2023-12-29 20:27 | 1.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_16_30_01_Nicolaus Esterhazy Sinfonia_Angels We Have Heard on High.aac | 2023-12-29 20:25 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_16_30_01_Anonymous 4_A Virgin Unspotted.aac | 2023-12-29 20:22 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_16_30_01_Chanticleer_Beautiful Star of Bethlehem.aac | 2023-12-29 20:20 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_16_30_01_St. Paul's Cathedral Choir_Gaudete! (medieval melody).aac | 2023-12-29 20:17 | 1.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_16_30_01_Baltimore Consort_In dir ist Freude (In you is Joy).aac | 2023-12-29 20:15 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_16_30_01__.aac | 2023-12-29 20:13 | 3.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_16_30_01_Bengt Forsberg, piano_English Folk Song- So Blest A Sight.aac | 2023-12-29 20:08 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_16_30_01_The Queen's Six_Corpus Christi Carol.aac | 2023-12-29 20:05 | 2.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_16_30_01_Singscape_Quem pastores.aac | 2023-12-29 20:01 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_16_30_01_Royal Philharmonic_El Noi de la Mare (Son of the Virgin).aac | 2023-12-29 20:00 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_16_30_01_The Carillon Brass_European Carol Medley (arr. Arthur Frackenpohl).aac | 2023-12-29 19:57 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_16_30_01__ (11).aac | 2023-12-29 19:53 | 3.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_16_30_01_The Cambridge Singers_Once As I Remember (Italian Carol).aac | 2023-12-29 19:48 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_16_30_01_Seattle Pro Musica_Das Roslein, das ich meine.aac | 2023-12-29 19:45 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_16_30_01_Vienna Boys Choir_Stille, Stille, Stille (Austrian).aac | 2023-12-29 19:43 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_16_30_01_City of Prague Orchestra_O Holy Night.aac | 2023-12-29 19:41 | 3.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_16_30_01_West Edge String Quartet_Carol of the Bells.aac | 2023-12-29 19:37 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_16_30_01_Renaissonics_Fum, Fum, Fum.aac | 2023-12-29 19:35 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_16_30_01_24 Cellos of the London Sound_Introit- Once in Royal David's City.aac | 2023-12-29 19:33 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_16_30_01_Die Singphoniker_Still, o Himmel (Hush o Heaven - Bavarian carol).aac | 2023-12-29 19:30 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_16_30_01_Musica Sacra_Did Mary Know-.aac | 2023-12-29 19:27 | 2.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_16_30_01__ (10).aac | 2023-12-29 19:23 | 4.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_16_30_01_Portland Brass Quintet_Il est bel et bon (French chanson).aac | 2023-12-29 19:17 | 858K | |
![[ ]](/icons/unknown.gif) | 2023_12_29_16_30_01__ (9).aac | 2023-12-29 19:16 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_16_30_01_Aulos Ensemble_When Christ Was Born On Earth.aac | 2023-12-29 19:12 | 2.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_16_30_01__ (8).aac | 2023-12-29 19:08 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_16_30_01_The Toronto Consort_The Spanish Gypsies (opens with -Drive the cold winter away-.aac | 2023-12-29 19:05 | 3.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_16_30_01_City of London Sinfonia_Christmas Night (French Carol).aac | 2023-12-29 19:00 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_16_30_01_The Choir of Royal Holloway_Coventry Carol (arr. Ola Gjeilo).aac | 2023-12-29 18:56 | 2.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_16_30_01_Lahti Symphony Orchestra_The Bells of Christmas.aac | 2023-12-29 18:53 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_16_30_01__ (7).aac | 2023-12-29 18:49 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_16_30_01_St. Paul's Cathedral Choir_O Come, All Ye Faithful (arr. David Willcocks).aac | 2023-12-29 18:46 | 2.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_16_30_01_Oregon Bach Festival Chorus_Lo, How A Rose E'er Blooming.aac | 2023-12-29 18:42 | 3.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_16_30_01_London Baroque_Canzona - Aria.aac | 2023-12-29 18:37 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_16_30_01_Oklahoma Woodwind Quintet_Good Christian Men Rejoice.aac | 2023-12-29 18:34 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_16_30_01__ (6).aac | 2023-12-29 18:31 | 1.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_16_30_01_Gloriae Dei Cantores_A Child's Welcome (From A Celebration Of Carols).aac | 2023-12-29 18:30 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_16_30_01_La Pieta_Laissez Paitre Vos Betes (Noel Bressan) (arr. Claude Gagnon).aac | 2023-12-29 18:26 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_16_30_01_Baltimore Consort_Christmas Day in the Morning.aac | 2023-12-29 18:24 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_16_30_01_ICAN Holiday_Cinnamon Bear- Chapter 11 - Fee Foo The Gentle Giant.aac | 2023-12-29 18:22 | 9.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_16_30_01__ (5).aac | 2023-12-29 18:08 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_16_30_01_The Cambridge Singers_Tomorrow Shall Be My Dancing Day.aac | 2023-12-29 18:05 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_16_30_01_Christopher Parkening, guitar_Infant Holy, Infant Lowly (Polish Carol).aac | 2023-12-29 18:02 | 2.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_16_30_01_Chanticleer_The Three Kings.aac | 2023-12-29 17:59 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_16_30_01_Seattle Pro Musica_Marienlieder (Songs of Mary)- The Annunciation.aac | 2023-12-29 17:56 | 2.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_16_30_01_Portland Revels_Jenny Pluck Pears fr English Dancing Master 1651.aac | 2023-12-29 17:52 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_16_30_01_Renaissonics_Joseph, lieber Joseph mein.aac | 2023-12-29 17:50 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_16_30_01_Ensemble Galilei_God Rest Ye Merry, Gentlemen; Good King Wenceslas.aac | 2023-12-29 17:47 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_16_30_01_The Carillon Brass_Personent Hodie (arr. Don Hart).aac | 2023-12-29 17:43 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_16_30_01__ (4).aac | 2023-12-29 17:39 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_16_30_01_Vienna Boys Choir_O du stille Zeit.aac | 2023-12-29 17:37 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_16_30_01_Die Singphoniker_Vom Himmel hoch (From Heaven on High I come to you).aac | 2023-12-29 17:35 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_16_30_01_Royal Ballet Sinfonia_Old Christmas Music- The First Mercy (after Peter Warlock).aac | 2023-12-29 17:33 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_16_30_01_National Philharmonic Orchestra_Ave Maria.aac | 2023-12-29 17:30 | 3.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_16_30_01_Rose Ensemble_The Babe of Bethlehem.aac | 2023-12-29 17:25 | 494K | |
![[ ]](/icons/unknown.gif) | 2023_12_29_16_30_01__ (3).aac | 2023-12-29 17:25 | 1.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_16_30_01_The Queen's Six_Out of Your Sleep.aac | 2023-12-29 17:23 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_16_30_01_Schola Cantorum of Saint Peter's in the Loop_Gloria.aac | 2023-12-29 17:22 | 3.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_16_30_01_Musica Sacra_Saw You Never In The Twilight.aac | 2023-12-29 17:17 | 1.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_16_30_01_Portland Brass Quintet_Canzona per Sonare No. 4.aac | 2023-12-29 17:15 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_16_30_01__ (2).aac | 2023-12-29 17:13 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_16_30_01_Lahti Symphony Orchestra_Hosianna.aac | 2023-12-29 17:10 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_16_30_01_Aulos Ensemble_Noel Etranger.aac | 2023-12-29 17:08 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_16_30_01_Kansas City Chorale_The Holy Infant's Lullaby.aac | 2023-12-29 17:06 | 3.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_16_30_01_Sistine Chapel Choir_Jubilate Deo (Sing Joyfully to God).aac | 2023-12-29 17:00 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_16_30_01_St. Paul's Cathedral Choir_Coventry Carol (Lully, Lulla, Lullay).aac | 2023-12-29 16:59 | 3.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_16_30_01_West Edge String Quartet_A La Media Noche-De Tierra Lajana Venimos.aac | 2023-12-29 16:54 | 3.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_16_30_01__ (1).aac | 2023-12-29 16:49 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_16_30_01_Renaissonics_Quando nascette Ninno.aac | 2023-12-29 16:47 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_16_30_01_Raymond Mase, trumpet; Fred Sherry, cello; Anne-Marie McDerm_A Christmas Medley (Joy to the World, & more).aac | 2023-12-29 16:45 | 4.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_16_30_01_Choir of King's College, Cambridge_I Saw a Maiden.aac | 2023-12-29 16:38 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_16_30_01_In Mulieribus (Portland ens.)_Ther is no rose of swych vertu (15th c.).aac | 2023-12-29 16:35 | 2.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_07_30_02_Robert Groslot, piano_Children's Suite- Romance- Andantino.aac | 2023-12-29 09:29 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_07_30_02_Piano4te_Merry Christmas Mr. Lawrence (arr. H. Otakara).aac | 2023-12-29 09:27 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_07_30_02__.aac | 2023-12-29 09:25 | 3.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_07_30_02_Die Singphoniker_Nu zijt wellekome (You are Welcome).aac | 2023-12-29 09:20 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_07_30_02_Taverner Consort, Choir & Players_O Jesulein suss (O Sweet Jesus).aac | 2023-12-29 09:18 | 2.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_07_30_02_Oklahoma Woodwind Quintet_Christmas Carol Medley.aac | 2023-12-29 09:14 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_07_30_02_Royal Philharmonic Orchestra with London Voices_He shall feed His flock.aac | 2023-12-29 09:11 | 3.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_07_30_02_Katherine Murdock, viola; Nathaniel Rosen, cello_Ding, Dong! merrily on high.aac | 2023-12-29 09:06 | 4.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_07_30_02_West Edge String Quartet_A La Nanita Nana (Lullaby).aac | 2023-12-29 09:00 | 2.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_07_30_02_London Symphony Brass_Canzon II a 4 for brass.aac | 2023-12-29 08:56 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_07_30_02_Canadian Brass_Joy to the World.aac | 2023-12-29 08:53 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_07_30_02_The American Boychoir_Missa Brevis- Veni Redemptor.aac | 2023-12-29 08:52 | 1.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_07_30_02_Pittsburgh Symphony Low Brass_Petites Litanies de Jesus.aac | 2023-12-29 08:50 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_07_30_02_University of British Columbia Singers_Lo in a Manger.aac | 2023-12-29 08:48 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_07_30_02_Arion_Noels- Amoroso.aac | 2023-12-29 08:45 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_07_30_02_Santa Fe Guitar Quartet_Terpsichore- Ballet (Guitar Quartet).aac | 2023-12-29 08:43 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_07_30_02_Bengt Forsberg, piano_Villancico Vasco (Basque Carol).aac | 2023-12-29 08:41 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_07_30_02_The Sixteen_Salve Regina (Plainchant).aac | 2023-12-29 08:39 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_07_30_02_Members of the Vienna Philharmonic_It Came Upon a Midnight Clear.aac | 2023-12-29 08:36 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_07_30_02__ (3).aac | 2023-12-29 08:34 | 1.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_07_30_02_Portland Revels_Quem Pastores Laudavere (navtivity carol).aac | 2023-12-29 08:32 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_07_30_02_Washington Choral Arts Society_Jesus Christ the Apple Tree.aac | 2023-12-29 08:30 | 2.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_07_30_02_Canadian Brass_Or Let the Merry Bells Ring 'Round.aac | 2023-12-29 08:26 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_07_30_02_Vienna Boys Choir_Stille, Stille, Stille (Austrian).aac | 2023-12-29 08:24 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_07_30_02__ (2).aac | 2023-12-29 08:22 | 3.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_07_30_02_Emma_Storynory- Sleeping Beauty.aac | 2023-12-29 08:17 | 5.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_07_30_02_West Edge String Quartet_A La Nanita Nana (Lullaby) (1).aac | 2023-12-29 08:09 | 2.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_07_30_02_The Muddy River Morris Team_Constant Billy.aac | 2023-12-29 08:05 | 1.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_07_30_02_Los Angeles Guitar Quartet_Nutcracker Suite, Opus 71a- Waltz of the Flowers.aac | 2023-12-29 08:03 | 3.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_07_30_02_Robert Shaw Festival Singers_Four Motets for Christmas- Seeing the Star.aac | 2023-12-29 07:58 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_07_30_02_Musica Intima_Huron Carol.aac | 2023-12-29 07:55 | 2.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_07_30_02_Seattle Pro Musica_Ave Maria.aac | 2023-12-29 07:52 | 2.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_07_30_02_Members of the Vienna Philharmonic_It Came Upon a Midnight Clear (1).aac | 2023-12-29 07:48 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_07_30_02_De Organographia_Hark! The Herald Angels Sing (4 trombones).aac | 2023-12-29 07:47 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_07_30_02_Royal Ballet Sinfonia_Waltz for Strings.aac | 2023-12-29 07:45 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_07_30_02_Bournemouth Symphony Orchestra_Traditional Slavic Christmas Music.aac | 2023-12-29 07:42 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_07_30_02__ (1).aac | 2023-12-29 07:39 | 3.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_29_07_30_02_City of London Choir_There is no Rose, Opus 14.aac | 2023-12-29 07:37 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_28_16_30_01_Seattle Pro Musica_Puer natus in Bethlehem (A child is born in Bethlehem).aac | 2023-12-28 20:26 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_28_16_30_01_Rome Sinfonietta Orchestra_Ave Maria.aac | 2023-12-28 20:23 | 2.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_28_16_30_01_Schwerin Brass Collegium_Quem pastores laudavere (The shepherds praised).aac | 2023-12-28 20:19 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_28_16_30_01_Sinfonia Cymru_Lullaby for Pegi.aac | 2023-12-28 20:17 | 2.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_28_16_30_01_Debra Torok & Marylene Dosse, piano_Christmas Music for piano 4-hands- Silent Night.aac | 2023-12-28 20:13 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_28_16_30_01_University of Portland Singers_Austrian Carol Medley (arr. Michael Connolly).aac | 2023-12-28 20:11 | 5.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_28_16_30_01__.aac | 2023-12-28 20:03 | 5.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_28_16_30_01_Brent Mason, guitar; Mark Casstevens, guitar; John Jarvis, p_Carol of the Bells (arr. O'Connor).aac | 2023-12-28 19:55 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_28_16_30_01_West Edge String Quartet_Coventry Carol.aac | 2023-12-28 19:52 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_28_16_30_01_Christopher Parkening, guitar_El Noi de la Mare (Son of the Virgin).aac | 2023-12-28 19:49 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_28_16_30_01_Oklahoma Woodwind Quintet_What Child Is This-.aac | 2023-12-28 19:46 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_28_16_30_01_Arsys Bourgogne_Tebe pojem.aac | 2023-12-28 19:42 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_28_16_30_01__ (9).aac | 2023-12-28 19:39 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_28_16_30_01_RIAS Chamber Choir_Lasset uns frohlocken (Let Us Rejoice).aac | 2023-12-28 19:37 | 846K | |
![[ ]](/icons/unknown.gif) | 2023_12_28_16_30_01_True North Brass_Hodie, Christus Natus Est (brass ensemble).aac | 2023-12-28 19:35 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_28_16_30_01_Bach Trumpet Ensemble of Munich_Sonata 'Ad Festum Paschatis'.aac | 2023-12-28 19:34 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_28_16_30_01_Emory Symphonic Winds_Symphonic Prelude on -Adeste Fideles-.aac | 2023-12-28 19:31 | 2.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_28_16_30_01_Paul O'Dette, lute_Es ist ein Ros entsprungen.aac | 2023-12-28 19:28 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_28_16_30_01_In Mulieribus (Portland ens.)_Angelus ad virginem.aac | 2023-12-28 19:25 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_28_16_30_01_Pomerium_In dulci jubilo a 2.aac | 2023-12-28 19:22 | 622K | |
![[ ]](/icons/unknown.gif) | 2023_12_28_16_30_01_Voces 8_Locus iste.aac | 2023-12-28 19:21 | 2.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_28_16_30_01_Ensemble 94_Ou s'en vont ces gays bergers.aac | 2023-12-28 19:17 | 858K | |
![[ ]](/icons/unknown.gif) | 2023_12_28_16_30_01_Trinity Cathedral Choir, Portland_The Cherry Tree Carol.aac | 2023-12-28 19:16 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_28_16_30_01_Oregon Bach Festival Chorus_Christmas Day is Come.aac | 2023-12-28 19:13 | 1.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_28_16_30_01__ (8).aac | 2023-12-28 19:11 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_28_16_30_01_Yolanda Kondonassis, harp_O Sleep, My Pretty Baby.aac | 2023-12-28 19:08 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_28_16_30_01_BBC Singers_Sing Lullaby.aac | 2023-12-28 19:06 | 2.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_28_16_30_01_The Cambridge Singers_Lute-Book Lullaby.aac | 2023-12-28 19:02 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_28_16_30_01_Epic Brass_Sleigh Ride.aac | 2023-12-28 19:00 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_28_16_30_01__ (7).aac | 2023-12-28 18:57 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_28_16_30_01_St. Paul's Cathedral Choir_Once In Royal David's City (arr. Mann).aac | 2023-12-28 18:55 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_28_16_30_01__ (6).aac | 2023-12-28 18:52 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_28_16_30_01_Royal Ballet Sinfonia_Fairytale Suite- Snow Scene.aac | 2023-12-28 18:49 | 1.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_28_16_30_01_Eaken Piano Trio_The Nutcracker- Waltz of the Flowers.aac | 2023-12-28 18:48 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_28_16_30_01_Gerold Huber, piano_Inmitten der nacht.aac | 2023-12-28 18:45 | 1.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_28_16_30_01_Portland State Chamber Choir_Pater Noster.aac | 2023-12-28 18:43 | 4.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_28_16_30_01_The Sixteen_Ave Maris Stella.aac | 2023-12-28 18:36 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_28_16_30_01_La Pieta_The Holy Boy.aac | 2023-12-28 18:33 | 2.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_28_16_30_01_Academy of St Martin in the Fields_The Skaters Waltz (Les Patineurs), Opus 183.aac | 2023-12-28 18:29 | 5.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_28_16_30_01_Les Boreades de Montreal_Noel provencal.aac | 2023-12-28 18:21 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_28_16_30_01_ICAN Holidays_Cinnamon Bear- Chapter 10 - Professor Whiz.aac | 2023-12-28 18:20 | 8.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_28_16_30_01__ (5).aac | 2023-12-28 18:07 | 3.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_28_16_30_01_The Carillon Brass_Fum, Fum, Fum.aac | 2023-12-28 18:03 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_28_16_30_01_Schwerin Brass Player Collegium_Canzona No. 45 in 8 parts from -Sacri Concentus- (1601).aac | 2023-12-28 18:00 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_28_16_30_01_Seattle Pro Musica_So singen wir all Amen.aac | 2023-12-28 17:56 | 906K | |
![[ ]](/icons/unknown.gif) | 2023_12_28_16_30_01_24 Cellos of the London Sound_Troika - O Little Town of Bethlehem (cellos).aac | 2023-12-28 17:54 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_28_16_30_01_Tafelmusik Baroque Orchestra_Messiah- Rejoice greatly, O daughter of Zion.aac | 2023-12-28 17:51 | 3.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_28_16_30_01_Sinfonia Cymru_Lullaby for Ana Gwen.aac | 2023-12-28 17:47 | 3.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_28_16_30_01__ (4).aac | 2023-12-28 17:42 | 3.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_28_16_30_01_In Mulieribus (Portland ens.)_There is no rose of such virtue.aac | 2023-12-28 17:37 | 3.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_28_16_30_01_Voces 8_My Lord Has Come.aac | 2023-12-28 17:32 | 2.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_28_16_30_01_Cincinnati Pops Orchestra_Angel's Dance.aac | 2023-12-28 17:28 | 3.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_28_16_30_01__ (3).aac | 2023-12-28 17:23 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_28_16_30_01_Hollywood Bowl Orchestra_Away In A Manger.aac | 2023-12-28 17:21 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_28_16_30_01_New York Polyphony_Gabriel's Message (arr. Alexander Craig).aac | 2023-12-28 17:17 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_28_16_30_01_Queen Melissa_Storytime- The Girl and the Whirlwinds.aac | 2023-12-28 17:15 | 6.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_28_16_30_01_RIAS Chamber Choir_Schlaf, mein Kindelein (Sleep, my little child).aac | 2023-12-28 17:05 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_28_16_30_01_The Queen's Six_God Rest You Merry, Gentlemen (arr. Simon Whiteley).aac | 2023-12-28 17:03 | 2.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_28_16_30_01_Canadian Brass_Arrival of the Queen of Sheba.aac | 2023-12-28 17:00 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_28_16_30_01_Vincent Boucher, organ_Wachet auf, ruft uns die Stimme (Sleepers Awake).aac | 2023-12-28 16:56 | 2.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_28_16_30_01_Schwerin Brass Player Collegium_Freue dich, du Tochter Zion (1655).aac | 2023-12-28 16:52 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_28_16_30_01__ (2).aac | 2023-12-28 16:49 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_28_16_30_01_Faith DeBow, piano_Requiem (mother mary, full of grace, awaken).aac | 2023-12-28 16:46 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_28_16_30_01_Stile Antico_Ave Maria (Hail Mary; for Advent).aac | 2023-12-28 16:43 | 1.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_28_16_30_01_City of London Sinfonia_Love Came Down At Christmas.aac | 2023-12-28 16:41 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_28_16_30_01_The Toronto Consort_All you that are good fellows.aac | 2023-12-28 16:38 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_28_16_30_01__ (1).aac | 2023-12-28 16:36 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_28_07_30_01_Chanticleer_The Three Kings.aac | 2023-12-28 09:28 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_28_07_30_01_Rome Sinfonietta Orchestra_Maria, che dolce nome (Mary, how sweet a name).aac | 2023-12-28 09:25 | 2.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_28_07_30_01_Prague Philharmonic Orchestra_Bethlehem Down.aac | 2023-12-28 09:21 | 2.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_28_07_30_01_Grex Vocalis_Kling no klokka (The bells ring, they sound).aac | 2023-12-28 09:17 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_28_07_30_01_Kampin Laulu Chamber Choir_Ecce novum gaudium (Behold the new Joy).aac | 2023-12-28 09:15 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_28_07_30_01__.aac | 2023-12-28 09:13 | 3.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_28_07_30_01_Carolina Chamber Chorale_Hannerot Hallalu (Hanukkah song).aac | 2023-12-28 09:08 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_28_07_30_01__ (4).aac | 2023-12-28 09:06 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_28_07_30_01_Maestro Classics_Maestro Classics- The Nutcracker.aac | 2023-12-28 09:03 | 42M | |
![[ ]](/icons/unknown.gif) | 2023_12_28_07_30_01_Taverner Choir_Chant- Antiphon from Chester Processional.aac | 2023-12-28 08:02 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_28_07_30_01__ (3).aac | 2023-12-28 08:00 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_28_07_30_01_Portland Brass Quintet_Deck the Hall.aac | 2023-12-28 07:58 | 682K | |
![[ ]](/icons/unknown.gif) | 2023_12_28_07_30_01_The Choral Project_The Wassail Song.aac | 2023-12-28 07:57 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_28_07_30_01_Etherea Vocal Ensemble_Gabriel's Message (arr. John Rutter).aac | 2023-12-28 07:54 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_28_07_30_01_Vienna Boys Choir_Entre le boeuf et l'ane gris.aac | 2023-12-28 07:52 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_28_07_30_01_Royal Philharmonic Orchestra with London Voices_He shall feed His flock.aac | 2023-12-28 07:49 | 3.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_28_07_30_01__ (2).aac | 2023-12-28 07:44 | 3.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_28_07_30_01_St. Thomas Choir, Leipzig_Ich Steh An Deiner Krippen Hier.aac | 2023-12-28 07:39 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_28_07_30_01_The Queen's Six_Gabriel's Message.aac | 2023-12-28 07:37 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_28_07_30_01__ (1).aac | 2023-12-28 07:35 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_16_30_02_The Trail Band_It Came Upon a Midnight Clear.aac | 2023-12-27 20:29 | 1.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_16_30_02_Trinity Cathedral Choir, Portland_The Linden Tree Carol.aac | 2023-12-27 20:27 | 3.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_16_30_02_Harrington String Quartet; Phoenix Chorale_The Ground (adapted from Sunrise Mass).aac | 2023-12-27 20:23 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_16_30_02_Westminster Choir College of Rider University_Twinkle, Twinkle Little Star.aac | 2023-12-27 20:19 | 2.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_16_30_02__.aac | 2023-12-27 20:16 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_16_30_02_Jessica Gordon, guitar_Ding Dong Merrily On High.aac | 2023-12-27 20:13 | 938K | |
![[ ]](/icons/unknown.gif) | 2023_12_27_16_30_02_Aulos Ensemble_Shepherds Shake Off Your Drowsy Sleep.aac | 2023-12-27 20:12 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_16_30_02_Sistine Chapel Choir_Adoramus te, Christe (We Adore Thee, Christ).aac | 2023-12-27 20:11 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_16_30_02_Singscape_Quem pastores.aac | 2023-12-27 20:08 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_16_30_02_Oklahoma Woodwind Quintet_Stille, Stille, Stille.aac | 2023-12-27 20:07 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_16_30_02_La Pieta_Noel Nouvelet (arr. Claude Gagnon).aac | 2023-12-27 20:04 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_16_30_02_Baltimore Consort_Wir singen dir, Immanuel (We sing unto You, Emmanuel).aac | 2023-12-27 20:01 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_16_30_02_1st Presb. Ft. Thomas Bell Choir_Angels We Have Heard on High.aac | 2023-12-27 19:59 | 658K | |
![[ ]](/icons/unknown.gif) | 2023_12_27_16_30_02_St. Paul's Cathedral Choir_There Is No Rose.aac | 2023-12-27 19:58 | 1.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_16_30_02_RIAS Chamber Choir_In der Christnacht.aac | 2023-12-27 19:56 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_16_30_02_Katherine Murdock, viola; Nathaniel Rosen, cello_Carol of the Bells.aac | 2023-12-27 19:52 | 846K | |
![[ ]](/icons/unknown.gif) | 2023_12_27_16_30_02_Seattle Pro Musica_Gedeonis Area(13th Cent French Conductus).aac | 2023-12-27 19:51 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_16_30_02_Bournemouth Sinfonietta_St. Paul's Suite, Opus 29 no 2- Mvmt 4 Finale (The Dargason).aac | 2023-12-27 19:48 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_16_30_02_Joshua Bell, violin; Thomas Bartlett, piano; Rob Moose, guit_I Want an Old Fashioned Christmas.aac | 2023-12-27 19:45 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_16_30_02_Yolanda Kondonassis, harp_Bring a Torch, Jeanette, Isabella.aac | 2023-12-27 19:41 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_16_30_02_The American Boychoir_A Boy was Born.aac | 2023-12-27 19:39 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_16_30_02_Cantus_Coventry Carol.aac | 2023-12-27 19:36 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_16_30_02_Young People's Chorus of New York_Silent Night.aac | 2023-12-27 19:34 | 2.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_16_30_02_Westminster Concert Bell Choir_Jesu, Joy of Man's Desiring (Cantata BWV 147).aac | 2023-12-27 19:31 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_16_30_02_Marc Gagnon, violin_El Noy de la Mare (Catalan traditional melody).aac | 2023-12-27 19:28 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_16_30_02_Emory Symphonic Winds_Greensleaves (arr. Alfred Reed).aac | 2023-12-27 19:25 | 3.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_16_30_02__ (5).aac | 2023-12-27 19:19 | 2.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_16_30_02_The Choir of Queens College, Cambridge_The Holly And The Ivy.aac | 2023-12-27 19:15 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_16_30_02_Monteverdi Choir_Es ist ein Ros' entsprungen (16th c. German).aac | 2023-12-27 19:12 | 2.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_16_30_02_Chanticleer_Spanish Carol.aac | 2023-12-27 19:08 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_16_30_02_Foothills Brass Quintet_Jesu Bambino.aac | 2023-12-27 19:07 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_16_30_02_Mainstreet Brass_Joseph lieber, Joseph mein (Brass Quintet).aac | 2023-12-27 19:04 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_16_30_02__ (4).aac | 2023-12-27 19:01 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_16_30_02_St. Thomas Choir, Leipzig_In Dulci Jubio.aac | 2023-12-27 18:59 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_16_30_02_Die Singphoniker_Nu zijt wellekome (You are Welcome).aac | 2023-12-27 18:56 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_16_30_02_Ensemble 94_Une jeune pucelle (A young virgin of noble heart...).aac | 2023-12-27 18:54 | 1.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_16_30_02_Arion_Noels- Amoroso.aac | 2023-12-27 18:52 | 2.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_16_30_02_Santa Fe Guitar Quartet_Terpsichore- Ballet (Guitar Quartet).aac | 2023-12-27 18:49 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_16_30_02_The Cambridge Singers_Ave Maria.aac | 2023-12-27 18:46 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_16_30_02_Vienna Boys Choir_Heiligste Nacht (Holiest Night).aac | 2023-12-27 18:43 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_16_30_02_City of Prague Orchestra_O Holy Night.aac | 2023-12-27 18:41 | 2.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_16_30_02_Pioneer Brass_From Every Spire on Christmas Eve.aac | 2023-12-27 18:36 | 1.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_16_30_02_BBC Concert Orchestra_Patapan (for Woodwinds).aac | 2023-12-27 18:34 | 962K | |
![[ ]](/icons/unknown.gif) | 2023_12_27_16_30_02_Eaken Piano Trio_Hansel & Gretel- Evening Prayer.aac | 2023-12-27 18:33 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_16_30_02_Seattle Pro Musica_Das Roslein, das ich meine.aac | 2023-12-27 18:30 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_16_30_02_Vasari Singers_Sweet was the song.aac | 2023-12-27 18:28 | 2.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_16_30_02_Musica Sacra_O Little Town Of Bethlehem.aac | 2023-12-27 18:23 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_16_30_02_ICAN Holiday_Cinnamon Bear- Chapter 9 - Rolly Polly Policeman.aac | 2023-12-27 18:20 | 8.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_16_30_02_Kay Johannsen, organ_Morgen kommt der Weihnachtsmann.aac | 2023-12-27 18:07 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_16_30_02_Emory Symphonic Winds_Christmas Day- Fantasy on Old Carols.aac | 2023-12-27 18:04 | 4.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_16_30_02_Sinfonia Cymru_Lullaby for Pegi.aac | 2023-12-27 17:58 | 2.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_16_30_02_Taverner Consort, Choir & Players_O Jesulein suss (O Sweet Jesus).aac | 2023-12-27 17:54 | 1.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_16_30_02__ (3).aac | 2023-12-27 17:52 | 2.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_16_30_02_Royal Philharmonic Orchestra_Once in royal David's city (arr. John Rutter).aac | 2023-12-27 17:48 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_16_30_02__ (2).aac | 2023-12-27 17:44 | 4.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_16_30_02_Tom Hanks; Brussels Philharmonic_The Polar Express Suite.aac | 2023-12-27 17:38 | 4.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_16_30_02_Rome Sinfonietta Orchestra_Ave Maria.aac | 2023-12-27 17:31 | 2.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_16_30_02_The Bekova Sisters_The Christmas Tree- Waltz.aac | 2023-12-27 17:28 | 2.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_16_30_02_Read by Artist in Residence Adam Eccleston_Together for Kwanzaa.aac | 2023-12-27 17:25 | 7.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_16_30_02_Westminster Choir College of Rider University_O Magnum Mysterium.aac | 2023-12-27 17:14 | 3.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_16_30_02_Robert Shaw Festival Singers_Glory to God in the Highest.aac | 2023-12-27 17:09 | 2.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_16_30_02_Vasari Singers_Of the Father's heart begotten.aac | 2023-12-27 17:04 | 2.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_16_30_02_Oregon Repertory Singers_Ave Maria.aac | 2023-12-27 17:01 | 4.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_16_30_02_Ensemble 94_Ou s'en vont ces gays bergers.aac | 2023-12-27 16:55 | 834K | |
![[ ]](/icons/unknown.gif) | 2023_12_27_16_30_02_Ensemble Galilei_God Rest Ye Merry, Gentlemen; Good King Wenceslas.aac | 2023-12-27 16:54 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_16_30_02_New York Pops_Adeste Fideles.aac | 2023-12-27 16:50 | 3.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_16_30_02__ (1).aac | 2023-12-27 16:46 | 3.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_16_30_02_The Cambridge Singers_Cherry Tree Carol.aac | 2023-12-27 16:41 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_16_30_02_RIAS Chamber Choir_Ich lag in tiefster Todesnacht.aac | 2023-12-27 16:39 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_16_30_02_Drottningholm Baroque Orchestra_Trumpet Concerto in D- Allegro.aac | 2023-12-27 16:36 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_12_02_19_Boston Pops Orchestra_L'Enfance du Christ- Shepherd's Chorus.aac | 2023-12-27 14:00 | 3.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_12_02_19_Academy of St Martin in the Fields_The Skaters Waltz (Les Patineurs), Opus 183.aac | 2023-12-27 13:55 | 6.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_12_02_19__.aac | 2023-12-27 13:46 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_12_02_19_Musica Intima_Huron Carol.aac | 2023-12-27 13:45 | 2.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_12_02_19_Phoenix Chorale_A Spotless Rose.aac | 2023-12-27 13:41 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_12_02_19__ (6).aac | 2023-12-27 13:38 | 4.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_12_02_19_La Pieta_Sleep Holy Infant - Lullaby.aac | 2023-12-27 13:31 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_12_02_19_Royal Ballet Sinfonia_Old Christmas Music- The First Mercy (after Peter Warlock).aac | 2023-12-27 13:27 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_12_02_19_The Cambridge Singers_The Shepherd's Carol.aac | 2023-12-27 13:23 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_12_02_19_Pomerium_Alma redemptoris mater a 4.aac | 2023-12-27 13:21 | 3.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_12_02_19_Seattle Pro Musica_Wachet auf, ruft uns die Stimme.aac | 2023-12-27 13:15 | 798K | |
![[ ]](/icons/unknown.gif) | 2023_12_27_12_02_19__ (5).aac | 2023-12-27 13:14 | 1.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_12_02_19_Bengt Forsberg, piano_English Folk Song- So Blest A Sight.aac | 2023-12-27 13:13 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_12_02_19_Monteverdi Choir_Alma Redemptoris Mater (16th century).aac | 2023-12-27 13:10 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_12_02_19_Baltimore Consort_Christmas Day in the Morning.aac | 2023-12-27 13:06 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_12_02_19_West Edge String Quartet_The First Nowell.aac | 2023-12-27 13:03 | 2.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_12_02_19__ (4).aac | 2023-12-27 12:59 | 3.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_12_02_19_Solid Brass_Suite of Medieval Carols.aac | 2023-12-27 12:55 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_12_02_19_London Baroque_Canzona - Aria.aac | 2023-12-27 12:52 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_12_02_19_Portland Brass Quintet_Il est bel et bon (French chanson).aac | 2023-12-27 12:49 | 846K | |
![[ ]](/icons/unknown.gif) | 2023_12_27_12_02_19_Christopher Parkening, guitar_Infant Holy, Infant Lowly (Polish Carol).aac | 2023-12-27 12:47 | 2.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_12_02_19_Oregon Repertory Singers_Ave Maria.aac | 2023-12-27 12:44 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_12_02_19__ (3).aac | 2023-12-27 12:41 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_12_02_19_University of British Columbia Singers_Lullay My Liking.aac | 2023-12-27 12:39 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_12_02_19__ (2).aac | 2023-12-27 12:36 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_12_02_19_The Sixteen_Faire is the heaven.aac | 2023-12-27 12:34 | 3.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_12_02_19__ (1).aac | 2023-12-27 12:28 | 2.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_12_02_19_BBC Concert Orchestra_Carols for Woodwinds- Angels in our Fields.aac | 2023-12-27 12:24 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_12_02_19_Brent Mason, guitar; Mark Casstevens, guitar; John Jarvis, p_O Christmas Tree (arr. Mark O'Connor).aac | 2023-12-27 12:21 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_12_02_19_ICAN Holiday_Cinnamon Bear- Chapter 9 - Rolly Polly Policeman.aac | 2023-12-27 12:19 | 8.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_12_02_19_St. Paul's Cathedral Choir_Ding dong! merrily on high (arr. Mack Wilberg).aac | 2023-12-27 12:06 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_07_30_01_Chamber Orchestra Kremlin_The Seasons- December- Christmas.aac | 2023-12-27 09:28 | 3.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_07_30_01_Chicago Symphony_Messiah- -I know that my Redeemer liveth-.aac | 2023-12-27 09:23 | 5.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_07_30_01_RIAS Chamber Choir_Let us rock the little child.aac | 2023-12-27 09:16 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_07_30_01_24 Cellos of the London Sound_Introit- Once in Royal David's City.aac | 2023-12-27 09:14 | 2.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_07_30_01_Vasari Singers_Sing Lullaby.aac | 2023-12-27 09:10 | 2.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_07_30_01_Musica Sacra_Patapan.aac | 2023-12-27 09:07 | 918K | |
![[ ]](/icons/unknown.gif) | 2023_12_27_07_30_01_Lahti Symphony Orchestra_The Bells of Christmas.aac | 2023-12-27 09:01 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_07_30_01_Heartstrings (Oregon-based ens.)_Joy To The World.aac | 2023-12-27 08:56 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_07_30_01_La Pieta_The Bells of Christmas (adapt. Antoine Bareil).aac | 2023-12-27 08:54 | 2.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_07_30_01_Katherine Murdock, viola; Nathaniel Rosen, cello_When Christmas Morn Was Dawning.aac | 2023-12-27 08:50 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_07_30_01_Anonymous 4_Greene growith the holy.aac | 2023-12-27 08:48 | 2.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_07_30_01_Seattle Pro Musica_Marias Kirchgang (Mary's trip to the church).aac | 2023-12-27 08:45 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_07_30_01_Ensemble 94_O nous dites Marie (Now tell us, Mary).aac | 2023-12-27 08:42 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_07_30_01_Ronn McFarlane, lute_Airs for the Winter- The Laurel.aac | 2023-12-27 08:40 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_07_30_01_Bengt Forsberg, piano_The Three Mummers.aac | 2023-12-27 08:19 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_07_30_01_Polyphony_O Magnum Mysterium.aac | 2023-12-27 08:12 | 4.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_07_30_01_University of Portland Singers_The Wexford Carol.aac | 2023-12-27 08:06 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_07_30_01_Gabrieli Consort & Players_Christmas Mass- Sonata.aac | 2023-12-27 08:03 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_07_30_01_Baltimore Consort_The Cherry Tree Carol.aac | 2023-12-27 08:00 | 3.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_07_30_01_Eaken Piano Trio_Gesu Bambino (Piano Trio).aac | 2023-12-27 07:55 | 3.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_07_30_01_West Edge String Quartet_A La Media Noche-De Tierra Lajana Venimos.aac | 2023-12-27 07:50 | 3.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_07_30_01_Prague Philharmonic Orchestra_Bethlehem Down.aac | 2023-12-27 07:45 | 2.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_07_30_01_Gabrieli Consort of Venice_O Sacrum Convivium.aac | 2023-12-27 07:41 | 3.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_27_07_30_01_Stile Antico_Cantiones sacrae II- Laudibus in sanctis.aac | 2023-12-27 07:36 | 3.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_26_16_30_02_La Pieta_Laissez Paitre Vos Betes (Noel Bressan) (arr. Claude Gagnon).aac | 2023-12-26 20:28 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_26_16_30_02_Renaissonics_Joseph, lieber Joseph mein.aac | 2023-12-26 20:25 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_26_16_30_02_Portland State Chamber Choir_O Salutaris Hostia.aac | 2023-12-26 20:22 | 2.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_26_16_30_02_Orpheus Vocal Ensemble; Ars Antiqua Austria_Ave maris stella (Hail, queen of the stars).aac | 2023-12-26 20:18 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_26_16_30_02_St. Paul's Cathedral Choir_I Sing of a Maiden.aac | 2023-12-26 20:15 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_26_16_30_02_West Edge String Quartet_Today in Bethlehem.aac | 2023-12-26 20:12 | 3.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_26_16_30_02_Synergy Brass Quintet_Ding Dong Merrily On High.aac | 2023-12-26 20:08 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_26_16_30_02_The Choral Project_Caroling, Caroling.aac | 2023-12-26 20:06 | 1.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_26_16_30_02_Rome Sinfonietta Orchestra_Maria, che dolce nome (Mary, how sweet a name).aac | 2023-12-26 20:04 | 2.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_26_16_30_02_Eaken Piano Trio_The Sussex Mummers' Christmas Carol.aac | 2023-12-26 20:00 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_26_16_30_02_Renaissonics_Gaytas.aac | 2023-12-26 19:57 | 802K | |
![[ ]](/icons/unknown.gif) | 2023_12_26_16_30_02_New York Polyphony_Quem Pastores Laudavere (arr. Susan LaBarr).aac | 2023-12-26 19:56 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_26_16_30_02_Choir of Gonville & Caius College, Cambridge_Rocking (Czech Carol, arr. Edward Higginbottom).aac | 2023-12-26 19:54 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_26_16_30_02_Christopher Parkening, guitar_Sheep May Safely Graze.aac | 2023-12-26 19:52 | 3.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_26_16_30_02_Billy Oskay, harmonium; Dagny Regan, oboe_Il est ne le divin enfant (the Divine Infant is Born).aac | 2023-12-26 19:47 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_26_16_30_02_Sonos Handbell Choir_Austrian Carol.aac | 2023-12-26 19:43 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_26_16_30_02_Vienna Boys Choir_O Tannenbaum (O Christmas Tree).aac | 2023-12-26 19:34 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_26_16_30_02_Capricorn_Jesu, Joy Of Man's Desiring.aac | 2023-12-26 19:33 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_26_16_30_02_Brent Mason, guitar; Mark Casstevens, guitar; John Jarvis, p_We Wish You a Merry Christmas (arr. O'Connor).aac | 2023-12-26 19:30 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_26_16_30_02_Aulos Ensemble_Noel Etranger.aac | 2023-12-26 19:28 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_26_16_30_02_In Mulieribus (Portland ens.)_There is no rose of such virtue.aac | 2023-12-26 19:22 | 3.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_26_16_30_02_Pittsburgh Symphony Brass_Bring a Torch, Jeanette, Isabella.aac | 2023-12-26 19:12 | 942K | |
![[ ]](/icons/unknown.gif) | 2023_12_26_16_30_02_Grex Vocalis_Kling no klokka (The bells ring, they sound).aac | 2023-12-26 19:10 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_26_16_30_02_Kampin Laulu Chamber Choir_Ecce novum gaudium (Behold the new Joy).aac | 2023-12-26 19:08 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_26_16_30_02_Synergy Brass Quintet_Joy To The World.aac | 2023-12-26 19:06 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_26_16_30_02_Seraphic Fire_Once As I Remember (arr. Charles Wood).aac | 2023-12-26 19:03 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_26_16_30_02_Pavao String Quartet_Carol (arr. Carlo Martelli).aac | 2023-12-26 19:01 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_26_16_30_02_Christopher Parkening, guitar_El Noi de la Mare (Son of the Virgin).aac | 2023-12-26 18:59 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_26_16_30_02_Pomerium_Preter rerum seriem.aac | 2023-12-26 18:56 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_26_16_30_02_Portland Revels_The Holly and the Ivy (Herefordshire variant).aac | 2023-12-26 18:53 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_26_16_30_02_The American Boychoir_Candlelight Carol.aac | 2023-12-26 18:50 | 2.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_26_16_30_02_London Symphony Brass_Canzon septimi e octavi toni, a 12.aac | 2023-12-26 18:46 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_26_16_30_02_Renaissonics_Piva.aac | 2023-12-26 18:43 | 1.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_26_16_30_02_West Edge String Quartet_Lo, How A Rose E'er Bloming.aac | 2023-12-26 18:42 | 2.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_26_16_30_02_Eaken Piano Trio_The Nutcracker- Waltz of the Flowers.aac | 2023-12-26 18:38 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_26_16_30_02_Cantus_Nowell! Nowell! This is the Salutacion.aac | 2023-12-26 18:35 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_26_16_30_02_Hamburg Soloists_Christmas Aria.aac | 2023-12-26 18:33 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_26_16_30_02_Canadian Brass_The Holly and the Ivy.aac | 2023-12-26 18:30 | 1.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_26_16_30_02_Katherine Murdock, viola; Nathaniel Rosen, cello_Deck the Hall.aac | 2023-12-26 18:15 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_26_16_30_02_St. Paul's Cathedral Choir_A New Year Carol.aac | 2023-12-26 18:13 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_26_16_30_02_Slovak Philharmonic Orchestra_Lieutenant Kije Suite- Troika.aac | 2023-12-26 18:10 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_26_16_30_02_Baltimore Consort_Drive the Cold Winter Away.aac | 2023-12-26 18:07 | 2.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_26_16_30_02_Pittsburgh Symphony Low Brass_Petites Litanies de Jesus.aac | 2023-12-26 18:03 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_26_16_30_02_Westminster Choir, Rider University, NY_Dans cette etable.aac | 2023-12-26 18:01 | 1.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_26_16_30_02_Bournemouth Sinfonietta_St. Paul's Suite, Opus 29 no 2- Mvmt 4 Finale (The Dargason).aac | 2023-12-26 17:59 | 2.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_26_16_30_02_Toronto Chamber Orchestra_The Four Seasons- Winter- Largo.aac | 2023-12-26 17:56 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_26_16_30_02_Mxolisi & the Sankofa Singers_Harambee! Let's Pull Together!.aac | 2023-12-26 17:51 | 5.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_26_16_30_02_Karen Malina White and Bunny Hull_Bunny Hull- A Family Kwanzaa Story.aac | 2023-12-26 17:42 | 5.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_26_16_30_02_Katherine Dines_The Origin of Kwanzaa.aac | 2023-12-26 17:34 | 3.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_26_16_30_02_James 'pj' Spraggins_Jingle Bells (St. Lucia Style).aac | 2023-12-26 17:29 | 2.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_26_16_30_02_All Classical Portland's Artist in Residence_Adam Eccelston ICAN Holiday Concert.aac | 2023-12-26 17:25 | 9.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_26_16_30_02_Mxolisi & the Sankofa Singers_Habari Gani - Seven Days of Kwanzaa.aac | 2023-12-26 17:12 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_26_16_30_02_Fanoko Singers_Happy Kwanzaa.aac | 2023-12-26 17:08 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_26_16_30_02_GUITAR_Ahlinhan (from Benin).aac | 2023-12-26 17:05 | 962K | |
![[ ]](/icons/unknown.gif) | 2023_12_26_16_30_02_Aulos Ensemble_Shepherds Shake Off Your Drowsy Sleep.aac | 2023-12-26 17:02 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_26_16_30_02_University of Portland Singers_Jesus, Jesus Rest Your Head (Appalachian).aac | 2023-12-26 17:00 | 2.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_26_16_30_02_Malle Babbe Women's Choir_Der Englische Gruss (The Annunciation).aac | 2023-12-26 16:56 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_26_16_30_02_Oregon Repertory Singers_How Sweet Is love (Dutch carol).aac | 2023-12-26 16:45 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_26_16_30_02_Chanticleer_The Three Kings.aac | 2023-12-26 16:43 | 2.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_26_16_30_02_Seattle Pro Musica_Lob, ehr ser Gott, dem Vater.aac | 2023-12-26 16:37 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_26_16_30_02_London Symphony Brass_Canzon II a 4 for brass.aac | 2023-12-26 16:35 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_26_16_30_02_Arion_Noels- Amoroso.aac | 2023-12-26 16:32 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_26_07_30_01_New York Pops_Carol of the Drum.aac | 2023-12-26 09:25 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_26_07_30_01_Sinfonia Cymru_Lullaby for Ana Gwen.aac | 2023-12-26 09:20 | 3.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_26_07_30_01_Christopher Parkening, guitar_Infant Holy, Infant Lowly (Polish Carol).aac | 2023-12-26 09:15 | 2.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_26_07_30_01_Malle Babbe Women's Choir_Maria durch ein Dornwald ging.aac | 2023-12-26 09:12 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_26_07_30_01_Cappella SF (San Francisco)_Psallite unigenito (Sing Psalms).aac | 2023-12-26 09:09 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_26_07_30_01_Oklahoma Woodwind Quintet_Rise, Come and See The King.aac | 2023-12-26 09:08 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_26_07_30_01_Pioneer Brass_The Holly and the Ivy.aac | 2023-12-26 09:05 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_26_07_30_01_Pittsburgh Symphony Brass_Volte.aac | 2023-12-26 09:04 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_26_07_30_01_Slovak Radio Symphony Orchestra_The Seasons- Winter- Ice.aac | 2023-12-26 08:55 | 918K | |
![[ ]](/icons/unknown.gif) | 2023_12_26_07_30_01_St. Paul's Cathedral Choir_All Bells in Paradise.aac | 2023-12-26 08:21 | 3.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_26_07_30_01_Bengt Forsberg, piano_English Folk Song- So Blest A Sight.aac | 2023-12-26 08:15 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_26_07_30_01_Canadian Brass_Little Fantasy on -The Twelve Days of Christmas-.aac | 2023-12-26 08:12 | 2.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_26_07_30_01_Cherwell Singers_A Child This Day Is Born.aac | 2023-12-26 08:09 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_26_07_30_01_Taverner Choir_Chant- Antiphon from Chester Processional.aac | 2023-12-26 08:06 | 694K | |
![[ ]](/icons/unknown.gif) | 2023_12_26_07_30_01_Vienna Boys Choir_O du stille Zeit.aac | 2023-12-26 07:58 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_26_07_30_01_City of London Sinfonia_There is a Flower.aac | 2023-12-26 07:56 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_26_07_30_01_The American Boychoir_I sing of a maiden.aac | 2023-12-26 07:52 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_26_07_30_01_Foothills Brass Quintet_Noel Nouvolet..Sing We Now Of Christmas.aac | 2023-12-26 07:49 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_26_07_30_01_Les Boreades de Montreal_Bon Joseph ecoute moy (Good Joseph Listen to Me).aac | 2023-12-26 07:47 | 3.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_26_07_30_01_Chamber Orchestra Kremlin_The Seasons- December- Christmas.aac | 2023-12-26 07:42 | 3.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_26_07_30_01_Schola Cantorum of Saint Peter's in the Loop_Gloria.aac | 2023-12-26 07:38 | 5.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_25_16_30_01_St. Paul's Cathedral Choir_Gaudete! (medieval melody).aac | 2023-12-25 20:28 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_25_16_30_01_Baltimore Consort_In dir ist Freude (In you is Joy).aac | 2023-12-25 20:27 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_25_16_30_01_Bengt Forsberg, piano_English Folk Song- So Blest A Sight.aac | 2023-12-25 20:19 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_25_16_30_01_City of Prague Orchestra_O Holy Night.aac | 2023-12-25 20:14 | 2.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_25_16_30_01_The Queen's Six_Corpus Christi Carol.aac | 2023-12-25 20:10 | 2.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_25_16_30_01_Singscape_Quem pastores.aac | 2023-12-25 20:06 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_25_16_30_01_Royal Philharmonic_El Noi de la Mare (Son of the Virgin).aac | 2023-12-25 20:05 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_25_16_30_01_The Carillon Brass_European Carol Medley (arr. Arthur Frackenpohl).aac | 2023-12-25 20:01 | 2.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_25_16_30_01_The Cambridge Singers_Once As I Remember (Italian Carol).aac | 2023-12-25 19:55 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_25_16_30_01_Seattle Pro Musica_Das Roslein, das ich meine.aac | 2023-12-25 19:53 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_25_16_30_01_Vienna Boys Choir_Stille, Stille, Stille (Austrian).aac | 2023-12-25 19:51 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_25_16_30_01_West Edge String Quartet_Carol of the Bells.aac | 2023-12-25 19:49 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_25_16_30_01_Renaissonics_Fum, Fum, Fum.aac | 2023-12-25 19:47 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_25_16_30_01_24 Cellos of the London Sound_Introit- Once in Royal David's City.aac | 2023-12-25 19:45 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_25_16_30_01_Die Singphoniker_Still, o Himmel (Hush o Heaven - Bavarian carol).aac | 2023-12-25 19:41 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_25_16_30_01_Musica Sacra_Did Mary Know-.aac | 2023-12-25 19:39 | 2.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_25_16_30_01_Portland Brass Quintet_Il est bel et bon (French chanson).aac | 2023-12-25 19:29 | 846K | |
![[ ]](/icons/unknown.gif) | 2023_12_25_16_30_01_Aulos Ensemble_When Christ Was Born On Earth.aac | 2023-12-25 19:24 | 2.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_25_16_30_01_Choral Scholars of University College Dublin; Irish Chamber_The Adoration of the Magi (orch. Earley).aac | 2023-12-25 19:20 | 4.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_25_16_30_01_Lahti Symphony Orchestra_The Bells of Christmas.aac | 2023-12-25 19:14 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_25_16_30_01_City of London Sinfonia_Christmas Night (French Carol).aac | 2023-12-25 19:05 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_25_16_30_01_Gabrieli Consort & Players_Christmas Mass- Sanctus motet.aac | 2023-12-25 19:01 | 4.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_25_16_30_01_The Choir of Royal Holloway_Coventry Carol (arr. Ola Gjeilo).aac | 2023-12-25 18:55 | 2.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_25_16_30_01_St. Paul's Cathedral Choir_O Come, All Ye Faithful (arr. David Willcocks).aac | 2023-12-25 18:51 | 2.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_25_16_30_01_London Baroque_Canzona - Aria.aac | 2023-12-25 18:48 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_25_16_30_01_Gloriae Dei Cantores_A Child's Welcome (From A Celebration Of Carols).aac | 2023-12-25 18:45 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_25_16_30_01_Baltimore Consort_Christmas Day in the Morning.aac | 2023-12-25 18:42 | 2.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_25_16_30_01_La Pieta_Laissez Paitre Vos Betes (Noel Bressan) (arr. Claude Gagnon).aac | 2023-12-25 18:37 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_25_16_30_01_The American Boychoir_Christmas Day- Fantasy on Old Carols.aac | 2023-12-25 18:35 | 4.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_25_16_30_01_Wizzard_I wish it could be Christmas Everyday.aac | 2023-12-25 17:10 | 3.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_25_16_30_01_Kansas City Chorale_The Holy Infant's Lullaby.aac | 2023-12-25 17:05 | 3.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_25_16_30_01_St. Paul's Cathedral Choir_Coventry Carol (Lully, Lulla, Lullay).aac | 2023-12-25 17:00 | 3.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_25_16_30_01_West Edge String Quartet_A La Media Noche-De Tierra Lajana Venimos.aac | 2023-12-25 16:56 | 3.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_25_16_30_01_Renaissonics_Quando nascette Ninno.aac | 2023-12-25 16:51 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_25_16_30_01_Raymond Mase, trumpet; Fred Sherry, cello; Anne-Marie McDerm_A Christmas Medley (Joy to the World, & more).aac | 2023-12-25 16:48 | 4.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_25_16_30_01_Choir of King's College, Cambridge_I Saw a Maiden.aac | 2023-12-25 16:42 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_25_16_30_01_In Mulieribus (Portland ens.)_Ther is no rose of swych vertu (15th c.).aac | 2023-12-25 16:39 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_25_16_30_01_City of London Sinfonia_Dormi Jesu.aac | 2023-12-25 16:35 | 3.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_25_07_30_02_Oklahoma Woodwind Quintet_Christmas Carol Medley.aac | 2023-12-25 09:29 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_25_07_30_02_Mandy Dickson_Bless Us All (The Muppet Christmas Carol).aac | 2023-12-25 09:22 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_25_07_30_02_Royal Philharmonic Orchestra with London Voices_He shall feed His flock.aac | 2023-12-25 09:19 | 3.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_25_07_30_02_Choral Scholars of University College Dublin; Irish Chamber_Curoo Curoo.aac | 2023-12-25 09:14 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_25_07_30_02_Ryan Shore_Tiny Christmas.aac | 2023-12-25 09:11 | 670K | |
![[ ]](/icons/unknown.gif) | 2023_12_25_07_30_02_London Symphony Brass_Canzon II a 4 for brass.aac | 2023-12-25 09:10 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_25_07_30_02_Canadian Brass_Joy to the World.aac | 2023-12-25 09:06 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_25_07_30_02_The American Boychoir_Missa Brevis- Veni Redemptor.aac | 2023-12-25 09:05 | 1.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_25_07_30_02_Arion_Noels- Amoroso.aac | 2023-12-25 09:03 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_25_07_30_02_Santa Fe Guitar Quartet_Terpsichore- Ballet (Guitar Quartet).aac | 2023-12-25 09:01 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_25_07_30_02_Bengt Forsberg, piano_Villancico Vasco (Basque Carol).aac | 2023-12-25 08:59 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_25_07_30_02_Monteverdi Choir_Gloria in excelsis Deo (16th century).aac | 2023-12-25 08:57 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_25_07_30_02_Musica Fiata_Jubiliret Frohlich (Canzona in 8 parts).aac | 2023-12-25 08:55 | 3.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_25_07_30_02_BBC Concert Orchestra_Patapan (for Woodwinds).aac | 2023-12-25 08:50 | 962K | |
![[ ]](/icons/unknown.gif) | 2023_12_25_07_30_02_Eduard Laurel, piano_Toy Soldier March.aac | 2023-12-25 08:49 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_25_07_30_02_Taverner Consort_Christmas Eve.aac | 2023-12-25 08:47 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_25_07_30_02_Taverner Consort_Blessed Be That Maid Mary.aac | 2023-12-25 08:32 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_25_07_30_02_St. George's Chapel Choir, Windsor_The Shepherd Men (Choral music).aac | 2023-12-25 08:30 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_25_07_30_02_Boston Baroque_Ich danke Dir ewiglich.aac | 2023-12-25 08:27 | 1.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_25_07_30_02_West Edge String Quartet_A La Nanita Nana (Lullaby).aac | 2023-12-25 08:25 | 2.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_25_07_30_02_Canadian Brass_Or Let the Merry Bells Ring 'Round.aac | 2023-12-25 08:12 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_25_07_30_02_The Muddy River Morris Team_Constant Billy.aac | 2023-12-25 08:09 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_25_07_30_02_Los Angeles Guitar Quartet_Nutcracker Suite, Opus 71a- Waltz of the Flowers.aac | 2023-12-25 08:08 | 3.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_25_07_30_02_Robert Shaw Festival Singers_Four Motets for Christmas- Seeing the Star.aac | 2023-12-25 08:02 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_25_07_30_02_Musica Intima_Huron Carol.aac | 2023-12-25 07:59 | 2.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_25_07_30_02_Seattle Pro Musica_Ave Maria.aac | 2023-12-25 07:56 | 2.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_25_07_30_02_Members of the Vienna Philharmonic_It Came Upon a Midnight Clear.aac | 2023-12-25 07:53 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_25_07_30_02_De Organographia_Hark! The Herald Angels Sing (4 trombones).aac | 2023-12-25 07:51 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_25_07_30_02_Royal Ballet Sinfonia_Waltz for Strings.aac | 2023-12-25 07:49 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_25_07_30_02_Bournemouth Symphony Orchestra_Traditional Slavic Christmas Music.aac | 2023-12-25 07:46 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_25_07_30_02_City of London Choir_There is no Rose, Opus 14.aac | 2023-12-25 07:43 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_25_07_30_02_SarahZ_Mindful Moment- Scent Meditation.aac | 2023-12-25 07:34 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_25_07_30_02_Kay Johannsen, organ_Wie soll ich dich empfangen (How shall I receive thee).aac | 2023-12-25 07:33 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_24_16_30_01_Robert Shaw Chamber Singers_Alleluia.aac | 2023-12-24 20:28 | 3.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_24_16_30_01_The Choir of Queens College, Cambridge_The Holly And The Ivy.aac | 2023-12-24 20:24 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_24_16_30_01_Eric Robertson, organ_O Come, All Ye Faithful & Joy to the World.aac | 2023-12-24 20:15 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_24_16_30_01_Mainstreet Brass_Joseph lieber, Joseph mein (Brass Quintet).aac | 2023-12-24 20:12 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_24_16_30_01_Vasari Singers_I believe in Father Christmas (arr. Jonathan Rathbone).aac | 2023-12-24 20:07 | 2.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_24_16_30_01_Voices of Ascension_Missa Papae Marcelli- Agnus Dei.aac | 2023-12-24 20:03 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_24_16_30_01_Chanticleer_The First Nowell.aac | 2023-12-24 20:00 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_24_16_30_01_Bengt Forsberg, piano_The Three Mummers.aac | 2023-12-24 19:57 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_24_16_30_01_Philharmonia Orchestra_The Nutcracker- Dance of the Sugar Plum Fairy.aac | 2023-12-24 19:54 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_24_16_30_01_SWR Radio Orch Kaiserslautern_Christmas Oratorio- Sinfonia.aac | 2023-12-24 19:52 | 3.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_24_16_30_01_De Organographia_Tomorrow shall be my dancing day.aac | 2023-12-24 19:47 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_24_16_30_01_Anonymous 4_Awake, and join the cheerful choir.aac | 2023-12-24 19:45 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_24_16_30_01_RIAS Chamber Choir_Our blessed Lady dreams.aac | 2023-12-24 19:40 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_24_16_30_01_Arsys Bourgogne_Les anges dans nos campagnes.aac | 2023-12-24 19:38 | 2.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_24_16_30_01_Vincent Boucher, organ_Wachet auf, ruft uns die Stimme (Sleepers Awake).aac | 2023-12-24 19:35 | 2.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_24_16_30_01_Oklahoma Woodwind Quintet_Rise, Come and See The King.aac | 2023-12-24 19:31 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_24_16_30_01_Royal Philharmonic Orchestra with London Voices_He shall feed His flock.aac | 2023-12-24 19:28 | 3.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_24_16_30_01_The Cambridge Singers_Blessed Be That Maid Mary.aac | 2023-12-24 19:21 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_24_16_30_01_City of London Sinfonia_Love Came Down At Christmas.aac | 2023-12-24 19:18 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_24_16_30_01_University of Portland Singers_Austrian Carol Medley (arr. Michael Connolly).aac | 2023-12-24 19:16 | 5.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_24_16_30_01_24 Cellos of the London Sound_The Nutcracker - Pas de Deux.aac | 2023-12-24 19:08 | 3.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_24_16_30_01_Pittsburgh Symphony Brass_Volte.aac | 2023-12-24 19:03 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_24_16_30_01_Empire Brass_Sheep May Safely Graze (Cantata BWV 208).aac | 2023-12-24 19:01 | 3.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_24_16_30_01_The King's Singers_Lux Aurumque (Light and Gold).aac | 2023-12-24 18:56 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_24_16_30_01_Vienna Boys Choir_Auf dem Berge, da wehet der Wind (Wind Blows on the Mountain.aac | 2023-12-24 18:52 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_24_16_30_01_Oregon Ballet Theatre Orchestr_The Nutcracker- Overture.aac | 2023-12-24 18:50 | 2.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_24_16_30_01_Capella Istropolitana_German Dances, K.605- No.3 -Sleigh Ride-.aac | 2023-12-24 18:47 | 2.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_24_16_30_01_Young People's Chorus of New York_Silent Night.aac | 2023-12-24 18:43 | 2.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_24_16_30_01_Los Angeles Guitar Quartet_Nutcracker Suite, Opus 71a- Waltz of the Flowers.aac | 2023-12-24 18:40 | 3.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_24_16_30_01_Empire Brass_Make a Joyful Noise.aac | 2023-12-24 18:34 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_24_16_30_01_Portland Symphonic Choir_Vespers, Op 37- (6) Rejoice, O Virgin.aac | 2023-12-24 18:30 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_24_16_30_01_Katherine Murdock, viola; Nathaniel Rosen, cello_Angels' Carol.aac | 2023-12-24 18:27 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_24_16_30_01_Pro Arte Singers_Give good gifts to one another.aac | 2023-12-24 18:11 | 2.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_24_16_30_01_Vermont Symphony Brass Quintet_Christmas Crackers II (Medley).aac | 2023-12-24 18:07 | 2.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_24_16_30_01_Schwerin Brass Player Collegium_Christmas Tree Suite- Psallite (arr. brass and timpani).aac | 2023-12-24 18:03 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_24_16_30_01_Baltimore Consort_Christmas Day in the Morning.aac | 2023-12-24 18:01 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_24_16_30_01_Scottish National Orchestra_Christmas Eve Suite.aac | 2023-12-24 17:52 | 20M | |
![[ ]](/icons/unknown.gif) | 2023_12_24_16_30_01_Slovak Philharmonic Orchestra_The Nutcracker- Dance of the Toy Flutes.aac | 2023-12-24 17:23 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_24_16_30_01_Slovak Philharmonic Orchestra_The Nutcracker- Act II, Tableau I. March.aac | 2023-12-24 17:09 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_24_16_30_01_Les Boreades de Montreal_Bon Joseph ecoute moy (Good Joseph Listen to Me).aac | 2023-12-24 17:02 | 3.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_24_16_30_01_Boston Pops Orchestra_Christmas Waltz.aac | 2023-12-24 16:57 | 3.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_24_16_30_01_Vasari Singers_The Christ-child.aac | 2023-12-24 16:53 | 3.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_24_16_30_01_Taylor Festival Choir & Players_This Evenfall 'tis Snowing.aac | 2023-12-24 16:48 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_24_16_30_01_Empire Brass_Three Chorales.aac | 2023-12-24 16:44 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_24_16_30_01_Pavao String Quartet_Shepherd's Farewell (arr. Carlo Martelli).aac | 2023-12-24 16:41 | 3.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_24_16_30_01_De Organographia_Hark! The Herald Angels Sing (4 trombones).aac | 2023-12-24 16:36 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_24_16_30_01_Christopher Parkening, guitar_Gesu Bambino.aac | 2023-12-24 16:34 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_24_07_33_31_In Mulieribus (Portland ens.)_Ave Maria.aac | 2023-12-24 09:27 | 1.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_24_07_33_31_Tafelmusik Baroque Orchestra_Messiah- Rejoice greatly, O daughter of Zion.aac | 2023-12-24 09:25 | 3.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_24_07_33_31_Pavao String Quartet_Christmas Medley (arr. Carlo Martelli).aac | 2023-12-24 09:20 | 4.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_24_07_33_31_New York Polyphony_There is no Rose.aac | 2023-12-24 09:14 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_24_07_33_31_BBC Concert Orchestra_A Musical Sleigh Ride.aac | 2023-12-24 09:12 | 3.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_24_07_33_31_Polyphony_Lullay (from Stella Natalis - Star of the Nativity).aac | 2023-12-24 09:04 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_24_07_33_31_The King's Noyse_The New Year's gift.aac | 2023-12-24 09:00 | 762K | |
![[ ]](/icons/unknown.gif) | 2023_12_24_07_33_31_Malle Babbe Women's Choir_Ave Maria (16th century setting).aac | 2023-12-24 08:57 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_24_07_33_31_RIAS Chamber Choir_Schlaf, mein Kindelein (Sleep, my little child).aac | 2023-12-24 08:56 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_24_07_33_31_The American Boychoir_Missa Brevis- Gloria.aac | 2023-12-24 08:53 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_24_07_33_31_Czech Radio Symphony Orchestra_Gaelic Lullaby.aac | 2023-12-24 08:46 | 2.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_24_07_33_31_Choir of Gonville & Caius College, Cambridge_Ave Maria.aac | 2023-12-24 08:42 | 3.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_24_07_33_31_Tom Hanks; Brussels Philharmonic_The Polar Express Suite.aac | 2023-12-24 08:14 | 4.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_24_07_33_31_Choir of King's College, Cambridge_Angels from the Realms of Glory.aac | 2023-12-24 08:03 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_24_07_33_31_Mainstreet Brass_Gloucestershire Wassail (arr. Brass Quintet).aac | 2023-12-24 07:58 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_24_07_33_31_Katherine Murdock, viola; Nathaniel Rosen, cello_Good King Wenceslas.aac | 2023-12-24 07:56 | 634K | |
![[ ]](/icons/unknown.gif) | 2023_12_24_07_33_31_Kay Johannsen, organ_Wie soll ich dich empfangen (How shall I receive thee).aac | 2023-12-24 07:55 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_24_07_33_31_Portland Revels_Comes the Morning.aac | 2023-12-24 07:43 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_24_07_33_31_In Mulieribus (Portland ens.)_There is no rose of such virtue.aac | 2023-12-24 07:39 | 3.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_23_16_30_01_La Pieta_Laissez Paitre Vos Betes (Noel Bressan) (arr. Claude Gagnon).aac | 2023-12-23 20:25 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_23_16_30_01_Renaissonics_Joseph, lieber Joseph mein.aac | 2023-12-23 20:23 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_23_16_30_01_Portland State Chamber Choir_O Salutaris Hostia.aac | 2023-12-23 20:19 | 2.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_23_16_30_01_Orpheus Vocal Ensemble; Ars Antiqua Austria_Ave maris stella (Hail, queen of the stars).aac | 2023-12-23 20:15 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_23_16_30_01_St. Paul's Cathedral Choir_I Sing of a Maiden.aac | 2023-12-23 20:12 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_23_16_30_01_West Edge String Quartet_Today in Bethlehem.aac | 2023-12-23 20:10 | 2.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_23_16_30_01_Synergy Brass Quintet_Ding Dong Merrily On High.aac | 2023-12-23 20:06 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_23_16_30_01_Rome Sinfonietta Orchestra_Maria, che dolce nome (Mary, how sweet a name).aac | 2023-12-23 20:03 | 2.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_23_16_30_01_Eaken Piano Trio_The Sussex Mummers' Christmas Carol.aac | 2023-12-23 19:59 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_23_16_30_01_Renaissonics_Gaytas.aac | 2023-12-23 19:56 | 798K | |
![[ ]](/icons/unknown.gif) | 2023_12_23_16_30_01_New York Polyphony_Quem Pastores Laudavere (arr. Susan LaBarr).aac | 2023-12-23 19:55 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_23_16_30_01_Choir of Gonville & Caius College, Cambridge_Rocking (Czech Carol, arr. Edward Higginbottom).aac | 2023-12-23 19:53 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_23_16_30_01_Christopher Parkening, guitar_Sheep May Safely Graze.aac | 2023-12-23 19:51 | 3.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_23_16_30_01_Billy Oskay, harmonium; Dagny Regan, oboe_Il est ne le divin enfant (the Divine Infant is Born).aac | 2023-12-23 19:46 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_23_16_30_01_Sonos Handbell Choir_Austrian Carol.aac | 2023-12-23 19:42 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_23_16_30_01_Pioneer Brass_I Wonder As I Wander.aac | 2023-12-23 19:39 | 3.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_23_16_30_01_Vienna Boys Choir_O Tannenbaum (O Christmas Tree).aac | 2023-12-23 19:29 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_23_16_30_01_Capricorn_Jesu, Joy Of Man's Desiring.aac | 2023-12-23 19:28 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_23_16_30_01_Brent Mason, guitar; Mark Casstevens, guitar; John Jarvis, p_We Wish You a Merry Christmas (arr. O'Connor).aac | 2023-12-23 19:25 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_23_16_30_01_Aulos Ensemble_Noel Etranger.aac | 2023-12-23 19:22 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_23_16_30_01_In Mulieribus (Portland ens.)_There is no rose of such virtue.aac | 2023-12-23 19:17 | 3.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_23_16_30_01_Grex Vocalis_Kling no klokka (The bells ring, they sound).aac | 2023-12-23 19:04 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_23_16_30_01_Kampin Laulu Chamber Choir_Ecce novum gaudium (Behold the new Joy).aac | 2023-12-23 19:02 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_23_16_30_01_Synergy Brass Quintet_Joy To The World.aac | 2023-12-23 19:00 | 2.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_23_16_30_01_Seraphic Fire_Once As I Remember (arr. Charles Wood).aac | 2023-12-23 18:57 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_23_16_30_01_Pavao String Quartet_Carol (arr. Carlo Martelli).aac | 2023-12-23 18:55 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_23_16_30_01_Christopher Parkening, guitar_El Noi de la Mare (Son of the Virgin).aac | 2023-12-23 18:52 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_23_16_30_01_Triad Ensemble Berlin_Greensleeves (for recorders).aac | 2023-12-23 18:48 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_23_16_30_01_Portland Revels_The Holly and the Ivy (Herefordshire variant).aac | 2023-12-23 18:46 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_23_16_30_01_The American Boychoir_Candlelight Carol.aac | 2023-12-23 18:43 | 3.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_23_16_30_01_London Symphony Brass_Canzon septimi e octavi toni, a 12.aac | 2023-12-23 18:39 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_23_16_30_01_Renaissonics_Piva.aac | 2023-12-23 18:36 | 1.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_23_16_30_01_West Edge String Quartet_Lo, How A Rose E'er Bloming.aac | 2023-12-23 18:35 | 2.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_23_16_30_01_Eaken Piano Trio_The Nutcracker- Waltz of the Flowers.aac | 2023-12-23 18:31 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_23_16_30_01_Cantus_Nowell! Nowell! This is the Salutacion.aac | 2023-12-23 18:28 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_23_16_30_01_Hamburg Soloists_Christmas Aria.aac | 2023-12-23 18:26 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_23_16_30_01_Canadian Brass_The Holly and the Ivy.aac | 2023-12-23 18:23 | 1.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_23_16_30_01_Katherine Murdock, viola; Nathaniel Rosen, cello_Deck the Hall.aac | 2023-12-23 18:08 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_23_16_30_01_La Pieta_Noel Nouvelet (arr. Claude Gagnon).aac | 2023-12-23 18:06 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_23_16_30_01_Renaissonics_Tant que vivray.aac | 2023-12-23 18:02 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_23_16_30_01_Vienna Boys Choir_Entre le boeuf et l'ane gris.aac | 2023-12-23 17:56 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_23_16_30_01_St. Paul's Cathedral Choir_A New Year Carol.aac | 2023-12-23 17:54 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_23_16_30_01_Slovak Philharmonic Orchestra_Lieutenant Kije Suite- Troika.aac | 2023-12-23 17:51 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_23_16_30_01_Baltimore Consort_Drive the Cold Winter Away.aac | 2023-12-23 17:48 | 2.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_23_16_30_01_Joshua Bell, violin; Thomas Bartlett, piano; Rob Moose, guit_I Want an Old Fashioned Christmas.aac | 2023-12-23 17:45 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_23_16_30_01_Pittsburgh Symphony Low Brass_Petites Litanies de Jesus.aac | 2023-12-23 17:42 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_23_16_30_01_Westminster Choir, Rider University, NY_Dans cette etable.aac | 2023-12-23 17:39 | 1.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_23_16_30_01_Etherea Vocal Ensemble_Gabriel's Message (arr. John Rutter).aac | 2023-12-23 17:37 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_23_16_30_01_In Mulieribus (Portland ens.)_Verbum patris umanatur (Today is born a Savior).aac | 2023-12-23 17:35 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_23_16_30_01_Bournemouth Sinfonietta_St. Paul's Suite, Opus 29 no 2- Mvmt 4 Finale (The Dargason).aac | 2023-12-23 17:33 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_23_16_30_01_Toronto Chamber Orchestra_The Four Seasons- Winter- Largo.aac | 2023-12-23 17:26 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_23_16_30_01_King's College Choir, Cambridge_Mille churubini in coro (A Thousand Cherubs in Chorus).aac | 2023-12-23 17:21 | 2.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_23_16_30_01_City of London Sinfonia_Love Came Down At Christmas.aac | 2023-12-23 17:17 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_23_16_30_01_Musica Sacra_Of The Father's Love Begotten.aac | 2023-12-23 17:14 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_23_16_30_01_Baltimore Consort_Wir singen dir, Immanuel (We sing unto You, Emmanuel).aac | 2023-12-23 17:12 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_23_16_30_01_Oregon Ballet Theatre Orchestra_The Nutcracker- Tea (Chinese Dance).aac | 2023-12-23 17:10 | 846K | |
![[ ]](/icons/unknown.gif) | 2023_12_23_16_30_01_Oregon Ballet Theatre Orchestra_The Nutcracker- Dance of the Reed Flutes.aac | 2023-12-23 17:08 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_23_16_30_01_Schwerin Brass Player Collegium_Christmas Symphony in D.aac | 2023-12-23 17:06 | 5.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_23_16_30_01_Portland Revels_Comes the Morning.aac | 2023-12-23 16:57 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_23_16_30_01_University of Portland Singers_Jesus, Jesus Rest Your Head (Appalachian).aac | 2023-12-23 16:56 | 2.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_23_16_30_01_Malle Babbe Women's Choir_Der Englische Gruss (The Annunciation).aac | 2023-12-23 16:52 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_23_16_30_01_Aulos Ensemble_Shepherds Shake Off Your Drowsy Sleep.aac | 2023-12-23 16:46 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_23_16_30_01_Oregon Repertory Singers_How Sweet Is love (Dutch carol).aac | 2023-12-23 16:37 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_23_16_30_01_Chanticleer_The Three Kings.aac | 2023-12-23 16:35 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_23_07_30_01_City of London Sinfonia_Candlelight Carol.aac | 2023-12-23 09:29 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_23_07_30_01_American Boy Choir_Lullay, Lullay- As I lay on Yoolis Night.aac | 2023-12-23 09:24 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_23_07_30_01_In Mulieribus_Es ist ein' Ros' entsprungen.aac | 2023-12-23 09:22 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_23_07_30_01_Los Angeles Guitar Quartet_Nutcracker Suite, Opus 71a- Waltz of the Flowers.aac | 2023-12-23 09:19 | 3.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_23_07_30_01_Sinfonia Cymru_Lullaby for Ana Gwen.aac | 2023-12-23 09:12 | 3.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_23_07_30_01_Christopher Parkening, guitar_Infant Holy, Infant Lowly (Polish Carol).aac | 2023-12-23 09:08 | 2.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_23_07_30_01_Malle Babbe Women's Choir_Maria durch ein Dornwald ging.aac | 2023-12-23 09:04 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_23_07_30_01_Cappella SF (San Francisco)_Psallite unigenito (Sing Psalms).aac | 2023-12-23 09:02 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_23_07_30_01_Oklahoma Woodwind Quintet_Rise, Come and See The King.aac | 2023-12-23 09:00 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_23_07_30_01_Pioneer Brass_The Holly and the Ivy.aac | 2023-12-23 08:58 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_23_07_30_01_Pittsburgh Symphony Brass_Volte.aac | 2023-12-23 08:56 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_23_07_30_01_Slovak Radio Symphony Orchestra_The Seasons- Winter- Ice.aac | 2023-12-23 08:48 | 926K | |
![[ ]](/icons/unknown.gif) | 2023_12_23_07_30_01_St. Paul's Cathedral Choir_All Bells in Paradise.aac | 2023-12-23 08:23 | 3.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_23_07_30_01_Die Singphoniker_Venid cantad (Come, sing the sweet Christmas songs).aac | 2023-12-23 08:18 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_23_07_30_01_New York Pops_Carol of the Drum.aac | 2023-12-23 08:16 | 2.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_23_07_30_01_Empire Brass_Sheep May Safely Graze (Cantata BWV 208).aac | 2023-12-23 08:12 | 3.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_23_07_30_01_Bengt Forsberg, piano_English Folk Song- So Blest A Sight.aac | 2023-12-23 08:07 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_23_07_30_01_Canadian Brass_Little Fantasy on -The Twelve Days of Christmas-.aac | 2023-12-23 08:05 | 2.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_23_07_30_01_Cherwell Singers_A Child This Day Is Born.aac | 2023-12-23 08:01 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_23_07_30_01_Taverner Choir_Chant- Antiphon from Chester Processional.aac | 2023-12-23 07:59 | 694K | |
![[ ]](/icons/unknown.gif) | 2023_12_23_07_30_01_Vienna Boys Choir_O du stille Zeit.aac | 2023-12-23 07:50 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_23_07_30_01_City of London Sinfonia_There is a Flower.aac | 2023-12-23 07:49 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_23_07_30_01_The American Boychoir_I sing of a maiden.aac | 2023-12-23 07:44 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_23_07_30_01_Foothills Brass Quintet_Noel Nouvolet..Sing We Now Of Christmas.aac | 2023-12-23 07:41 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_23_07_30_01_Les Boreades de Montreal_Bon Joseph ecoute moy (Good Joseph Listen to Me).aac | 2023-12-23 07:40 | 3.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_23_07_30_01_Chamber Orchestra Kremlin_The Seasons- December- Christmas.aac | 2023-12-23 07:35 | 3.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_22_16_30_02_La Pieta_Noel Nouvelet (arr. Claude Gagnon).aac | 2023-12-22 20:28 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_22_16_30_02_Nicolaus Esterhazy Sinfonia_Angels We Have Heard on High.aac | 2023-12-22 20:26 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_22_16_30_02_Anonymous 4_A Virgin Unspotted.aac | 2023-12-22 20:23 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_22_16_30_02_Chanticleer_Beautiful Star of Bethlehem.aac | 2023-12-22 20:20 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_22_16_30_02_St. Paul's Cathedral Choir_Gaudete! (medieval melody).aac | 2023-12-22 20:17 | 1.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_22_16_30_02_Baltimore Consort_In dir ist Freude (In you is Joy).aac | 2023-12-22 20:15 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_22_16_30_02_The Cambridge Singers_Once As I Remember (Italian Carol).aac | 2023-12-22 20:08 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_22_16_30_02_Singscape_Quem pastores.aac | 2023-12-22 20:05 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_22_16_30_02_The Queen's Six_Corpus Christi Carol.aac | 2023-12-22 20:04 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_22_16_30_02_Royal Philharmonic_El Noi de la Mare (Son of the Virgin).aac | 2023-12-22 20:01 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_22_16_30_02_The Carillon Brass_European Carol Medley (arr. Arthur Frackenpohl).aac | 2023-12-22 19:57 | 2.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_22_16_30_02_Eaken Piano Trio_Winter Wonderland.aac | 2023-12-22 19:48 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_22_16_30_02_Seattle Pro Musica_Das Roslein, das ich meine.aac | 2023-12-22 19:47 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_22_16_30_02_Vienna Boys Choir_Stille, Stille, Stille (Austrian).aac | 2023-12-22 19:45 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_22_16_30_02_City of Prague Orchestra_O Holy Night.aac | 2023-12-22 19:43 | 2.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_22_16_30_02_West Edge String Quartet_Carol of the Bells.aac | 2023-12-22 19:39 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_22_16_30_02_Renaissonics_Fum, Fum, Fum.aac | 2023-12-22 19:37 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_22_16_30_02_24 Cellos of the London Sound_Introit- Once in Royal David's City.aac | 2023-12-22 19:34 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_22_16_30_02_Die Singphoniker_Still, o Himmel (Hush o Heaven - Bavarian carol).aac | 2023-12-22 19:31 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_22_16_30_02_Musica Sacra_Did Mary Know-.aac | 2023-12-22 19:28 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_22_16_30_02_Razumovsky Symphony Orchestra_March of the Toys.aac | 2023-12-22 19:18 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_22_16_30_02_Portland Brass Quintet_Il est bel et bon (French chanson).aac | 2023-12-22 19:14 | 858K | |
![[ ]](/icons/unknown.gif) | 2023_12_22_16_30_02_Aulos Ensemble_When Christ Was Born On Earth.aac | 2023-12-22 19:09 | 2.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_22_16_30_02_Carolyn Surrick, viola da gamba_Have Yourself a Merry Little Christmas.aac | 2023-12-22 18:59 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_22_16_30_02_City of London Sinfonia_Christmas Night (French Carol).aac | 2023-12-22 18:57 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_22_16_30_02_The Choir of Royal Holloway_Coventry Carol (arr. Ola Gjeilo).aac | 2023-12-22 18:53 | 2.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_22_16_30_02_Lahti Symphony Orchestra_The Bells of Christmas.aac | 2023-12-22 18:50 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_22_16_30_02_St. Paul's Cathedral Choir_O Come, All Ye Faithful (arr. David Willcocks).aac | 2023-12-22 18:46 | 3.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_22_16_30_02_London Baroque_Canzona - Aria.aac | 2023-12-22 18:41 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_22_16_30_02_Christopher Parkening, guitar_Infant Holy, Infant Lowly (Polish Carol).aac | 2023-12-22 18:38 | 2.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_22_16_30_02_Gloriae Dei Cantores_A Child's Welcome (From A Celebration Of Carols).aac | 2023-12-22 18:35 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_22_16_30_02_La Pieta_Laissez Paitre Vos Betes (Noel Bressan) (arr. Claude Gagnon).aac | 2023-12-22 18:33 | 3.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_22_16_30_02_Northern Lights Orchestra_White Christmas.aac | 2023-12-22 18:28 | 2.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_22_16_30_02_Rome Sinfonietta Orchestra_Panis Angelicus.aac | 2023-12-22 18:24 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_22_16_30_02_The Cambridge Singers_Tomorrow Shall Be My Dancing Day.aac | 2023-12-22 18:04 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_22_16_30_02_Chanticleer_The Three Kings.aac | 2023-12-22 18:02 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_22_16_30_02_Seattle Pro Musica_Marienlieder (Songs of Mary)- The Annunciation.aac | 2023-12-22 17:59 | 2.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_22_16_30_02_Portland Revels_Jenny Pluck Pears fr English Dancing Master 1651.aac | 2023-12-22 17:55 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_22_16_30_02_Ensemble Galilei_God Rest Ye Merry, Gentlemen; Good King Wenceslas.aac | 2023-12-22 17:53 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_22_16_30_02_Vienna Boys Choir_O du stille Zeit.aac | 2023-12-22 17:47 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_22_16_30_02_Die Singphoniker_Vom Himmel hoch (From Heaven on High I come to you).aac | 2023-12-22 17:45 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_22_16_30_02_Royal Ballet Sinfonia_Old Christmas Music- The First Mercy (after Peter Warlock).aac | 2023-12-22 17:43 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_22_16_30_02_National Philharmonic Orchestra_Ave Maria.aac | 2023-12-22 17:40 | 3.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_22_16_30_02_Rose Ensemble_The Babe of Bethlehem.aac | 2023-12-22 17:35 | 494K | |
![[ ]](/icons/unknown.gif) | 2023_12_22_16_30_02_The Queen's Six_Out of Your Sleep.aac | 2023-12-22 17:33 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_22_16_30_02_Schola Cantorum of Saint Peter's in the Loop_Gloria.aac | 2023-12-22 17:22 | 3.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_22_16_30_02_Musica Sacra_Saw You Never In The Twilight.aac | 2023-12-22 17:18 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_22_16_30_02_Portland Brass Quintet_Canzona per Sonare No. 4.aac | 2023-12-22 17:16 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_22_16_30_02_St. Paul's Cathedral Choir_Coventry Carol (Lully, Lulla, Lullay).aac | 2023-12-22 17:11 | 3.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_22_16_30_02_Lahti Symphony Orchestra_Hosianna.aac | 2023-12-22 17:07 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_22_16_30_02_Aulos Ensemble_Noel Etranger.aac | 2023-12-22 17:04 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_22_16_30_02_Kansas City Chorale_The Holy Infant's Lullaby.aac | 2023-12-22 17:01 | 3.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_22_16_30_02_Sistine Chapel Choir_Jubilate Deo (Sing Joyfully to God).aac | 2023-12-22 16:57 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_22_16_30_02_West Edge String Quartet_A La Media Noche-De Tierra Lajana Venimos.aac | 2023-12-22 16:55 | 3.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_22_16_30_02_Renaissonics_Quando nascette Ninno.aac | 2023-12-22 16:48 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_22_16_30_02_Raymond Mase, trumpet; Fred Sherry, cello; Anne-Marie McDerm_A Christmas Medley (Joy to the World, & more).aac | 2023-12-22 16:46 | 4.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_22_16_30_02_Choir of King's College, Cambridge_I Saw a Maiden.aac | 2023-12-22 16:39 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_22_16_30_02_In Mulieribus (Portland ens.)_Ther is no rose of swych vertu (15th c.).aac | 2023-12-22 16:36 | 2.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_22_07_44_20_Paul O'Dette, lute_All hail to the days (To Drive the Cold Winter Away).aac | 2023-12-22 09:23 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_22_07_44_20_Die Singphoniker_Nu zijt wellekome (You are Welcome).aac | 2023-12-22 09:20 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_22_07_44_20_Taverner Consort, Choir & Players_O Jesulein suss (O Sweet Jesus).aac | 2023-12-22 09:17 | 2.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_22_07_44_20_Oklahoma Woodwind Quintet_Christmas Carol Medley.aac | 2023-12-22 09:13 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_22_07_44_20_Royal Philharmonic Orchestra with London Voices_He shall feed His flock.aac | 2023-12-22 09:11 | 3.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_22_07_44_20_Canadian Brass_Joy to the World.aac | 2023-12-22 09:06 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_22_07_44_20_London Symphony Brass_Canzon II a 4 for brass.aac | 2023-12-22 09:04 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_22_07_44_20_The American Boychoir_Missa Brevis- Veni Redemptor.aac | 2023-12-22 09:01 | 1.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_22_07_44_20_Arion_Noels- Amoroso.aac | 2023-12-22 08:59 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_22_07_44_20_Santa Fe Guitar Quartet_Terpsichore- Ballet (Guitar Quartet).aac | 2023-12-22 08:57 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_22_07_44_20_Bengt Forsberg, piano_Villancico Vasco (Basque Carol).aac | 2023-12-22 08:55 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_22_07_44_20_Monteverdi Choir_Gloria in excelsis Deo (16th century).aac | 2023-12-22 08:53 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_22_07_44_20_City of London Sinfonia_I Sing Of A Maiden.aac | 2023-12-22 08:51 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_22_07_44_20_Musica Fiata_Jubiliret Frohlich (Canzona in 8 parts).aac | 2023-12-22 08:48 | 3.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_22_07_44_20_BBC Concert Orchestra_Patapan (for Woodwinds).aac | 2023-12-22 08:44 | 962K | |
![[ ]](/icons/unknown.gif) | 2023_12_22_07_44_20_Eduard Laurel, piano_Toy Soldier March.aac | 2023-12-22 08:42 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_22_07_44_20_Taverner Consort_Christmas Eve.aac | 2023-12-22 08:41 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_22_07_44_20_Taverner Consort_Blessed Be That Maid Mary.aac | 2023-12-22 08:23 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_22_07_44_20_St. George's Chapel Choir, Windsor_The Shepherd Men (Choral music).aac | 2023-12-22 08:20 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_22_07_44_20_Phoenix Chorale_A Spotless Rose.aac | 2023-12-22 08:17 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_22_07_44_20_Boston Baroque_Ich danke Dir ewiglich.aac | 2023-12-22 08:14 | 1.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_22_07_44_20_West Edge String Quartet_A La Nanita Nana (Lullaby).aac | 2023-12-22 08:12 | 2.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_22_07_44_20_Canadian Brass_Or Let the Merry Bells Ring 'Round.aac | 2023-12-22 08:08 | 3.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_22_07_44_20_The Muddy River Morris Team_Constant Billy.aac | 2023-12-22 08:03 | 1.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_22_07_44_20_Los Angeles Guitar Quartet_Nutcracker Suite, Opus 71a- Waltz of the Flowers.aac | 2023-12-22 08:01 | 3.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_22_07_44_20_Robert Shaw Festival Singers_Four Motets for Christmas- Seeing the Star.aac | 2023-12-22 07:56 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_22_07_44_20_Musica Intima_Huron Carol.aac | 2023-12-22 07:53 | 2.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_22_07_44_20_Seattle Pro Musica_Ave Maria.aac | 2023-12-22 07:50 | 2.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_22_07_44_20_Members of the Vienna Philharmonic_It Came Upon a Midnight Clear.aac | 2023-12-22 07:47 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_22_07_30_01_Royal Ballet Sinfonia_Waltz for Strings.aac | 2023-12-22 07:43 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_22_07_30_01_Bournemouth Symphony Orchestra_Traditional Slavic Christmas Music.aac | 2023-12-22 07:40 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_22_07_30_01_City of London Choir_There is no Rose, Opus 14.aac | 2023-12-22 07:37 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_21_16_30_02_Westminster Choir College of Rider University_Twinkle, Twinkle Little Star.aac | 2023-12-21 20:29 | 2.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_21_16_30_02_Jessica Gordon, guitar_Ding Dong Merrily On High.aac | 2023-12-21 20:23 | 942K | |
![[ ]](/icons/unknown.gif) | 2023_12_21_16_30_02_Aulos Ensemble_Shepherds Shake Off Your Drowsy Sleep.aac | 2023-12-21 20:22 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_21_16_30_02_Sistine Chapel Choir_Adoramus te, Christe (We Adore Thee, Christ).aac | 2023-12-21 20:21 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_21_16_30_02_St. Paul's Cathedral Choir_There Is No Rose.aac | 2023-12-21 20:18 | 1.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_21_16_30_02_Singscape_Quem pastores.aac | 2023-12-21 20:16 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_21_16_30_02_Seraphic Fire_Jesus Christ the Apple Tree.aac | 2023-12-21 20:15 | 3.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_21_16_30_02_La Pieta_Noel Nouvelet (arr. Claude Gagnon).aac | 2023-12-21 20:10 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_21_16_30_02_Baltimore Consort_Wir singen dir, Immanuel (We sing unto You, Emmanuel).aac | 2023-12-21 20:08 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_21_16_30_02_Oklahoma Woodwind Quintet_Stille, Stille, Stille.aac | 2023-12-21 20:05 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_21_16_30_02_Silverwood Quartet_Christmas Concerto- Largo Pastorale.aac | 2023-12-21 20:02 | 2.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_21_16_30_02_1st Presb. Ft. Thomas Bell Choir_Angels We Have Heard on High.aac | 2023-12-21 19:59 | 658K | |
![[ ]](/icons/unknown.gif) | 2023_12_21_16_30_02_RIAS Chamber Choir_In der Christnacht.aac | 2023-12-21 19:58 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_21_16_30_02_Katherine Murdock, viola; Nathaniel Rosen, cello_Carol of the Bells.aac | 2023-12-21 19:54 | 842K | |
![[ ]](/icons/unknown.gif) | 2023_12_21_16_30_02_Seattle Pro Musica_Gedeonis Area(13th Cent French Conductus).aac | 2023-12-21 19:53 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_21_16_30_02_Bournemouth Sinfonietta_St. Paul's Suite, Opus 29 no 2- Mvmt 4 Finale (The Dargason).aac | 2023-12-21 19:50 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_21_16_30_02_Joshua Bell, violin; Thomas Bartlett, piano; Rob Moose, guit_I Want an Old Fashioned Christmas.aac | 2023-12-21 19:47 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_21_16_30_02_Yolanda Kondonassis, harp_Bring a Torch, Jeanette, Isabella.aac | 2023-12-21 19:44 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_21_16_30_02_The American Boychoir_A Boy was Born.aac | 2023-12-21 19:41 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_21_16_30_02_Cantus_Coventry Carol.aac | 2023-12-21 19:39 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_21_16_30_02_Young People's Chorus of New York_Silent Night.aac | 2023-12-21 19:36 | 2.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_21_16_30_02_Westminster Concert Bell Choir_Jesu, Joy of Man's Desiring (Cantata BWV 147).aac | 2023-12-21 19:33 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_21_16_30_02_Marc Gagnon, violin_El Noy de la Mare (Catalan traditional melody).aac | 2023-12-21 19:30 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_21_16_30_02_Emory Symphonic Winds_Greensleaves (arr. Alfred Reed).aac | 2023-12-21 19:27 | 3.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_21_16_30_02_The Choir of Queens College, Cambridge_The Holly And The Ivy.aac | 2023-12-21 19:18 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_21_16_30_02_Monteverdi Choir_Es ist ein Ros' entsprungen (16th c. German).aac | 2023-12-21 19:15 | 2.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_21_16_30_02_Mainstreet Brass_Joseph lieber, Joseph mein (Brass Quintet).aac | 2023-12-21 19:11 | 3.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_21_16_30_02_Chanticleer_Spanish Carol.aac | 2023-12-21 19:06 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_21_16_30_02_St. Thomas Choir, Leipzig_In Dulci Jubio.aac | 2023-12-21 19:02 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_21_16_30_02_Die Singphoniker_Nu zijt wellekome (You are Welcome).aac | 2023-12-21 19:00 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_21_16_30_02_Ensemble 94_Une jeune pucelle (A young virgin of noble heart...).aac | 2023-12-21 18:57 | 1.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_21_16_30_02_Arion_Noels- Amoroso.aac | 2023-12-21 18:56 | 2.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_21_16_30_02_Santa Fe Guitar Quartet_Terpsichore- Ballet (Guitar Quartet).aac | 2023-12-21 18:52 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_21_16_30_02_The Cambridge Singers_Ave Maria.aac | 2023-12-21 18:50 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_21_16_30_02_Vienna Boys Choir_Heiligste Nacht (Holiest Night).aac | 2023-12-21 18:47 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_21_16_30_02_City of Prague Orchestra_O Holy Night.aac | 2023-12-21 18:44 | 2.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_21_16_30_02_Pioneer Brass_From Every Spire on Christmas Eve.aac | 2023-12-21 18:40 | 1.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_21_16_30_02_Eaken Piano Trio_Hansel & Gretel- Evening Prayer.aac | 2023-12-21 18:38 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_21_16_30_02_Seattle Pro Musica_Das Roslein, das ich meine.aac | 2023-12-21 18:35 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_21_16_30_02_Vasari Singers_Sweet was the song.aac | 2023-12-21 18:33 | 2.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_21_16_30_02_Musica Sacra_O Little Town Of Bethlehem.aac | 2023-12-21 18:28 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_21_16_30_02_The American Boychoir_Missa Brevis- Veni Redemptor.aac | 2023-12-21 18:25 | 1.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_21_16_30_02_BBC Concert Orchestra_Patapan (for Woodwinds).aac | 2023-12-21 18:10 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_21_16_30_02_Northern Lights Orchestra_Frosty the Snowman.aac | 2023-12-21 18:04 | 3.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_21_16_30_02_The Sixteen_Salve Regina (Plainchant).aac | 2023-12-21 17:56 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_21_16_30_02_The Bekova Sisters_The Christmas Tree- Waltz.aac | 2023-12-21 17:53 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_21_16_30_02_Raymond Mase, trumpet; Fred Sherry, cello; Anne-Marie McDerm_A Christmas Medley (Joy to the World, & more).aac | 2023-12-21 17:50 | 4.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_21_16_30_02_Emory Symphonic Winds_Christmas Day- Fantasy on Old Carols.aac | 2023-12-21 17:44 | 4.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_21_16_30_02_Sinfonia Cymru_Lullaby for Pegi.aac | 2023-12-21 17:38 | 2.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_21_16_30_02_Taverner Consort, Choir & Players_O Jesulein suss (O Sweet Jesus).aac | 2023-12-21 17:34 | 1.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_21_16_30_02_Royal Philharmonic Orchestra_Once in royal David's city (arr. John Rutter).aac | 2023-12-21 17:28 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_21_16_30_02_Rome Sinfonietta Orchestra_Ave Maria.aac | 2023-12-21 17:11 | 3.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_21_16_30_02_Hollywood Studio Symphony Orchestra_Buddy's Journey.aac | 2023-12-21 16:36 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_21_07_30_02_University of British Columbia Singers_Little Child in a Manger.aac | 2023-12-21 09:28 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_21_07_30_02_Grex Vocalis_Ave Maris Stella.aac | 2023-12-21 09:26 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_21_07_30_02_Cologne Chamber Orchestra_Christmas Concerto, Opus 6-8- Pastorale.aac | 2023-12-21 09:23 | 2.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_21_07_30_02_Chamber Orchestra Kremlin_The Seasons- December- Christmas.aac | 2023-12-21 09:19 | 3.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_21_07_30_02_Chicago Symphony_Messiah- -I know that my Redeemer liveth-.aac | 2023-12-21 09:14 | 4.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_21_07_30_02_RIAS Chamber Choir_Let us rock the little child.aac | 2023-12-21 09:09 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_21_07_30_02_La Pieta_The Bells of Christmas (adapt. Antoine Bareil).aac | 2023-12-21 09:06 | 3.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_21_07_30_02_The Bekova Sisters_The Christmas Tree- Waltz.aac | 2023-12-21 08:58 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_21_07_30_02_24 Cellos of the London Sound_Introit- Once in Royal David's City.aac | 2023-12-21 08:55 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_21_07_30_02_Akiko Ebi, piano_Snow.aac | 2023-12-21 08:49 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_21_07_30_02_Julius Drake, piano_The Snowman- Walking In The Air.aac | 2023-12-21 08:43 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_21_07_30_02_NordWest Deutsche Philharmonie_Der Schneemann (The Snowman)- Prelude-Serenade.aac | 2023-12-21 08:40 | 3.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_21_07_30_02_Northern Lights Orchestra_Frosty the Snowman.aac | 2023-12-21 08:36 | 3.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_21_07_30_02_Ronn McFarlane, lute_Airs for the Winter- The Laurel.aac | 2023-12-21 08:28 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_21_07_30_02_Gotz Payer, piano_Leise rieselt der Schnee (Snow comes silently down).aac | 2023-12-21 08:11 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_21_07_30_02_Polyphony_O Magnum Mysterium.aac | 2023-12-21 08:04 | 4.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_21_07_30_02_University of Portland Singers_The Wexford Carol.aac | 2023-12-21 07:58 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_21_07_30_02_Gabrieli Consort & Players_Christmas Mass- Sonata.aac | 2023-12-21 07:55 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_21_07_30_02_Baltimore Consort_The Cherry Tree Carol.aac | 2023-12-21 07:52 | 3.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_21_07_30_02_Eaken Piano Trio_Gesu Bambino (Piano Trio).aac | 2023-12-21 07:47 | 3.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_21_07_30_02_West Edge String Quartet_A La Media Noche-De Tierra Lajana Venimos.aac | 2023-12-21 07:42 | 3.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_21_07_30_02_Prague Philharmonic Orchestra_Bethlehem Down.aac | 2023-12-21 07:37 | 2.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_20_16_30_01_La Pieta_Laissez Paitre Vos Betes (Noel Bressan) (arr. Claude Gagnon).aac | 2023-12-20 20:28 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_20_16_30_01_Renaissonics_Joseph, lieber Joseph mein.aac | 2023-12-20 20:26 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_20_16_30_01_Portland State Chamber Choir_O Salutaris Hostia.aac | 2023-12-20 20:23 | 2.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_20_16_30_01_Orpheus Vocal Ensemble; Ars Antiqua Austria_Ave maris stella (Hail, queen of the stars).aac | 2023-12-20 20:19 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_20_16_30_01_St. Paul's Cathedral Choir_I Sing of a Maiden.aac | 2023-12-20 20:16 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_20_16_30_01_West Edge String Quartet_Today in Bethlehem.aac | 2023-12-20 20:13 | 2.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_20_16_30_01_Rome Sinfonietta Orchestra_Maria, che dolce nome (Mary, how sweet a name).aac | 2023-12-20 20:09 | 2.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_20_16_30_01_Synergy Brass Quintet_Ding Dong Merrily On High.aac | 2023-12-20 20:06 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_20_16_30_01_Eaken Piano Trio_The Sussex Mummers' Christmas Carol.aac | 2023-12-20 20:03 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_20_16_30_01_Renaissonics_Gaytas.aac | 2023-12-20 20:00 | 790K | |
![[ ]](/icons/unknown.gif) | 2023_12_20_16_30_01_New York Polyphony_Quem Pastores Laudavere (arr. Susan LaBarr).aac | 2023-12-20 19:59 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_20_16_30_01_Choir of Gonville & Caius College, Cambridge_Rocking (Czech Carol, arr. Edward Higginbottom).aac | 2023-12-20 19:56 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_20_16_30_01_Christopher Parkening, guitar_Sheep May Safely Graze.aac | 2023-12-20 19:54 | 3.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_20_16_30_01_Billy Oskay, harmonium; Dagny Regan, oboe_Il est ne le divin enfant (the Divine Infant is Born).aac | 2023-12-20 19:49 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_20_16_30_01_Sonos Handbell Choir_Austrian Carol.aac | 2023-12-20 19:45 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_20_16_30_01_Pioneer Brass_I Wonder As I Wander.aac | 2023-12-20 19:42 | 3.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_20_16_30_01_Vienna Boys Choir_O Tannenbaum (O Christmas Tree).aac | 2023-12-20 19:32 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_20_16_30_01_Capricorn_Jesu, Joy Of Man's Desiring.aac | 2023-12-20 19:30 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_20_16_30_01_Brent Mason, guitar; Mark Casstevens, guitar; John Jarvis, p_We Wish You a Merry Christmas (arr. O'Connor).aac | 2023-12-20 19:27 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_20_16_30_01_Christopher Parkening, guitar_El Noi de la Mare (Son of the Virgin).aac | 2023-12-20 19:25 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_20_16_30_01_Aulos Ensemble_Noel Etranger.aac | 2023-12-20 19:22 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_20_16_30_01_Synergy Brass Quintet_Joy To The World.aac | 2023-12-20 19:17 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_20_16_30_01_In Mulieribus (Portland ens.)_There is no rose of such virtue.aac | 2023-12-20 19:14 | 3.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_20_16_30_01_Pittsburgh Symphony Brass_Bring a Torch, Jeanette, Isabella.aac | 2023-12-20 19:06 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_20_16_30_01_Grex Vocalis_Kling no klokka (The bells ring, they sound).aac | 2023-12-20 19:04 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_20_16_30_01_Kampin Laulu Chamber Choir_Ecce novum gaudium (Behold the new Joy).aac | 2023-12-20 19:02 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_20_16_30_01_Seraphic Fire_Once As I Remember (arr. Charles Wood).aac | 2023-12-20 19:00 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_20_16_30_01_Pavao String Quartet_Carol (arr. Carlo Martelli).aac | 2023-12-20 18:58 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_20_16_30_01_Triad Ensemble Berlin_Greensleeves (for recorders).aac | 2023-12-20 18:54 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_20_16_30_01_RIAS Chamber Choir_O freudenreicher Tag (O Joyous Day).aac | 2023-12-20 18:51 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_20_16_30_01_Portland Revels_The Holly and the Ivy (Herefordshire variant).aac | 2023-12-20 18:50 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_20_16_30_01_The American Boychoir_Candlelight Carol.aac | 2023-12-20 18:47 | 2.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_20_16_30_01_London Symphony Brass_Canzon septimi e octavi toni, a 12.aac | 2023-12-20 18:43 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_20_16_30_01_Renaissonics_Piva.aac | 2023-12-20 18:40 | 1.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_20_16_30_01_Eaken Piano Trio_The Nutcracker- Waltz of the Flowers.aac | 2023-12-20 18:39 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_20_16_30_01_Cantus_Nowell! Nowell! This is the Salutacion.aac | 2023-12-20 18:36 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_20_16_30_01_Hamburg Soloists_Christmas Aria.aac | 2023-12-20 18:29 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_20_16_30_01_Canadian Brass_The Holly and the Ivy.aac | 2023-12-20 18:26 | 1.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_20_16_30_01_Katherine Murdock, viola; Nathaniel Rosen, cello_Deck the Hall.aac | 2023-12-20 18:07 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_20_16_30_01_Pittsburgh Symphony Low Brass_Petites Litanies de Jesus.aac | 2023-12-20 18:05 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_20_16_30_01_Westminster Choir, Rider University, NY_Dans cette etable.aac | 2023-12-20 18:03 | 1.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_20_16_30_01_Etherea Vocal Ensemble_Gabriel's Message (arr. John Rutter).aac | 2023-12-20 18:01 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_20_16_30_01_In Mulieribus (Portland ens.)_Verbum patris umanatur (Today is born a Savior).aac | 2023-12-20 17:58 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_20_16_30_01_Bournemouth Sinfonietta_St. Paul's Suite, Opus 29 no 2- Mvmt 4 Finale (The Dargason).aac | 2023-12-20 17:56 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_20_16_30_01_Toronto Chamber Orchestra_The Four Seasons- Winter- Largo.aac | 2023-12-20 17:49 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_20_16_30_01_City of London Sinfonia_Love Came Down At Christmas.aac | 2023-12-20 17:45 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_20_16_30_01_Musica Sacra_Of The Father's Love Begotten.aac | 2023-12-20 17:42 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_20_16_30_01_Baltimore Consort_Wir singen dir, Immanuel (We sing unto You, Emmanuel).aac | 2023-12-20 17:40 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_20_16_30_01_Oregon Ballet Theatre Orchestra_The Nutcracker- Dance of the Reed Flutes.aac | 2023-12-20 17:37 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_20_16_30_01_Oregon Ballet Theatre Orchestra_The Nutcracker- Tea (Chinese Dance).aac | 2023-12-20 17:07 | 882K | |
![[ ]](/icons/unknown.gif) | 2023_12_20_16_30_01_Schwerin Brass Player Collegium_Christmas Symphony in D.aac | 2023-12-20 17:06 | 5.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_20_16_30_01_Portland Revels_Comes the Morning.aac | 2023-12-20 16:58 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_20_16_30_01_University of Portland Singers_Jesus, Jesus Rest Your Head (Appalachian).aac | 2023-12-20 16:56 | 2.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_20_16_30_01_Malle Babbe Women's Choir_Der Englische Gruss (The Annunciation).aac | 2023-12-20 16:52 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_20_16_30_01_Aulos Ensemble_Shepherds Shake Off Your Drowsy Sleep.aac | 2023-12-20 16:47 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_20_16_30_01_Oregon Repertory Singers_How Sweet Is love (Dutch carol).aac | 2023-12-20 16:38 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_20_16_30_01_Chanticleer_The Three Kings.aac | 2023-12-20 16:35 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_20_07_30_02_City of London Sinfonia_Candlelight Carol.aac | 2023-12-20 09:29 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_20_07_30_02_American Boy Choir_Lullay, Lullay- As I lay on Yoolis Night.aac | 2023-12-20 09:25 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_20_07_30_02_In Mulieribus_Es ist ein' Ros' entsprungen.aac | 2023-12-20 09:22 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_20_07_30_02_Los Angeles Guitar Quartet_Nutcracker Suite, Opus 71a- Waltz of the Flowers.aac | 2023-12-20 09:20 | 3.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_20_07_30_02_Sinfonia Cymru_Lullaby for Ana Gwen.aac | 2023-12-20 09:13 | 3.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_20_07_30_02_Christopher Parkening, guitar_Infant Holy, Infant Lowly (Polish Carol).aac | 2023-12-20 09:08 | 2.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_20_07_30_02_Malle Babbe Women's Choir_Maria durch ein Dornwald ging.aac | 2023-12-20 09:05 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_20_07_30_02_Cappella SF (San Francisco)_Psallite unigenito (Sing Psalms).aac | 2023-12-20 09:02 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_20_07_30_02_Oklahoma Woodwind Quintet_Rise, Come and See The King.aac | 2023-12-20 09:01 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_20_07_30_02_Pioneer Brass_The Holly and the Ivy.aac | 2023-12-20 08:58 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_20_07_30_02_Cis Ensemble of Salzburg_Christmas Symphony in D.aac | 2023-12-20 08:56 | 5.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_20_07_30_02_Pittsburgh Symphony Brass_Volte.aac | 2023-12-20 08:49 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_20_07_30_02_Slovak Radio Symphony Orchestra_The Seasons- Winter- Ice.aac | 2023-12-20 08:41 | 930K | |
![[ ]](/icons/unknown.gif) | 2023_12_20_07_30_02_Ola Gjeilo, piano, and 12 Ensemble_First Snow.aac | 2023-12-20 08:39 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_20_07_30_02_Royal Ballet Sinfonia_Fairytale Suite- Snow Scene.aac | 2023-12-20 08:19 | 1.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_20_07_30_02_St. Paul's Cathedral Choir_All Bells in Paradise.aac | 2023-12-20 08:18 | 3.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_20_07_30_02_New York Pops_Carol of the Drum.aac | 2023-12-20 08:12 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_20_07_30_02_Bengt Forsberg, piano_English Folk Song- So Blest A Sight.aac | 2023-12-20 08:09 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_20_07_30_02_Canadian Brass_Little Fantasy on -The Twelve Days of Christmas-.aac | 2023-12-20 08:06 | 2.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_20_07_30_02_Cherwell Singers_A Child This Day Is Born.aac | 2023-12-20 08:02 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_20_07_30_02_Taverner Choir_Chant- Antiphon from Chester Processional.aac | 2023-12-20 08:00 | 706K | |
![[ ]](/icons/unknown.gif) | 2023_12_20_07_30_02_Vienna Boys Choir_O du stille Zeit.aac | 2023-12-20 07:51 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_20_07_30_02_City of London Sinfonia_There is a Flower.aac | 2023-12-20 07:50 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_20_07_30_02_The American Boychoir_I sing of a maiden.aac | 2023-12-20 07:46 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_20_07_30_02_Foothills Brass Quintet_Noel Nouvolet..Sing We Now Of Christmas.aac | 2023-12-20 07:43 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_20_07_30_02_Les Boreades de Montreal_Bon Joseph ecoute moy (Good Joseph Listen to Me).aac | 2023-12-20 07:41 | 3.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_20_07_30_02_Chamber Orchestra Kremlin_The Seasons- December- Christmas.aac | 2023-12-20 07:36 | 3.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_19_16_30_02_Vasari Singers_The Stable Door.aac | 2023-12-19 20:29 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_19_16_30_02_Seattle Pro Musica_Puer natus in Bethlehem (A child is born in Bethlehem).aac | 2023-12-19 20:26 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_19_16_30_02_Rome Sinfonietta Orchestra_Ave Maria.aac | 2023-12-19 20:23 | 2.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_19_16_30_02_Schwerin Brass Collegium_Quem pastores laudavere (The shepherds praised).aac | 2023-12-19 20:20 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_19_16_30_02_Sinfonia Cymru_Lullaby for Pegi.aac | 2023-12-19 20:17 | 2.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_19_16_30_02_Debra Torok & Marylene Dosse, piano_Christmas Music for piano 4-hands- Silent Night.aac | 2023-12-19 20:13 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_19_16_30_02_RIAS Chamber Choir_Lasset uns frohlocken (Let Us Rejoice).aac | 2023-12-19 20:12 | 834K | |
![[ ]](/icons/unknown.gif) | 2023_12_19_16_30_02_University of Portland Singers_Austrian Carol Medley (arr. Michael Connolly).aac | 2023-12-19 20:11 | 5.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_19_16_30_02_Copley Singers_Shepherd's Carol.aac | 2023-12-19 20:02 | 2.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_19_16_30_02_Brent Mason, guitar; Mark Casstevens, guitar; John Jarvis, p_Carol of the Bells (arr. O'Connor).aac | 2023-12-19 19:55 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_19_16_30_02_West Edge String Quartet_Coventry Carol.aac | 2023-12-19 19:52 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_19_16_30_02_Christopher Parkening, guitar_El Noi de la Mare (Son of the Virgin).aac | 2023-12-19 19:48 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_19_16_30_02_Oklahoma Woodwind Quintet_What Child Is This-.aac | 2023-12-19 19:45 | 2.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_19_16_30_02_Arsys Bourgogne_Tebe pojem.aac | 2023-12-19 19:41 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_19_16_30_02_True North Brass_Hodie, Christus Natus Est (brass ensemble).aac | 2023-12-19 19:31 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_19_16_30_02_Bach Trumpet Ensemble of Munich_Sonata 'Ad Festum Paschatis'.aac | 2023-12-19 19:29 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_19_16_30_02_Emory Symphonic Winds_Symphonic Prelude on -Adeste Fideles-.aac | 2023-12-19 19:27 | 2.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_19_16_30_02_Paul O'Dette, lute_Es ist ein Ros entsprungen.aac | 2023-12-19 19:24 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_19_16_30_02_In Mulieribus (Portland ens.)_Angelus ad virginem.aac | 2023-12-19 19:21 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_19_16_30_02_Pomerium_In dulci jubilo a 2.aac | 2023-12-19 19:18 | 626K | |
![[ ]](/icons/unknown.gif) | 2023_12_19_16_30_02_Voces 8_Locus iste.aac | 2023-12-19 19:17 | 2.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_19_16_30_02_Ensemble 94_Ou s'en vont ces gays bergers.aac | 2023-12-19 19:13 | 846K | |
![[ ]](/icons/unknown.gif) | 2023_12_19_16_30_02_Yolanda Kondonassis, harp_O Sleep, My Pretty Baby.aac | 2023-12-19 19:09 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_19_16_30_02_BBC Singers_Sing Lullaby.aac | 2023-12-19 19:07 | 2.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_19_16_30_02_Oregon Bach Festival Chorus_Christmas Day is Come.aac | 2023-12-19 19:03 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_19_16_30_02_Choir of Magdalen College, Oxford_Sweet was the Song.aac | 2023-12-19 19:01 | 2.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_19_16_30_02_The Cambridge Singers_Lute-Book Lullaby.aac | 2023-12-19 18:57 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_19_16_30_02_Epic Brass_Sleigh Ride.aac | 2023-12-19 18:55 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_19_16_30_02_Carsten Linck, guitar_Morgen, Kinder, wird's was geben.aac | 2023-12-19 18:53 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_19_16_30_02_24 Cellos of the London Sound_Troika - O Little Town of Bethlehem (cellos).aac | 2023-12-19 18:50 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_19_16_30_02_Oklahoma Woodwind Quintet_Christmas Carol Medley.aac | 2023-12-19 18:45 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_19_16_30_02_Trinity Cathedral Choir, Portland_The Cherry Tree Carol.aac | 2023-12-19 18:43 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_19_16_30_02_St. Paul's Cathedral Choir_Once In Royal David's City (arr. Mann).aac | 2023-12-19 18:40 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_19_16_30_02_Eaken Piano Trio_The Nutcracker- Waltz of the Flowers.aac | 2023-12-19 18:34 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_19_16_30_02_Gerold Huber, piano_Inmitten der nacht.aac | 2023-12-19 18:31 | 1.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_19_16_30_02_The Sixteen_Ave Maris Stella.aac | 2023-12-19 18:29 | 2.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_19_16_30_02_La Pieta_The Holy Boy.aac | 2023-12-19 18:26 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_19_16_30_02_Academy of St Martin in the Fields_The Skaters Waltz (Les Patineurs), Opus 183.aac | 2023-12-19 18:23 | 5.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_19_16_30_02_Royal Ballet Sinfonia_Fairytale Suite- Snow Scene.aac | 2023-12-19 18:03 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_19_16_30_02_Les Boreades de Montreal_Noel provencal.aac | 2023-12-19 18:01 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_19_16_30_02_The Carillon Brass_Fum, Fum, Fum.aac | 2023-12-19 17:59 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_19_16_30_02_Schwerin Brass Player Collegium_Canzona No. 45 in 8 parts from -Sacri Concentus- (1601).aac | 2023-12-19 17:56 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_19_16_30_02_Seattle Pro Musica_So singen wir all Amen.aac | 2023-12-19 17:52 | 906K | |
![[ ]](/icons/unknown.gif) | 2023_12_19_16_30_02_Tafelmusik Baroque Orchestra_Messiah- Rejoice greatly, O daughter of Zion.aac | 2023-12-19 17:51 | 3.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_19_16_30_02_Sinfonia Cymru_Lullaby for Ana Gwen.aac | 2023-12-19 17:46 | 3.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_19_16_30_02_In Mulieribus (Portland ens.)_There is no rose of such virtue.aac | 2023-12-19 17:36 | 3.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_19_16_30_02_Voces 8_My Lord Has Come.aac | 2023-12-19 17:31 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_19_16_30_02_Cincinnati Pops Orchestra_Angel's Dance.aac | 2023-12-19 17:28 | 3.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_19_16_30_02_The Queen's Six_God Rest You Merry, Gentlemen (arr. Simon Whiteley).aac | 2023-12-19 17:23 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_19_16_30_02_Hollywood Bowl Orchestra_Away In A Manger.aac | 2023-12-19 17:17 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_19_16_30_02_RIAS Chamber Choir_Schlaf, mein Kindelein (Sleep, my little child).aac | 2023-12-19 17:04 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_19_16_30_02_New York Polyphony_Gabriel's Message (arr. Alexander Craig).aac | 2023-12-19 17:02 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_19_16_30_02_Canadian Brass_Arrival of the Queen of Sheba.aac | 2023-12-19 16:59 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_19_16_30_02_Vincent Boucher, organ_Wachet auf, ruft uns die Stimme (Sleepers Awake).aac | 2023-12-19 16:56 | 2.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_19_16_30_02_Schwerin Brass Player Collegium_Freue dich, du Tochter Zion (1655).aac | 2023-12-19 16:52 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_19_16_30_02_Faith DeBow, piano_Requiem (mother mary, full of grace, awaken).aac | 2023-12-19 16:46 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_19_16_30_02_Stile Antico_Ave Maria (Hail Mary; for Advent).aac | 2023-12-19 16:43 | 1.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_19_16_30_02_City of London Sinfonia_Love Came Down At Christmas.aac | 2023-12-19 16:40 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_19_16_30_02_The Toronto Consort_All you that are good fellows.aac | 2023-12-19 16:38 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_19_08_00_25_Rome Sinfonietta Orchestra_Maria, che dolce nome (Mary, how sweet a name).aac | 2023-12-19 09:29 | 2.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_19_08_00_25_Prague Philharmonic Orchestra_Bethlehem Down.aac | 2023-12-19 09:25 | 2.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_19_08_00_25_Grex Vocalis_Kling no klokka (The bells ring, they sound).aac | 2023-12-19 09:20 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_19_08_00_25_Kampin Laulu Chamber Choir_Ecce novum gaudium (Behold the new Joy).aac | 2023-12-19 09:18 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_19_08_00_25_Carolina Chamber Chorale_Hannerot Hallalu (Hanukkah song).aac | 2023-12-19 09:12 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_19_08_00_25_Taverner Choir_Chant- Antiphon from Chester Processional.aac | 2023-12-19 09:07 | 690K | |
![[ ]](/icons/unknown.gif) | 2023_12_19_08_00_25_Portland Brass Quintet_Deck the Hall.aac | 2023-12-19 08:01 | 1.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_19_07_30_01_Etherea Vocal Ensemble_Gabriel's Message (arr. John Rutter).aac | 2023-12-19 07:57 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_19_07_30_01_Vienna Boys Choir_Entre le boeuf et l'ane gris.aac | 2023-12-19 07:54 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_19_07_30_01_Royal Philharmonic Orchestra with London Voices_He shall feed His flock.aac | 2023-12-19 07:52 | 3.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_19_07_30_01_St. Thomas Choir, Leipzig_Ich Steh An Deiner Krippen Hier.aac | 2023-12-19 07:42 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_19_07_30_01_The Queen's Six_Gabriel's Message.aac | 2023-12-19 07:40 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_19_07_30_01_Baltimore Consort_Chestnut (A Wassail Tune).aac | 2023-12-19 07:34 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_18_16_30_02_The Trail Band_It Came Upon a Midnight Clear.aac | 2023-12-18 20:29 | 1.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_18_16_30_02_Trinity Cathedral Choir, Portland_The Linden Tree Carol.aac | 2023-12-18 20:27 | 3.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_18_16_30_02_Harrington String Quartet; Phoenix Chorale_The Ground (adapted from Sunrise Mass).aac | 2023-12-18 20:23 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_18_16_30_02_Westminster Choir College of Rider University_Twinkle, Twinkle Little Star.aac | 2023-12-18 20:19 | 2.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_18_16_30_02_Jessica Gordon, guitar_Ding Dong Merrily On High.aac | 2023-12-18 20:13 | 938K | |
![[ ]](/icons/unknown.gif) | 2023_12_18_16_30_02_Aulos Ensemble_Shepherds Shake Off Your Drowsy Sleep.aac | 2023-12-18 20:12 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_18_16_30_02_Sistine Chapel Choir_Adoramus te, Christe (We Adore Thee, Christ).aac | 2023-12-18 20:10 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_18_16_30_02_Singscape_Quem pastores.aac | 2023-12-18 20:08 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_18_16_30_02_Seraphic Fire_Jesus Christ the Apple Tree.aac | 2023-12-18 20:06 | 3.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_18_16_30_02_La Pieta_Noel Nouvelet (arr. Claude Gagnon).aac | 2023-12-18 20:02 | 1.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_18_16_30_02_Baltimore Consort_Wir singen dir, Immanuel (We sing unto You, Emmanuel).aac | 2023-12-18 20:00 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_18_16_30_02_Oklahoma Woodwind Quintet_Stille, Stille, Stille.aac | 2023-12-18 19:57 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_18_16_30_02_1st Presb. Ft. Thomas Bell Choir_Angels We Have Heard on High.aac | 2023-12-18 19:54 | 658K | |
![[ ]](/icons/unknown.gif) | 2023_12_18_16_30_02_St. Paul's Cathedral Choir_There Is No Rose.aac | 2023-12-18 19:53 | 1.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_18_16_30_02_RIAS Chamber Choir_In der Christnacht.aac | 2023-12-18 19:51 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_18_16_30_02_Katherine Murdock, viola; Nathaniel Rosen, cello_Carol of the Bells.aac | 2023-12-18 19:47 | 846K | |
![[ ]](/icons/unknown.gif) | 2023_12_18_16_30_02_Seattle Pro Musica_Gedeonis Area(13th Cent French Conductus).aac | 2023-12-18 19:46 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_18_16_30_02_Bournemouth Sinfonietta_St. Paul's Suite, Opus 29 no 2- Mvmt 4 Finale (The Dargason).aac | 2023-12-18 19:43 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_18_16_30_02_Joshua Bell, violin; Thomas Bartlett, piano; Rob Moose, guit_I Want an Old Fashioned Christmas.aac | 2023-12-18 19:40 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_18_16_30_02_Yolanda Kondonassis, harp_Bring a Torch, Jeanette, Isabella.aac | 2023-12-18 19:37 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_18_16_30_02_The American Boychoir_A Boy was Born.aac | 2023-12-18 19:34 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_18_16_30_02_Cantus_Coventry Carol.aac | 2023-12-18 19:32 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_18_16_30_02_Young People's Chorus of New York_Silent Night.aac | 2023-12-18 19:30 | 2.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_18_16_30_02_Westminster Concert Bell Choir_Jesu, Joy of Man's Desiring (Cantata BWV 147).aac | 2023-12-18 19:27 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_18_16_30_02_Marc Gagnon, violin_El Noy de la Mare (Catalan traditional melody).aac | 2023-12-18 19:24 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_18_16_30_02_Emory Symphonic Winds_Greensleaves (arr. Alfred Reed).aac | 2023-12-18 19:21 | 3.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_18_16_30_02_The Choir of Queens College, Cambridge_The Holly And The Ivy.aac | 2023-12-18 19:11 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_18_16_30_02_St. Thomas Choir, Leipzig_In Dulci Jubio.aac | 2023-12-18 19:08 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_18_16_30_02_Monteverdi Choir_Es ist ein Ros' entsprungen (16th c. German).aac | 2023-12-18 19:06 | 2.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_18_16_30_02_Foothills Brass Quintet_Jesu Bambino.aac | 2023-12-18 19:02 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_18_16_30_02_Mainstreet Brass_Joseph lieber, Joseph mein (Brass Quintet).aac | 2023-12-18 18:59 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_18_16_30_02_Chanticleer_Spanish Carol.aac | 2023-12-18 18:56 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_18_16_30_02_Die Singphoniker_Nu zijt wellekome (You are Welcome).aac | 2023-12-18 18:52 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_18_16_30_02_Ensemble 94_Une jeune pucelle (A young virgin of noble heart...).aac | 2023-12-18 18:50 | 1.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_18_16_30_02_Arion_Noels- Amoroso.aac | 2023-12-18 18:48 | 2.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_18_16_30_02_Santa Fe Guitar Quartet_Terpsichore- Ballet (Guitar Quartet).aac | 2023-12-18 18:44 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_18_16_30_02_The Cambridge Singers_Ave Maria.aac | 2023-12-18 18:42 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_18_16_30_02_Vienna Boys Choir_Heiligste Nacht (Holiest Night).aac | 2023-12-18 18:39 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_18_16_30_02_City of Prague Orchestra_O Holy Night.aac | 2023-12-18 18:36 | 2.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_18_16_30_02_Pioneer Brass_From Every Spire on Christmas Eve.aac | 2023-12-18 18:32 | 1.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_18_16_30_02_BBC Concert Orchestra_Patapan (for Woodwinds).aac | 2023-12-18 18:30 | 966K | |
![[ ]](/icons/unknown.gif) | 2023_12_18_16_30_02_Eaken Piano Trio_Hansel & Gretel- Evening Prayer.aac | 2023-12-18 18:29 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_18_16_30_02_Seattle Pro Musica_Das Roslein, das ich meine.aac | 2023-12-18 18:25 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_18_16_30_02_Vasari Singers_Sweet was the song.aac | 2023-12-18 18:24 | 2.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_18_16_30_02_Musica Sacra_O Little Town Of Bethlehem.aac | 2023-12-18 18:20 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_18_16_30_02_Kay Johannsen, organ_Morgen kommt der Weihnachtsmann.aac | 2023-12-18 18:02 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_18_16_30_02_The Toronto Consort_The Spanish Gypsies (opens with -Drive the cold winter away-.aac | 2023-12-18 18:00 | 3.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_18_16_30_02_The American Boychoir_Missa Brevis- Veni Redemptor.aac | 2023-12-18 17:53 | 1.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_18_16_30_02_The Sixteen_Salve Regina (Plainchant).aac | 2023-12-18 17:51 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_18_16_30_02_The Bekova Sisters_The Christmas Tree- Waltz.aac | 2023-12-18 17:48 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_18_16_30_02_Raymond Mase, trumpet; Fred Sherry, cello; Anne-Marie McDerm_A Christmas Medley (Joy to the World, & more).aac | 2023-12-18 17:45 | 4.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_18_16_30_02_Sinfonia Cymru_Lullaby for Pegi.aac | 2023-12-18 17:39 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_18_16_30_02_Taverner Consort, Choir & Players_O Jesulein suss (O Sweet Jesus).aac | 2023-12-18 17:35 | 1.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_18_16_30_02_Royal Philharmonic Orchestra_Once in royal David's city (arr. John Rutter).aac | 2023-12-18 17:29 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_18_16_30_02_Rome Sinfonietta Orchestra_Ave Maria.aac | 2023-12-18 17:10 | 2.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_18_16_30_02_Ensemble Galilei_God Rest Ye Merry, Gentlemen; Good King Wenceslas.aac | 2023-12-18 17:07 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_18_16_30_02_Robert Shaw Festival Singers_Glory to God in the Highest.aac | 2023-12-18 17:03 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_18_16_30_02_Vasari Singers_Of the Father's heart begotten.aac | 2023-12-18 17:01 | 2.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_18_16_30_02_Oregon Repertory Singers_Ave Maria.aac | 2023-12-18 16:53 | 4.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_18_16_30_02_Ensemble 94_Ou s'en vont ces gays bergers.aac | 2023-12-18 16:47 | 834K | |
![[ ]](/icons/unknown.gif) | 2023_12_18_16_30_02_New York Pops_Adeste Fidelis.aac | 2023-12-18 16:46 | 3.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_18_16_30_02_The Cambridge Singers_Cherry Tree Carol.aac | 2023-12-18 16:37 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_18_16_30_02_RIAS Chamber Choir_Ich lag in tiefster Todesnacht.aac | 2023-12-18 16:35 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_18_07_30_01_City of London Sinfonia_Dormi Jesu.aac | 2023-12-18 09:29 | 3.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_18_07_30_01_University of British Columbia Singers_Little Child in a Manger.aac | 2023-12-18 09:24 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_18_07_30_01_Grex Vocalis_Ave Maris Stella.aac | 2023-12-18 09:21 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_18_07_30_01_Cologne Chamber Orchestra_Christmas Concerto, Opus 6-8- Pastorale.aac | 2023-12-18 09:18 | 2.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_18_07_30_01_Chamber Orchestra Kremlin_The Seasons- December- Christmas.aac | 2023-12-18 09:15 | 3.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_18_07_30_01_Chicago Symphony_Messiah- -I know that my Redeemer liveth-.aac | 2023-12-18 09:10 | 4.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_18_07_30_01_RIAS Chamber Choir_Let us rock the little child.aac | 2023-12-18 09:04 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_18_07_30_01_Vasari Singers_Sing Lullaby.aac | 2023-12-18 09:02 | 2.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_18_07_30_01_Musica Sacra_Patapan.aac | 2023-12-18 08:59 | 918K | |
![[ ]](/icons/unknown.gif) | 2023_12_18_07_30_01_Lahti Symphony Orchestra_The Bells of Christmas.aac | 2023-12-18 08:53 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_18_07_30_01_St. Paul's Cathedral Choir_O Come, All Ye Faithful (arr. David Willcocks).aac | 2023-12-18 08:49 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_18_07_30_01_Heartstrings (Oregon-based ens.)_Joy To The World.aac | 2023-12-18 08:27 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_18_07_30_01_La Pieta_The Bells of Christmas (adapt. Antoine Bareil).aac | 2023-12-18 08:25 | 3.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_18_07_30_01_Katherine Murdock, viola; Nathaniel Rosen, cello_When Christmas Morn Was Dawning.aac | 2023-12-18 08:20 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_18_07_30_01_Anonymous 4_Greene growith the holy.aac | 2023-12-18 08:18 | 2.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_18_07_30_01_Seattle Pro Musica_Marias Kirchgang (Mary's trip to the church).aac | 2023-12-18 08:15 | 1.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_18_07_30_01_24 Cellos of the London Sound_Introit- Once in Royal David's City.aac | 2023-12-18 08:13 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_18_07_30_01_Ensemble 94_O nous dites Marie (Now tell us, Mary).aac | 2023-12-18 08:09 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_18_07_30_01_Ronn McFarlane, lute_Airs for the Winter- The Laurel.aac | 2023-12-18 08:07 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_18_07_30_01_Bengt Forsberg, piano_The Three Mummers.aac | 2023-12-18 08:03 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_18_07_30_01_Polyphony_O Magnum Mysterium.aac | 2023-12-18 07:57 | 4.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_18_07_30_01_University of Portland Singers_The Wexford Carol.aac | 2023-12-18 07:50 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_18_07_30_01_Gabrieli Consort & Players_Christmas Mass- Sonata.aac | 2023-12-18 07:47 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_18_07_30_01_Baltimore Consort_The Cherry Tree Carol.aac | 2023-12-18 07:44 | 3.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_18_07_30_01_Eaken Piano Trio_Gesu Bambino (Piano Trio).aac | 2023-12-18 07:39 | 3.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_18_07_30_01_Prague Philharmonic Orchestra_Bethlehem Down.aac | 2023-12-18 07:35 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_17_16_30_02_La Pieta_Laissez Paitre Vos Betes (Noel Bressan) (arr. Claude Gagnon).aac | 2023-12-17 20:25 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_17_16_30_02_Renaissonics_Joseph, lieber Joseph mein.aac | 2023-12-17 20:23 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_17_16_30_02_Portland State Chamber Choir_O Salutaris Hostia.aac | 2023-12-17 20:19 | 2.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_17_16_30_02_Orpheus Vocal Ensemble; Ars Antiqua Austria_Ave maris stella (Hail, queen of the stars).aac | 2023-12-17 20:16 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_17_16_30_02_St. Paul's Cathedral Choir_I Sing of a Maiden.aac | 2023-12-17 20:13 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_17_16_30_02_West Edge String Quartet_Today in Bethlehem.aac | 2023-12-17 20:10 | 2.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_17_16_30_02_Synergy Brass Quintet_Ding Dong Merrily On High.aac | 2023-12-17 20:06 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_17_16_30_02_Rome Sinfonietta Orchestra_Maria, che dolce nome (Mary, how sweet a name).aac | 2023-12-17 20:03 | 2.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_17_16_30_02_Eaken Piano Trio_The Sussex Mummers' Christmas Carol.aac | 2023-12-17 20:00 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_17_16_30_02_Renaissonics_Gaytas.aac | 2023-12-17 19:57 | 786K | |
![[ ]](/icons/unknown.gif) | 2023_12_17_16_30_02_New York Polyphony_Quem Pastores Laudavere (arr. Susan LaBarr).aac | 2023-12-17 19:55 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_17_16_30_02_Choir of Gonville & Caius College, Cambridge_Rocking (Czech Carol, arr. Edward Higginbottom).aac | 2023-12-17 19:53 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_17_16_30_02_Christopher Parkening, guitar_Sheep May Safely Graze.aac | 2023-12-17 19:51 | 3.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_17_16_30_02_Billy Oskay, harmonium; Dagny Regan, oboe_Il est ne le divin enfant (the Divine Infant is Born).aac | 2023-12-17 19:46 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_17_16_30_02_Sonos Handbell Choir_Austrian Carol.aac | 2023-12-17 19:42 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_17_16_30_02_Pioneer Brass_I Wonder As I Wander.aac | 2023-12-17 19:39 | 3.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_17_16_30_02_Vienna Boys Choir_O Tannenbaum (O Christmas Tree).aac | 2023-12-17 19:29 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_17_16_30_02_Capricorn_Jesu, Joy Of Man's Desiring.aac | 2023-12-17 19:28 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_17_16_30_02_Brent Mason, guitar; Mark Casstevens, guitar; John Jarvis, p_We Wish You a Merry Christmas (arr. O'Connor).aac | 2023-12-17 19:25 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_17_16_30_02_Aulos Ensemble_Noel Etranger.aac | 2023-12-17 19:23 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_17_16_30_02_In Mulieribus (Portland ens.)_There is no rose of such virtue.aac | 2023-12-17 19:17 | 3.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_17_16_30_02_Pittsburgh Symphony Brass_Bring a Torch, Jeanette, Isabella.aac | 2023-12-17 19:06 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_17_16_30_02_Grex Vocalis_Kling no klokka (The bells ring, they sound).aac | 2023-12-17 19:04 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_17_16_30_02_Kampin Laulu Chamber Choir_Ecce novum gaudium (Behold the new Joy).aac | 2023-12-17 19:03 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_17_16_30_02_Synergy Brass Quintet_Joy To The World.aac | 2023-12-17 19:01 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_17_16_30_02_Seraphic Fire_Once As I Remember (arr. Charles Wood).aac | 2023-12-17 18:57 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_17_16_30_02_Pavao String Quartet_Carol (arr. Carlo Martelli).aac | 2023-12-17 18:55 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_17_16_30_02_Christopher Parkening, guitar_El Noi de la Mare (Son of the Virgin).aac | 2023-12-17 18:53 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_17_16_30_02_Triad Ensemble Berlin_Greensleeves (for recorders).aac | 2023-12-17 18:49 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_17_16_30_02_RIAS Chamber Choir_O freudenreicher Tag (O Joyous Day).aac | 2023-12-17 18:46 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_17_16_30_02_Portland Revels_The Holly and the Ivy (Herefordshire variant).aac | 2023-12-17 18:45 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_17_16_30_02_The American Boychoir_Candlelight Carol.aac | 2023-12-17 18:42 | 2.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_17_16_30_02_London Symphony Brass_Canzon septimi e octavi toni, a 12.aac | 2023-12-17 18:38 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_17_16_30_02_Renaissonics_Piva.aac | 2023-12-17 18:35 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_17_16_30_02_West Edge String Quartet_Lo, How A Rose E'er Bloming.aac | 2023-12-17 18:34 | 2.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_17_16_30_02_Eaken Piano Trio_The Nutcracker- Waltz of the Flowers.aac | 2023-12-17 18:30 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_17_16_30_02_Cantus_Nowell! Nowell! This is the Salutacion.aac | 2023-12-17 18:28 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_17_16_30_02_Hamburg Soloists_Christmas Aria.aac | 2023-12-17 18:25 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_17_16_30_02_Canadian Brass_The Holly and the Ivy.aac | 2023-12-17 18:22 | 1.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_17_16_30_02_Katherine Murdock, viola; Nathaniel Rosen, cello_Deck the Hall.aac | 2023-12-17 18:07 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_17_16_30_02_La Pieta_Noel Nouvelet (arr. Claude Gagnon).aac | 2023-12-17 18:06 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_17_16_30_02_Renaissonics_Tant que vivray.aac | 2023-12-17 18:03 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_17_16_30_02_Vienna Boys Choir_Entre le boeuf et l'ane gris.aac | 2023-12-17 17:57 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_17_16_30_02_St. Paul's Cathedral Choir_A New Year Carol.aac | 2023-12-17 17:55 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_17_16_30_02_Slovak Philharmonic Orchestra_Lieutenant Kije Suite- Troika.aac | 2023-12-17 17:52 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_17_16_30_02_Baltimore Consort_Drive the Cold Winter Away.aac | 2023-12-17 17:49 | 2.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_17_16_30_02_Joshua Bell, violin; Thomas Bartlett, piano; Rob Moose, guit_I Want an Old Fashioned Christmas.aac | 2023-12-17 17:46 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_17_16_30_02_Pittsburgh Symphony Low Brass_Petites Litanies de Jesus.aac | 2023-12-17 17:43 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_17_16_30_02_Westminster Choir, Rider University, NY_Dans cette etable.aac | 2023-12-17 17:41 | 1.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_17_16_30_02_Etherea Vocal Ensemble_Gabriel's Message (arr. John Rutter).aac | 2023-12-17 17:38 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_17_16_30_02_In Mulieribus (Portland ens.)_Verbum patris umanatur (Today is born a Savior).aac | 2023-12-17 17:36 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_17_16_30_02_Bournemouth Sinfonietta_St. Paul's Suite, Opus 29 no 2- Mvmt 4 Finale (The Dargason).aac | 2023-12-17 17:34 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_17_16_30_02_Toronto Chamber Orchestra_The Four Seasons- Winter- Largo.aac | 2023-12-17 17:27 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_17_16_30_02_King's College Choir, Cambridge_Mille churubini in coro (A Thousand Cherubs in Chorus).aac | 2023-12-17 17:22 | 2.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_17_16_30_02_City of London Sinfonia_Love Came Down At Christmas.aac | 2023-12-17 17:18 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_17_16_30_02_Musica Sacra_Of The Father's Love Begotten.aac | 2023-12-17 17:16 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_17_16_30_02_Baltimore Consort_Wir singen dir, Immanuel (We sing unto You, Emmanuel).aac | 2023-12-17 17:13 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_17_16_30_02_Oregon Ballet Theatre Orchestra_The Nutcracker- Tea (Chinese Dance).aac | 2023-12-17 17:11 | 846K | |
![[ ]](/icons/unknown.gif) | 2023_12_17_16_30_02_Oregon Ballet Theatre Orchestra_The Nutcracker- Dance of the Reed Flutes.aac | 2023-12-17 17:10 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_17_16_30_02_Schwerin Brass Player Collegium_Christmas Symphony in D.aac | 2023-12-17 17:07 | 5.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_17_16_30_02_Portland Revels_Comes the Morning.aac | 2023-12-17 16:58 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_17_16_30_02_University of Portland Singers_Jesus, Jesus Rest Your Head (Appalachian).aac | 2023-12-17 16:57 | 2.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_17_16_30_02_Malle Babbe Women's Choir_Der Englische Gruss (The Annunciation).aac | 2023-12-17 16:53 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_17_16_30_02_Aulos Ensemble_Shepherds Shake Off Your Drowsy Sleep.aac | 2023-12-17 16:47 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_17_16_30_02_Oregon Repertory Singers_How Sweet Is love (Dutch carol).aac | 2023-12-17 16:38 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_17_16_30_02_Chanticleer_The Three Kings.aac | 2023-12-17 16:36 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_17_07_30_01_City of London Sinfonia_Candlelight Carol.aac | 2023-12-17 09:29 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_17_07_30_01_American Boy Choir_Lullay, Lullay- As I lay on Yoolis Night.aac | 2023-12-17 09:25 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_17_07_30_01_In Mulieribus_Es ist ein' Ros' entsprungen.aac | 2023-12-17 09:23 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_17_07_30_01_Los Angeles Guitar Quartet_Nutcracker Suite, Opus 71a- Waltz of the Flowers.aac | 2023-12-17 09:19 | 3.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_17_07_30_01_Sinfonia Cymru_Lullaby for Ana Gwen.aac | 2023-12-17 09:12 | 3.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_17_07_30_01_Christopher Parkening, guitar_Infant Holy, Infant Lowly (Polish Carol).aac | 2023-12-17 09:08 | 2.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_17_07_30_01_Malle Babbe Women's Choir_Maria durch ein Dornwald ging.aac | 2023-12-17 09:05 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_17_07_30_01_Cappella SF (San Francisco)_Psallite unigenito (Sing Psalms).aac | 2023-12-17 09:02 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_17_07_30_01_Oklahoma Woodwind Quintet_Rise, Come and See The King.aac | 2023-12-17 09:01 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_17_07_30_01_Pioneer Brass_The Holly and the Ivy.aac | 2023-12-17 08:58 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_17_07_30_01_Pittsburgh Symphony Brass_Volte.aac | 2023-12-17 08:56 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_17_07_30_01_Slovak Radio Symphony Orchestra_The Seasons- Winter- Ice.aac | 2023-12-17 08:48 | 930K | |
![[ ]](/icons/unknown.gif) | 2023_12_17_07_30_01_St. Paul's Cathedral Choir_All Bells in Paradise.aac | 2023-12-17 08:24 | 3.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_17_07_30_01_Die Singphoniker_Venid cantad (Come, sing the sweet Christmas songs).aac | 2023-12-17 08:18 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_17_07_30_01_New York Pops_Carol of the Drum.aac | 2023-12-17 08:16 | 2.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_17_07_30_01_Empire Brass_Sheep May Safely Graze (Cantata BWV 208).aac | 2023-12-17 08:13 | 3.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_17_07_30_01_Bengt Forsberg, piano_English Folk Song- So Blest A Sight.aac | 2023-12-17 08:08 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_17_07_30_01_Canadian Brass_Little Fantasy on -The Twelve Days of Christmas-.aac | 2023-12-17 08:05 | 2.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_17_07_30_01_Cherwell Singers_A Child This Day Is Born.aac | 2023-12-17 08:02 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_17_07_30_01_Taverner Choir_Chant- Antiphon from Chester Processional.aac | 2023-12-17 07:59 | 706K | |
![[ ]](/icons/unknown.gif) | 2023_12_17_07_30_01_Vienna Boys Choir_O du stille Zeit.aac | 2023-12-17 07:51 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_17_07_30_01_City of London Sinfonia_There is a Flower.aac | 2023-12-17 07:49 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_17_07_30_01_The American Boychoir_I sing of a maiden.aac | 2023-12-17 07:45 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_17_07_30_01_Foothills Brass Quintet_Noel Nouvolet..Sing We Now Of Christmas.aac | 2023-12-17 07:42 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_17_07_30_01_Les Boreades de Montreal_Bon Joseph ecoute moy (Good Joseph Listen to Me).aac | 2023-12-17 07:40 | 3.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_17_07_30_01_Chamber Orchestra Kremlin_The Seasons- December- Christmas.aac | 2023-12-17 07:35 | 3.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_16_16_30_01_La Pieta_Noel Nouvelet (arr. Claude Gagnon).aac | 2023-12-16 20:25 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_16_16_30_01_Nicolaus Esterhazy Sinfonia_Angels We Have Heard on High.aac | 2023-12-16 20:24 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_16_16_30_01_Anonymous 4_A Virgin Unspotted.aac | 2023-12-16 20:20 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_16_16_30_01_Chanticleer_Beautiful Star of Bethlehem.aac | 2023-12-16 20:18 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_16_16_30_01_St. Paul's Cathedral Choir_Gaudete! (medieval melody).aac | 2023-12-16 20:15 | 1.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_16_16_30_01_Baltimore Consort_In dir ist Freude (In you is Joy).aac | 2023-12-16 20:13 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_16_16_30_01_Bengt Forsberg, piano_English Folk Song- So Blest A Sight.aac | 2023-12-16 20:06 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_16_16_30_01_The Queen's Six_Corpus Christi Carol.aac | 2023-12-16 20:03 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_16_16_30_01_Singscape_Quem pastores.aac | 2023-12-16 20:00 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_16_16_30_01_Royal Philharmonic_El Noi de la Mare (Son of the Virgin).aac | 2023-12-16 19:58 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_16_16_30_01_The Carillon Brass_European Carol Medley (arr. Arthur Frackenpohl).aac | 2023-12-16 19:55 | 2.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_16_16_30_01_The Cambridge Singers_Once As I Remember (Italian Carol).aac | 2023-12-16 19:46 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_16_16_30_01_Seattle Pro Musica_Das Roslein, das ich meine.aac | 2023-12-16 19:43 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_16_16_30_01_Vienna Boys Choir_Stille, Stille, Stille (Austrian).aac | 2023-12-16 19:42 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_16_16_30_01_City of Prague Orchestra_O Holy Night.aac | 2023-12-16 19:40 | 2.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_16_16_30_01_West Edge String Quartet_Carol of the Bells.aac | 2023-12-16 19:36 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_16_16_30_01_Renaissonics_Fum, Fum, Fum.aac | 2023-12-16 19:33 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_16_16_30_01_24 Cellos of the London Sound_Introit- Once in Royal David's City.aac | 2023-12-16 19:31 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_16_16_30_01_Die Singphoniker_Still, o Himmel (Hush o Heaven - Bavarian carol).aac | 2023-12-16 19:28 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_16_16_30_01_Musica Sacra_Did Mary Know-.aac | 2023-12-16 19:25 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_16_16_30_01_Portland Brass Quintet_Il est bel et bon (French chanson).aac | 2023-12-16 19:15 | 846K | |
![[ ]](/icons/unknown.gif) | 2023_12_16_16_30_01_Lahti Symphony Orchestra_The Bells of Christmas.aac | 2023-12-16 19:14 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_16_16_30_01_Aulos Ensemble_When Christ Was Born On Earth.aac | 2023-12-16 19:06 | 2.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_16_16_30_01_City of London Sinfonia_Christmas Night (French Carol).aac | 2023-12-16 18:58 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_16_16_30_01_The Choir of Royal Holloway_Coventry Carol (arr. Ola Gjeilo).aac | 2023-12-16 18:54 | 2.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_16_16_30_01_Brent Mason, guitar; Mark Casstevens, guitar_The Cherry Tree Carol (arr. O'Connor).aac | 2023-12-16 18:50 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_16_16_30_01_St. Paul's Cathedral Choir_O Come, All Ye Faithful (arr. David Willcocks).aac | 2023-12-16 18:47 | 2.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_16_16_30_01_Oregon Bach Festival Chorus_Lo, How A Rose E'er Blooming.aac | 2023-12-16 18:43 | 3.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_16_16_30_01_London Baroque_Canzona - Aria.aac | 2023-12-16 18:38 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_16_16_30_01_Christopher Parkening, guitar_Infant Holy, Infant Lowly (Polish Carol).aac | 2023-12-16 18:35 | 2.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_16_16_30_01_Gloriae Dei Cantores_A Child's Welcome (From A Celebration Of Carols).aac | 2023-12-16 18:30 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_16_16_30_01_Baltimore Consort_Christmas Day in the Morning.aac | 2023-12-16 18:28 | 2.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_16_16_30_01_The Cambridge Singers_Tomorrow Shall Be My Dancing Day.aac | 2023-12-16 18:23 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_16_16_30_01_La Pieta_Laissez Paitre Vos Betes (Noel Bressan) (arr. Claude Gagnon).aac | 2023-12-16 18:21 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_16_16_30_01_Rome Sinfonietta Orchestra_Panis Angelicus.aac | 2023-12-16 18:04 | 3.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_16_16_30_01_Chanticleer_The Three Kings.aac | 2023-12-16 17:59 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_16_16_30_01_Seattle Pro Musica_Marienlieder (Songs of Mary)- The Annunciation.aac | 2023-12-16 17:56 | 2.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_16_16_30_01_Portland Revels_Jenny Pluck Pears fr English Dancing Master 1651.aac | 2023-12-16 17:52 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_16_16_30_01_Renaissonics_Joseph, lieber Joseph mein.aac | 2023-12-16 17:51 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_16_16_30_01_Ensemble Galilei_God Rest Ye Merry, Gentlemen; Good King Wenceslas.aac | 2023-12-16 17:47 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_16_16_30_01_Vienna Boys Choir_O du stille Zeit.aac | 2023-12-16 17:41 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_16_16_30_01_Die Singphoniker_Vom Himmel hoch (From Heaven on High I come to you).aac | 2023-12-16 17:39 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_16_16_30_01_Royal Ballet Sinfonia_Old Christmas Music- The First Mercy (after Peter Warlock).aac | 2023-12-16 17:37 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_16_16_30_01_National Philharmonic Orchestra_Ave Maria.aac | 2023-12-16 17:34 | 3.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_16_16_30_01_Rose Ensemble_The Babe of Bethlehem.aac | 2023-12-16 17:29 | 482K | |
![[ ]](/icons/unknown.gif) | 2023_12_16_16_30_01_The Queen's Six_Out of Your Sleep.aac | 2023-12-16 17:27 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_16_16_30_01_Schola Cantorum of Saint Peter's in the Loop_Gloria.aac | 2023-12-16 17:16 | 3.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_16_16_30_01_Musica Sacra_Saw You Never In The Twilight.aac | 2023-12-16 17:12 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_16_16_30_01_Portland Brass Quintet_Canzona per Sonare No. 4.aac | 2023-12-16 17:10 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_16_16_30_01_Lahti Symphony Orchestra_Hosianna.aac | 2023-12-16 17:06 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_16_16_30_01_Aulos Ensemble_Noel Etranger.aac | 2023-12-16 17:03 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_16_16_30_01_Kansas City Chorale_The Holy Infant's Lullaby.aac | 2023-12-16 17:00 | 3.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_16_16_30_01_St. Paul's Cathedral Choir_Coventry Carol (Lully, Lulla, Lullay).aac | 2023-12-16 16:55 | 3.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_16_16_30_01_West Edge String Quartet_A La Media Noche-De Tierra Lajana Venimos.aac | 2023-12-16 16:51 | 3.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_16_16_30_01_Renaissonics_Quando nascette Ninno.aac | 2023-12-16 16:44 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_16_16_30_01_Raymond Mase, trumpet; Fred Sherry, cello; Anne-Marie McDerm_A Christmas Medley (Joy to the World, & more).aac | 2023-12-16 16:41 | 4.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_16_16_30_01_Choir of King's College, Cambridge_I Saw a Maiden.aac | 2023-12-16 16:35 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_16_07_30_02_Robert Groslot, piano_Children's Suite- Romance- Andantino.aac | 2023-12-16 09:26 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_16_07_30_02_Piano4te_Merry Christmas Mr. Lawrence (arr. H. Otakara).aac | 2023-12-16 09:24 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_16_07_30_02_Die Singphoniker_Nu zijt wellekome (You are Welcome).aac | 2023-12-16 09:17 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_16_07_30_02_Taverner Consort, Choir & Players_O Jesulein suss (O Sweet Jesus).aac | 2023-12-16 09:15 | 2.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_16_07_30_02_Oklahoma Woodwind Quintet_Christmas Carol Medley.aac | 2023-12-16 09:11 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_16_07_30_02_Royal Philharmonic Orchestra with London Voices_He shall feed His flock.aac | 2023-12-16 09:09 | 3.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_16_07_30_02_London Symphony Brass_Canzon II a 4 for brass.aac | 2023-12-16 09:03 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_16_07_30_02_Canadian Brass_Joy to the World.aac | 2023-12-16 09:00 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_16_07_30_02_The American Boychoir_Missa Brevis- Veni Redemptor.aac | 2023-12-16 08:58 | 1.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_16_07_30_02_Arion_Noels- Amoroso.aac | 2023-12-16 08:57 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_16_07_30_02_Santa Fe Guitar Quartet_Terpsichore- Ballet (Guitar Quartet).aac | 2023-12-16 08:55 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_16_07_30_02_Bengt Forsberg, piano_Villancico Vasco (Basque Carol).aac | 2023-12-16 08:53 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_16_07_30_02_The Sixteen_Salve Regina (Plainchant).aac | 2023-12-16 08:51 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_16_07_30_02_Monteverdi Choir_Gloria in excelsis Deo (16th century).aac | 2023-12-16 08:48 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_16_07_30_02_City of London Sinfonia_I Sing Of A Maiden.aac | 2023-12-16 08:46 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_16_07_30_02_Musica Fiata_Jubiliret Frohlich (Canzona in 8 parts).aac | 2023-12-16 08:43 | 3.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_16_07_30_02_BBC Concert Orchestra_Patapan (for Woodwinds).aac | 2023-12-16 08:38 | 966K | |
![[ ]](/icons/unknown.gif) | 2023_12_16_07_30_02_Eduard Laurel, piano_Toy Soldier March.aac | 2023-12-16 08:37 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_16_07_30_02_Taverner Consort_Christmas Eve.aac | 2023-12-16 08:35 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_16_07_30_02_Taverner Consort_Blessed Be That Maid Mary.aac | 2023-12-16 08:17 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_16_07_30_02_Phoenix Chorale_A Spotless Rose.aac | 2023-12-16 08:15 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_16_07_30_02_Boston Baroque_Ich danke Dir ewiglich.aac | 2023-12-16 08:11 | 1.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_16_07_30_02_West Edge String Quartet_A La Nanita Nana (Lullaby).aac | 2023-12-16 08:09 | 2.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_16_07_30_02_Canadian Brass_Or Let the Merry Bells Ring 'Round.aac | 2023-12-16 08:05 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_16_07_30_02_The Muddy River Morris Team_Constant Billy.aac | 2023-12-16 08:03 | 1.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_16_07_30_02_Los Angeles Guitar Quartet_Nutcracker Suite, Opus 71a- Waltz of the Flowers.aac | 2023-12-16 08:01 | 3.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_16_07_30_02_Robert Shaw Festival Singers_Four Motets for Christmas- Seeing the Star.aac | 2023-12-16 07:55 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_16_07_30_02_St. George's Chapel Choir, Windsor_The Shepherd Men (Choral music).aac | 2023-12-16 07:52 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_16_07_30_02_Musica Intima_Huron Carol.aac | 2023-12-16 07:50 | 2.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_16_07_30_02_Seattle Pro Musica_Ave Maria.aac | 2023-12-16 07:46 | 2.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_16_07_30_02_Members of the Vienna Philharmonic_It Came Upon a Midnight Clear.aac | 2023-12-16 07:43 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_16_07_30_02_De Organographia_Hark! The Herald Angels Sing (4 trombones).aac | 2023-12-16 07:41 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_16_07_30_02_Royal Ballet Sinfonia_Waltz for Strings.aac | 2023-12-16 07:39 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_16_07_30_02_Bournemouth Symphony Orchestra_Traditional Slavic Christmas Music.aac | 2023-12-16 07:37 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_16_07_30_02_City of London Choir_There is no Rose, Opus 14.aac | 2023-12-16 07:34 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_15_16_30_01_Eaken Piano Trio_The Sussex Mummers' Christmas Carol.aac | 2023-12-15 20:28 | 2.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_15_16_30_01_Baltimore Consort_The Cherry Tree Carol.aac | 2023-12-15 20:25 | 3.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_15_16_30_01_Robert Shaw Chamber Singers_Alleluia.aac | 2023-12-15 20:20 | 3.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_15_16_30_01_The Choir of Queens College, Cambridge_The Holly And The Ivy.aac | 2023-12-15 20:15 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_15_16_30_01_Eric Robertson, organ_O Come, All Ye Faithful & Joy to the World.aac | 2023-12-15 20:06 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_15_16_30_01_Mainstreet Brass_Joseph lieber, Joseph mein (Brass Quintet).aac | 2023-12-15 20:04 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_15_16_30_01_Royal Philharmonic Orchestra with London Voices_He shall feed His flock.aac | 2023-12-15 19:59 | 4.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_15_16_30_01_The Cambridge Singers_Blessed Be That Maid Mary.aac | 2023-12-15 19:51 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_15_16_30_01_City of London Sinfonia_Love Came Down At Christmas.aac | 2023-12-15 19:48 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_15_16_30_01_University of Portland Singers_Austrian Carol Medley (arr. Michael Connolly).aac | 2023-12-15 19:46 | 5.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_15_16_30_01_24 Cellos of the London Sound_The Nutcracker - Pas de Deux.aac | 2023-12-15 19:37 | 3.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_15_16_30_01_Pittsburgh Symphony Brass_Volte.aac | 2023-12-15 19:33 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_15_16_30_01_Empire Brass_Sheep May Safely Graze (Cantata BWV 208).aac | 2023-12-15 19:31 | 3.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_15_16_30_01_Young People's Chorus of New York_Silent Night.aac | 2023-12-15 19:24 | 2.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_15_16_30_01_The King's Singers_Lux Aurumque (Light and Gold).aac | 2023-12-15 19:21 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_15_16_30_01_Vienna Boys Choir_Auf dem Berge, da wehet der Wind (Wind Blows on the Mountain.aac | 2023-12-15 19:17 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_15_16_30_01_Oregon Ballet Theatre Orchestr_The Nutcracker- Overture.aac | 2023-12-15 19:15 | 2.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_15_16_30_01_Cantus_Coventry Carol.aac | 2023-12-15 19:12 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_15_16_30_01_Capella Istropolitana_German Dances, K.605- No.3 -Sleigh Ride-.aac | 2023-12-15 19:10 | 2.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_15_16_30_01_Los Angeles Guitar Quartet_Nutcracker Suite, Opus 71a- Waltz of the Flowers.aac | 2023-12-15 19:06 | 3.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_15_16_30_01_Empire Brass_Make a Joyful Noise.aac | 2023-12-15 19:01 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_15_16_30_01_Portland Symphonic Choir_Vespers, Op 37- (6) Rejoice, O Virgin.aac | 2023-12-15 18:57 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_15_16_30_01_Vasari Singers_The Christ-child.aac | 2023-12-15 18:54 | 3.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_15_16_30_01_Katherine Murdock, viola; Nathaniel Rosen, cello_Angels' Carol.aac | 2023-12-15 18:49 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_15_16_30_01_Pro Arte Singers_Give good gifts to one another.aac | 2023-12-15 18:45 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_15_16_30_01_Seattle Pro Musica_Deustches (German) Magnificat.aac | 2023-12-15 18:44 | 4.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_15_16_30_01_New York Pops_Carol of the Drum.aac | 2023-12-15 18:37 | 2.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_15_16_30_01_Baltimore Consort_Drive the Cold Winter Away.aac | 2023-12-15 18:33 | 2.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_15_16_30_01_Chicago Symphony_Messiah- -I know that my Redeemer liveth-.aac | 2023-12-15 18:30 | 4.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_15_16_30_01_The Queen's Six_Gabriel's Message.aac | 2023-12-15 18:24 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_15_16_30_01_The Cambridge Singers_All My Heart This Night Rejoices.aac | 2023-12-15 18:21 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_15_16_30_01_Die Singphoniker_Canco de hadal (Catalan Christmas song).aac | 2023-12-15 18:19 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_15_16_30_01_Musica Sacra_Of The Father's Love Begotten.aac | 2023-12-15 18:00 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_15_16_30_01_Les Boreades de Montreal_Noel provencal.aac | 2023-12-15 17:53 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_15_16_30_01_The Carillon Brass_Fum, Fum, Fum.aac | 2023-12-15 17:51 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_15_16_30_01_Schwerin Brass Player Collegium_Canzona No. 45 in 8 parts from -Sacri Concentus- (1601).aac | 2023-12-15 17:49 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_15_16_30_01_Tafelmusik Baroque Orchestra_Messiah- Rejoice greatly, O daughter of Zion.aac | 2023-12-15 17:45 | 3.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_15_16_30_01_Sinfonia Cymru_Lullaby for Ana Gwen.aac | 2023-12-15 17:40 | 3.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_15_16_30_01_In Mulieribus (Portland ens.)_There is no rose of such virtue.aac | 2023-12-15 17:30 | 3.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_15_16_30_01_Voces 8_My Lord Has Come.aac | 2023-12-15 17:25 | 2.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_15_16_30_01_Cincinnati Pops Orchestra_Angel's Dance.aac | 2023-12-15 17:22 | 3.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_15_16_30_01_De Organographia_Hark! The Herald Angels Sing (4 trombones).aac | 2023-12-15 17:14 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_15_16_30_01_Hollywood Bowl Orchestra_Away In A Manger.aac | 2023-12-15 17:12 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_15_16_30_01_RIAS Chamber Choir_Schlaf, mein Kindelein (Sleep, my little child).aac | 2023-12-15 16:59 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_15_16_30_01_Billband_Sparkle.aac | 2023-12-15 16:57 | 2.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_15_16_30_01_Les Boreades de Montreal_Bon Joseph ecoute moy (Good Joseph Listen to Me).aac | 2023-12-15 16:49 | 3.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_15_16_30_01_Taylor Festival Choir & Players_This Evenfall 'tis Snowing.aac | 2023-12-15 16:44 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_15_16_30_01_Empire Brass_Three Chorales.aac | 2023-12-15 16:40 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_15_16_30_01_Pavao String Quartet_Shepherd's Farewell (arr. Carlo Martelli).aac | 2023-12-15 16:36 | 3.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_15_07_30_01_Royal Philharmonic Orchestra_Ave Maria.aac | 2023-12-15 09:28 | 3.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_15_07_30_01_Royal Ballet Sinfonia_Waltz for Strings.aac | 2023-12-15 09:23 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_15_07_30_01_Vienna Boys Choir_Entre le boeuf et l'ane gris.aac | 2023-12-15 09:21 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_15_07_30_01_Ola Gjeilo, piano, and 12 Ensemble_Away in a Manger (arr. Ola Gjeilo).aac | 2023-12-15 09:18 | 2.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_15_07_30_01_Stuttgart Chamber Choir_Es ist ein Ros entsprungen.aac | 2023-12-15 09:14 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_15_07_30_01_Eteri Andjaparidze, piano_Weihnachtsbaum (Christmas Tree)- In dulci jubilo.aac | 2023-12-15 09:09 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_15_07_30_01_Bournemouth Symphony Orchestra_Traditional Slavic Christmas Music.aac | 2023-12-15 09:05 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_15_07_30_01_Empire Brass_Sleepers Wake (Cantata BWV 140).aac | 2023-12-15 09:02 | 3.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_15_07_30_01_New York Polyphony_There is no Rose.aac | 2023-12-15 08:57 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_15_07_30_01_In Mulieribus (Portland ens.)_Ave Maria.aac | 2023-12-15 08:53 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_15_07_30_01_Ensemble 94_Une jeune pucelle (A young virgin of noble heart...).aac | 2023-12-15 08:51 | 1.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_15_07_30_01_Tafelmusik Baroque Orchestra_Messiah- Rejoice greatly, O daughter of Zion.aac | 2023-12-15 08:49 | 3.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_15_07_30_01_Polyphony_Lullay (from Stella Natalis - Star of the Nativity).aac | 2023-12-15 08:41 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_15_07_30_01_Cantus_Awed by the Beauty.aac | 2023-12-15 08:37 | 3.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_15_07_30_01_St. Paul's Cathedral Choir_Hark! The Herald Angels Sing.aac | 2023-12-15 08:33 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_15_07_30_01_Foothills Brass Quintet_Jesu Bambino.aac | 2023-12-15 08:30 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_15_07_30_01_The King's Noyse_The New Year's gift.aac | 2023-12-15 08:27 | 750K | |
![[ ]](/icons/unknown.gif) | 2023_12_15_07_30_01_Pavao String Quartet_Christmas Medley (arr. Carlo Martelli).aac | 2023-12-15 08:24 | 4.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_15_07_30_01_Malle Babbe Women's Choir_Ave Maria (16th century setting).aac | 2023-12-15 08:18 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_15_07_30_01_RIAS Chamber Choir_Schlaf, mein Kindelein (Sleep, my little child).aac | 2023-12-15 08:16 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_15_07_30_01_The American Boychoir_Missa Brevis- Gloria.aac | 2023-12-15 08:14 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_15_07_30_01_West Edge String Quartet_The Wexford Carol.aac | 2023-12-15 08:11 | 2.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_15_07_30_01_Czech Radio Symphony Orchestra_Gaelic Lullaby.aac | 2023-12-15 08:02 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_15_07_30_01_Choir of Gonville & Caius College, Cambridge_Ave Maria.aac | 2023-12-15 07:59 | 3.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_15_07_30_01_Voces 8_Locus iste.aac | 2023-12-15 07:55 | 2.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_15_07_30_01_Mainstreet Brass_Gloucestershire Wassail (arr. Brass Quintet).aac | 2023-12-15 07:50 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_15_07_30_01_Choir of King's College, Cambridge_Angels from the Realms of Glory.aac | 2023-12-15 07:49 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_15_07_30_01_Katherine Murdock, viola; Nathaniel Rosen, cello_Good King Wenceslas.aac | 2023-12-15 07:45 | 626K | |
![[ ]](/icons/unknown.gif) | 2023_12_15_07_30_01_Kay Johannsen, organ_Wie soll ich dich empfangen (How shall I receive thee).aac | 2023-12-15 07:44 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_15_07_30_01_Philharmonia Orchestra_O Holy Night.aac | 2023-12-15 07:42 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_15_07_30_01_Monteverdi Choir_O Maria vernans rosa.aac | 2023-12-15 07:37 | 3.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_14_18_30_02_City of London Sinfonia_What Is This Fragrance.aac | 2023-12-14 21:29 | 2.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_14_18_30_02_Voces 8_Lux Aeterna- O Nata Lux.aac | 2023-12-14 21:26 | 3.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_14_18_30_02_West Edge String Quartet_The First Nowell.aac | 2023-12-14 21:21 | 2.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_14_18_30_02_National Flute Choir_He Is Born, the Divine Child.aac | 2023-12-14 21:17 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_14_18_30_02_SWR Radio Orch Kaiserslautern_Christmas Oratorio- Sinfonia.aac | 2023-12-14 21:15 | 3.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_14_18_30_02_In Mulieribus (Portland ens.)_Ave Maria.aac | 2023-12-14 21:10 | 1.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_14_18_30_02_The Cambridge Singers_Away in a manger.aac | 2023-12-14 21:08 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_14_18_30_02_Arsys Bourgogne_Les anges dans nos campagnes.aac | 2023-12-14 21:05 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_14_18_30_02_Chanticleer_Spanish Carol.aac | 2023-12-14 21:02 | 2.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_14_18_30_02_Baltimore Consort_Ding, Dong! merrily on high.aac | 2023-12-14 20:58 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_14_18_30_02_BBC Concert Orchestra_Carols for Woodwinds- Angels in our Fields.aac | 2023-12-14 20:56 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_14_18_30_02_St. Paul's Cathedral Choir_O Holy Night (arr. John Rutter).aac | 2023-12-14 20:53 | 3.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_14_18_30_02_Orchestra_We Thank Thee, Lord (Cantata 29).aac | 2023-12-14 20:44 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_14_18_30_02_London Festival Orchestra_Shepherd's Music for Christmas.aac | 2023-12-14 20:40 | 3.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_14_18_30_02_New York Polyphony_Sleep Now.aac | 2023-12-14 20:34 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_14_18_30_02_Cologne Radio Orchestra_Hansel and Gretel- Evening Prayer.aac | 2023-12-14 20:32 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_14_18_30_02_Trinity Cathedral Choir, Portland_Jesus Christ the Apple Tree.aac | 2023-12-14 20:30 | 2.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_14_18_30_02_Schwerin Brass Player Collegium_Kommet, ihr Hirten (Come, ye shepherds).aac | 2023-12-14 20:27 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_14_18_30_02_Kay Johannsen, organ_Morgen kommt der Weihnachtsmann.aac | 2023-12-14 20:25 | 870K | |
![[ ]](/icons/unknown.gif) | 2023_12_14_18_30_02_Academy of St Martin in Fields_Four Seasons- -Winter-- 2nd Mvmt (by the hearth).aac | 2023-12-14 20:24 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_14_18_30_02_Pro Arte Singers_To Bethlem did they go.aac | 2023-12-14 20:22 | 3.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_14_18_30_02_Vasari Singers_The Stable Door.aac | 2023-12-14 20:18 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_14_18_30_02_Seattle Pro Musica_Puer natus in Bethlehem (A child is born in Bethlehem).aac | 2023-12-14 20:15 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_14_18_30_02_Rome Sinfonietta Orchestra_Ave Maria.aac | 2023-12-14 20:12 | 2.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_14_18_30_02_Schwerin Brass Collegium_Quem pastores laudavere (The shepherds praised).aac | 2023-12-14 20:09 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_14_18_30_02_Sinfonia Cymru_Lullaby for Pegi.aac | 2023-12-14 20:06 | 2.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_14_18_30_02_Debra Torok & Marylene Dosse, piano_Christmas Music for piano 4-hands- Silent Night.aac | 2023-12-14 20:02 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_14_18_30_02_University of Portland Singers_Austrian Carol Medley (arr. Michael Connolly).aac | 2023-12-14 20:01 | 5.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_14_16_58_36_Copley Singers_Shepherd's Carol.aac | 2023-12-14 19:53 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_14_16_58_36_Brent Mason, guitar; Mark Casstevens, guitar; John Jarvis, p_Carol of the Bells (arr. O'Connor).aac | 2023-12-14 19:46 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_14_16_58_36_West Edge String Quartet_Coventry Carol.aac | 2023-12-14 19:42 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_14_16_58_36_Christopher Parkening, guitar_El Noi de la Mare (Son of the Virgin).aac | 2023-12-14 19:38 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_14_16_58_36_Oklahoma Woodwind Quintet_What Child Is This-.aac | 2023-12-14 19:36 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_14_16_58_36_Arsys Bourgogne_Tebe pojem.aac | 2023-12-14 19:32 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_14_16_58_36_RIAS Chamber Choir_Lasset uns frohlocken (Let Us Rejoice).aac | 2023-12-14 19:26 | 834K | |
![[ ]](/icons/unknown.gif) | 2023_12_14_16_58_36_True North Brass_Hodie, Christus Natus Est (brass ensemble).aac | 2023-12-14 19:20 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_14_16_58_36_Bach Trumpet Ensemble of Munich_Sonata 'Ad Festum Paschatis'.aac | 2023-12-14 19:19 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_14_18_30_02_Emory Symphonic Winds_Symphonic Prelude on -Adeste Fideles-.aac | 2023-12-14 19:16 | 2.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_14_16_58_36_Paul O'Dette, lute_Es ist ein Ros entsprungen.aac | 2023-12-14 19:13 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_14_18_30_02_In Mulieribus (Portland ens.)_Angelus ad virginem.aac | 2023-12-14 19:10 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_14_18_30_02_Pomerium_In dulci jubilo a 2.aac | 2023-12-14 19:07 | 634K | |
![[ ]](/icons/unknown.gif) | 2023_12_14_18_30_02_Voces 8_Locus iste.aac | 2023-12-14 19:07 | 2.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_14_16_58_36_Ensemble 94_Ou s'en vont ces gays bergers.aac | 2023-12-14 19:02 | 858K | |
![[ ]](/icons/unknown.gif) | 2023_12_14_16_58_36_Yolanda Kondonassis, harp_O Sleep, My Pretty Baby.aac | 2023-12-14 18:58 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_14_18_30_02_BBC Singers_Sing Lullaby.aac | 2023-12-14 18:56 | 2.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_14_16_58_36_Oregon Bach Festival Chorus_Christmas Day is Come.aac | 2023-12-14 18:52 | 1.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_14_16_58_36_24 Cellos of the London Sound_Troika - O Little Town of Bethlehem (cellos).aac | 2023-12-14 18:50 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_14_16_58_36_The Cambridge Singers_Lute-Book Lullaby.aac | 2023-12-14 18:47 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_14_18_30_02_Epic Brass_Sleigh Ride.aac | 2023-12-14 18:45 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_14_18_30_02_Carsten Linck, guitar_Morgen, Kinder, wird's was geben.aac | 2023-12-14 18:42 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_14_18_30_02_Trinity Cathedral Choir, Portland_The Cherry Tree Carol.aac | 2023-12-14 18:37 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_14_18_30_02_St. Paul's Cathedral Choir_Once In Royal David's City (arr. Mann).aac | 2023-12-14 18:34 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_14_16_58_36_Eaken Piano Trio_The Nutcracker- Waltz of the Flowers.aac | 2023-12-14 18:28 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_14_16_58_36_Gerold Huber, piano_Inmitten der nacht.aac | 2023-12-14 18:26 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_14_16_58_36_Portland State Chamber Choir_Pater Noster.aac | 2023-12-14 18:23 | 4.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_14_16_58_36_The Sixteen_Ave Maris Stella.aac | 2023-12-14 18:17 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_14_16_58_36_Academy of St Martin in the Fields_The Skaters Waltz (Les Patineurs), Opus 183.aac | 2023-12-14 18:14 | 5.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_14_16_58_36_La Pieta_The Holy Boy.aac | 2023-12-14 18:05 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_14_16_58_36_Royal Ballet Sinfonia_Fairytale Suite- Snow Scene.aac | 2023-12-14 18:02 | 962K | |
![[ ]](/icons/unknown.gif) | 2023_12_14_16_58_36_Quire Cleveland_(I'm Spending) Hanukkah in Santa Monica.aac | 2023-12-14 17:48 | 2.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_14_16_58_36_Eaken Piano Trio_Chanukah (Hanukkah) Suite.aac | 2023-12-14 17:26 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_14_16_58_36_Barenaked Ladies_Hanukkah, Oh Hanukkah.aac | 2023-12-14 17:11 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_14_07_30_01_Prague Philharmonic Orchestra_Bethlehem Down.aac | 2023-12-14 09:26 | 2.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_14_07_30_01_Grex Vocalis_Kling no klokka (The bells ring, they sound).aac | 2023-12-14 09:21 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_14_07_30_01_Kampin Laulu Chamber Choir_Ecce novum gaudium (Behold the new Joy).aac | 2023-12-14 09:19 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_14_07_30_01_Carolina Chamber Chorale_Hannerot Hallalu (Hanukkah song).aac | 2023-12-14 09:13 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_14_07_30_01_Oregon Ballet Theatre Orchestra_The Nutcracker- Waltz of the Flowers.aac | 2023-12-14 09:08 | 4.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_14_07_30_01_Schwerin Brass Player Collegium_Schlaf wohl, du Himmelsknabe (Sleep well, Child from Heaven).aac | 2023-12-14 09:01 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_14_07_30_01_New York Polyphony_Nowell- Arise and Wake.aac | 2023-12-14 08:59 | 2.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_14_07_30_01_Seraphic Fire_Once As I Remember (arr. Charles Wood).aac | 2023-12-14 08:55 | 1.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_14_07_30_01_West Edge String Quartet_The Bells of Christmas- A Medley of Two Modern Carols.aac | 2023-12-14 08:53 | 4.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_14_07_30_01_Eaken Piano Trio_Winter Wonderland.aac | 2023-12-14 08:47 | 1.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_14_07_30_01_Czech Radio Symphony Orchestra_The Seasons- Winter- Frost, snow, ice.aac | 2023-12-14 08:45 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_14_07_30_01_Claude Gagnon, guitar; David Jacques, guitar; Nicole Trotier_O Joyful Children (arr. Claude Gagnon).aac | 2023-12-14 08:38 | 2.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_14_07_30_01_The Choral Project_The Wassail Song.aac | 2023-12-14 08:33 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_14_07_30_01_RIAS Chamber Choir_O freudenreicher Tag (O Joyous Day).aac | 2023-12-14 08:29 | 1.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_14_07_30_01_Malle Babbe Women's Choir_Der Englische Gruss (The Annunciation).aac | 2023-12-14 08:27 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_14_07_30_01_Choir of Gonville & Caius College, Cambridge_Rocking (Czech Carol, arr. Edward Higginbottom).aac | 2023-12-14 08:23 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_14_07_30_01_Rochester Philharmonic_Chanukah (Hanukkah) Suite.aac | 2023-12-14 08:14 | 5.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_14_07_30_01_Taverner Choir_Chant- Antiphon from Chester Processional.aac | 2023-12-14 08:06 | 1.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_14_07_30_01_Portland Brass Quintet_Deck the Hall.aac | 2023-12-14 08:03 | 694K | |
![[ ]](/icons/unknown.gif) | 2023_12_14_07_30_01_Etherea Vocal Ensemble_Gabriel's Message (arr. John Rutter).aac | 2023-12-14 08:02 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_14_07_30_01_Vienna Boys Choir_Entre le boeuf et l'ane gris.aac | 2023-12-14 07:59 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_14_07_30_01_Royal Philharmonic Orchestra with London Voices_He shall feed His flock.aac | 2023-12-14 07:57 | 3.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_14_07_30_01_St. Thomas Choir, Leipzig_Ich Steh An Deiner Krippen Hier.aac | 2023-12-14 07:47 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_14_07_30_01_The Queen's Six_Gabriel's Message.aac | 2023-12-14 07:44 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_14_07_30_01_Baltimore Consort_Chestnut (A Wassail Tune).aac | 2023-12-14 07:38 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_14_07_30_01_Netherlands Bach Society_Christmas Oratorio (Pt. 2)- Sinfonia.aac | 2023-12-14 07:35 | 3.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_13_18_30_02_The Bekova Sisters_The Christmas Tree- Waltz.aac | 2023-12-13 21:25 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_13_18_30_02_In Mulieribus (Portland ens.)_Ave Maria.aac | 2023-12-13 21:22 | 1.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_13_18_30_02_The Cambridge Singers_Away in a manger.aac | 2023-12-13 21:20 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_13_18_30_02_Arsys Bourgogne_Les anges dans nos campagnes.aac | 2023-12-13 21:17 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_13_18_30_02_Chanticleer_Spanish Carol.aac | 2023-12-13 21:14 | 2.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_13_18_30_02_Baltimore Consort_Ding, Dong! merrily on high.aac | 2023-12-13 21:10 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_13_18_30_02_BBC Concert Orchestra_Carols for Woodwinds- Angels in our Fields.aac | 2023-12-13 21:08 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_13_18_30_02_St. Paul's Cathedral Choir_O Holy Night (arr. John Rutter).aac | 2023-12-13 21:05 | 4.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_13_18_30_02_Orchestra_We Thank Thee, Lord (Cantata 29).aac | 2023-12-13 20:56 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_13_18_30_02_London Festival Orchestra_Shepherd's Music for Christmas.aac | 2023-12-13 20:52 | 4.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_13_18_30_02_New York Polyphony_Sleep Now.aac | 2023-12-13 20:44 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_13_18_30_02_Cologne Radio Orchestra_Hansel and Gretel- Evening Prayer.aac | 2023-12-13 20:43 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_13_18_30_02_Trinity Cathedral Choir, Portland_Jesus Christ the Apple Tree.aac | 2023-12-13 20:41 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_13_18_30_02_Schwerin Brass Player Collegium_Kommet, ihr Hirten (Come, ye shepherds).aac | 2023-12-13 20:37 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_13_18_30_02_Kay Johannsen, organ_Morgen kommt der Weihnachtsmann.aac | 2023-12-13 20:36 | 858K | |
![[ ]](/icons/unknown.gif) | 2023_12_13_18_30_02_Academy of St Martin in Fields_Four Seasons- -Winter-- 2nd Mvmt (by the hearth).aac | 2023-12-13 20:34 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_13_18_30_02_Pro Arte Singers_To Bethlem did they go.aac | 2023-12-13 20:33 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_13_18_30_02_Vasari Singers_The Stable Door.aac | 2023-12-13 20:30 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_13_18_30_02_Seattle Pro Musica_Puer natus in Bethlehem (A child is born in Bethlehem).aac | 2023-12-13 20:27 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_13_18_30_02_Rome Sinfonietta Orchestra_Ave Maria.aac | 2023-12-13 20:24 | 2.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_13_18_30_02_Schwerin Brass Collegium_Quem pastores laudavere (The shepherds praised).aac | 2023-12-13 20:21 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_13_18_30_02_Sinfonia Cymru_Lullaby for Pegi.aac | 2023-12-13 20:18 | 2.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_13_18_30_02_Debra Torok & Marylene Dosse, piano_Christmas Music for piano 4-hands- Silent Night.aac | 2023-12-13 20:14 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_13_18_30_02_University of Portland Singers_Austrian Carol Medley (arr. Michael Connolly).aac | 2023-12-13 20:13 | 5.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_13_18_30_02_Copley Singers_Shepherd's Carol.aac | 2023-12-13 20:04 | 3.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_13_18_30_02_Brent Mason, guitar; Mark Casstevens, guitar; John Jarvis, p_Carol of the Bells (arr. O'Connor).aac | 2023-12-13 19:56 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_13_18_30_02_West Edge String Quartet_Coventry Carol.aac | 2023-12-13 19:52 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_13_18_30_02_Christopher Parkening, guitar_El Noi de la Mare (Son of the Virgin).aac | 2023-12-13 19:49 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_13_18_30_02_Oklahoma Woodwind Quintet_What Child Is This-.aac | 2023-12-13 19:46 | 2.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_13_18_30_02_Arsys Bourgogne_Tebe pojem.aac | 2023-12-13 19:42 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_13_18_30_02_RIAS Chamber Choir_Lasset uns frohlocken (Let Us Rejoice).aac | 2023-12-13 19:37 | 834K | |
![[ ]](/icons/unknown.gif) | 2023_12_13_18_30_02_True North Brass_Hodie, Christus Natus Est (brass ensemble).aac | 2023-12-13 19:30 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_13_18_30_02_Bach Trumpet Ensemble of Munich_Sonata 'Ad Festum Paschatis'.aac | 2023-12-13 19:29 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_13_18_30_02_Emory Symphonic Winds_Symphonic Prelude on -Adeste Fideles-.aac | 2023-12-13 19:26 | 2.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_13_18_30_02_Paul O'Dette, lute_Es ist ein Ros entsprungen.aac | 2023-12-13 19:23 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_13_18_30_02_In Mulieribus (Portland ens.)_Angelus ad virginem.aac | 2023-12-13 19:20 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_13_18_30_02_Voces 8_Locus iste.aac | 2023-12-13 19:18 | 2.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_13_18_30_02_Ensemble 94_Ou s'en vont ces gays bergers.aac | 2023-12-13 19:13 | 858K | |
![[ ]](/icons/unknown.gif) | 2023_12_13_18_30_02_Yolanda Kondonassis, harp_O Sleep, My Pretty Baby.aac | 2023-12-13 19:10 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_13_18_30_02_BBC Singers_Sing Lullaby.aac | 2023-12-13 19:07 | 2.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_13_18_30_02_Oregon Bach Festival Chorus_Christmas Day is Come.aac | 2023-12-13 19:04 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_13_18_30_02_Choir of Magdalen College, Oxford_Sweet was the Song.aac | 2023-12-13 19:01 | 2.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_13_18_30_02_The Cambridge Singers_Lute-Book Lullaby.aac | 2023-12-13 18:58 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_13_18_30_02_Epic Brass_Sleigh Ride.aac | 2023-12-13 18:56 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_13_18_30_02_Carsten Linck, guitar_Morgen, Kinder, wird's was geben.aac | 2023-12-13 18:53 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_13_18_30_02_Trinity Cathedral Choir, Portland_The Cherry Tree Carol.aac | 2023-12-13 18:48 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_13_18_30_02_St. Paul's Cathedral Choir_Once In Royal David's City (arr. Mann).aac | 2023-12-13 18:45 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_13_18_30_02_Royal Ballet Sinfonia_Fairytale Suite- Snow Scene.aac | 2023-12-13 18:39 | 962K | |
![[ ]](/icons/unknown.gif) | 2023_12_13_18_30_02_Eaken Piano Trio_The Nutcracker- Waltz of the Flowers.aac | 2023-12-13 18:38 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_13_18_30_02_Gerold Huber, piano_Inmitten der nacht.aac | 2023-12-13 18:35 | 1.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_13_18_30_02_The Sixteen_Ave Maris Stella.aac | 2023-12-13 18:33 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_13_07_30_01_Chanticleer_The Three Kings.aac | 2023-12-13 09:26 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_13_07_30_01_Prague Philharmonic Orchestra_Bethlehem Down.aac | 2023-12-13 09:23 | 3.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_13_07_30_01_Grex Vocalis_Kling no klokka (The bells ring, they sound).aac | 2023-12-13 09:19 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_13_07_30_01_Kampin Laulu Chamber Choir_Ecce novum gaudium (Behold the new Joy).aac | 2023-12-13 09:17 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_13_07_30_01_Carolina Chamber Chorale_Hannerot Hallalu (Hanukkah song).aac | 2023-12-13 09:10 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_13_07_30_01_Oregon Ballet Theatre Orchestra_The Nutcracker- Waltz of the Flowers.aac | 2023-12-13 09:05 | 4.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_13_07_30_01_Schwerin Brass Player Collegium_Schlaf wohl, du Himmelsknabe (Sleep well, Child from Heaven).aac | 2023-12-13 08:58 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_13_07_30_01_Seraphic Fire_Once As I Remember (arr. Charles Wood).aac | 2023-12-13 08:54 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_13_07_30_01_Die Singphoniker_Canco de hadal (Catalan Christmas song).aac | 2023-12-13 08:52 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_13_07_30_01_Debra Torok & Marylene Dosse, piano_Christmas Music for piano 4-hands- God Rest You Merry....aac | 2023-12-13 08:50 | 1.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_13_07_30_01_West Edge String Quartet_The Bells of Christmas- A Medley of Two Modern Carols.aac | 2023-12-13 08:48 | 4.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_13_07_30_01_Claude Gagnon, guitar; David Jacques, guitar; Nicole Trotier_O Joyful Children (arr. Claude Gagnon).aac | 2023-12-13 08:42 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_13_07_30_01_RIAS Chamber Choir_O freudenreicher Tag (O Joyous Day).aac | 2023-12-13 08:39 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_13_07_30_01_Malle Babbe Women's Choir_Der Englische Gruss (The Annunciation).aac | 2023-12-13 08:38 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_13_07_30_01_Choir of Gonville & Caius College, Cambridge_Rocking (Czech Carol, arr. Edward Higginbottom).aac | 2023-12-13 08:34 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_13_07_30_01_The Choral Project_The Wassail Song.aac | 2023-12-13 08:32 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_13_07_30_01_Amsterdam Baroque Orchestra_The Four Seasons- Winter- By the Hearth.aac | 2023-12-13 08:06 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_13_07_30_01_Taverner Choir_Chant- Antiphon from Chester Processional.aac | 2023-12-13 08:05 | 1.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_13_07_30_01_Portland Brass Quintet_Deck the Hall.aac | 2023-12-13 08:01 | 694K | |
![[ ]](/icons/unknown.gif) | 2023_12_13_07_30_01_Etherea Vocal Ensemble_Gabriel's Message (arr. John Rutter).aac | 2023-12-13 08:00 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_13_07_30_01_Vienna Boys Choir_Entre le boeuf et l'ane gris.aac | 2023-12-13 07:57 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_13_07_30_01_Royal Philharmonic Orchestra with London Voices_He shall feed His flock.aac | 2023-12-13 07:55 | 3.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_13_07_30_01_St. Thomas Choir, Leipzig_Ich Steh An Deiner Krippen Hier.aac | 2023-12-13 07:45 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_13_07_30_01_The Queen's Six_Gabriel's Message.aac | 2023-12-13 07:43 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_13_07_30_01_Baltimore Consort_Chestnut (A Wassail Tune).aac | 2023-12-13 07:36 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_12_19_56_09_St. Paul's Cathedral Choir_Coventry Carol (Lully, Lulla, Lullay).aac | 2023-12-12 21:26 | 3.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_12_19_56_09_Seattle Pro Musica_Meine Seele erhebt Gott, den Herren.aac | 2023-12-12 21:21 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_12_19_56_09_Katherine Murdock, viola; Nathaniel Rosen, cello_Gaudeamus (string quartet).aac | 2023-12-12 21:19 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_12_19_56_09_Cincinnati Pops Orchestra_We Three Kings.aac | 2023-12-12 21:15 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_12_19_56_09_The Toronto Consort_Now Candlemas is come at last.aac | 2023-12-12 21:13 | 2.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_12_19_56_09_The American Boychoir_Up! good Christian folk and listen.aac | 2023-12-12 21:08 | 1.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_12_19_56_09_Saint Petersburg Chamber Choir_Four Russian Christmas carols (1 & 3 sung in Ukrainian).aac | 2023-12-12 21:07 | 3.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_12_19_56_09_The Queen's Six_Balulalow.aac | 2023-12-12 21:01 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_12_19_56_09_Vermont Symphony Orchestra Brass Quintet_Christmas Crackers- Angels from the Realms of Glory, et al..aac | 2023-12-12 20:59 | 2.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_12_19_56_09_Schubert Academy_Frohliche Weihnacht uberall.aac | 2023-12-12 20:50 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_12_19_56_09_City of London Sinfonia_Wild Wood Carol.aac | 2023-12-12 20:47 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_12_19_56_09_The Cambridge Singers_O Tannenbaum (O Christmas Tree).aac | 2023-12-12 20:44 | 1.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_12_19_56_09_Kay Johannsen, organ_Wie soll ich dich empfangen (How shall I receive thee).aac | 2023-12-12 20:42 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_12_19_56_09_Rome Sinfonietta Orchestra_Ave Maria.aac | 2023-12-12 20:39 | 2.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_12_19_56_09_The Trail Band_It Came Upon a Midnight Clear.aac | 2023-12-12 20:35 | 1.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_12_19_56_09_Trinity Cathedral Choir, Portland_The Linden Tree Carol.aac | 2023-12-12 20:33 | 3.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_12_19_56_09_Harrington String Quartet; Phoenix Chorale_The Ground (adapted from Sunrise Mass).aac | 2023-12-12 20:29 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_12_19_56_09_Westminster Choir College of Rider University_Twinkle, Twinkle Little Star.aac | 2023-12-12 20:25 | 2.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_12_19_56_09_Jessica Gordon, guitar_Ding Dong Merrily On High.aac | 2023-12-12 20:20 | 938K | |
![[ ]](/icons/unknown.gif) | 2023_12_12_19_56_09_RIAS Chamber Choir_In der Christnacht.aac | 2023-12-12 20:18 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_12_19_56_09_Aulos Ensemble_Shepherds Shake Off Your Drowsy Sleep.aac | 2023-12-12 20:15 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_12_19_56_09_Seraphic Fire_Jesus Christ the Apple Tree.aac | 2023-12-12 20:13 | 3.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_12_19_56_09_St. Paul's Cathedral Choir_There Is No Rose.aac | 2023-12-12 20:09 | 1.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_12_19_56_09_Sistine Chapel Choir_Adoramus te, Christe (We Adore Thee, Christ).aac | 2023-12-12 20:07 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_12_19_56_09_Singscape_Quem pastores.aac | 2023-12-12 20:04 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_12_19_56_09_La Pieta_Noel Nouvelet (arr. Claude Gagnon).aac | 2023-12-12 20:03 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_12_19_56_09_Baltimore Consort_Wir singen dir, Immanuel (We sing unto You, Emmanuel).aac | 2023-12-12 20:00 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_12_18_30_01_Bournemouth Sinfonietta_St. Paul's Suite, Opus 29 no 2- Mvmt 4 Finale (The Dargason).aac | 2023-12-12 19:50 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_12_18_30_01_Joshua Bell, violin; Thomas Bartlett, piano; Rob Moose, guit_I Want an Old Fashioned Christmas.aac | 2023-12-12 19:47 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_12_18_30_01_Yolanda Kondonassis, harp_Bring a Torch, Jeanette, Isabella.aac | 2023-12-12 19:43 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_12_18_30_01_The American Boychoir_A Boy was Born.aac | 2023-12-12 19:41 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_12_18_30_01_Cantus_Coventry Carol.aac | 2023-12-12 19:38 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_12_18_30_01_Young People's Chorus of New York_Silent Night.aac | 2023-12-12 19:36 | 2.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_12_18_30_01_Westminster Concert Bell Choir_Jesu, Joy of Man's Desiring (Cantata BWV 147).aac | 2023-12-12 19:33 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_12_18_30_01_Marc Gagnon, violin_El Noy de la Mare (Catalan traditional melody).aac | 2023-12-12 19:29 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_12_18_30_01_Emory Symphonic Winds_Greensleaves (arr. Alfred Reed).aac | 2023-12-12 19:27 | 3.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_12_18_30_01_The Choir of Queens College, Cambridge_The Holly And The Ivy.aac | 2023-12-12 19:16 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_12_18_30_01_Monteverdi Choir_Es ist ein Ros' entsprungen (16th c. German).aac | 2023-12-12 19:13 | 2.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_12_18_30_01_St. Thomas Choir, Leipzig_In Dulci Jubio.aac | 2023-12-12 19:07 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_12_18_30_01_Die Singphoniker_Nu zijt wellekome (You are Welcome).aac | 2023-12-12 19:04 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_12_18_30_01_Foothills Brass Quintet_Jesu Bambino.aac | 2023-12-12 19:02 | 2.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_12_18_30_01_Mainstreet Brass_Joseph lieber, Joseph mein (Brass Quintet).aac | 2023-12-12 18:58 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_12_18_30_01_Chanticleer_Spanish Carol.aac | 2023-12-12 18:56 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_12_18_30_01_Ensemble 94_Une jeune pucelle (A young virgin of noble heart...).aac | 2023-12-12 18:54 | 1.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_12_18_30_01_Arion_Noels- Amoroso.aac | 2023-12-12 18:53 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_12_18_30_01_Santa Fe Guitar Quartet_Terpsichore- Ballet (Guitar Quartet).aac | 2023-12-12 18:51 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_12_18_30_01_The Cambridge Singers_Ave Maria.aac | 2023-12-12 18:48 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_12_18_30_01_Vienna Boys Choir_Heiligste Nacht (Holiest Night).aac | 2023-12-12 18:45 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_12_18_30_01_City of Prague Orchestra_O Holy Night.aac | 2023-12-12 18:43 | 2.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_12_18_30_01_Pioneer Brass_From Every Spire on Christmas Eve.aac | 2023-12-12 18:38 | 1.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_12_18_30_01_BBC Concert Orchestra_Patapan (for Woodwinds).aac | 2023-12-12 18:36 | 962K | |
![[ ]](/icons/unknown.gif) | 2023_12_12_18_30_01_Eaken Piano Trio_Hansel & Gretel- Evening Prayer.aac | 2023-12-12 18:35 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_12_07_30_02_University of British Columbia Singers_Little Child in a Manger.aac | 2023-12-12 09:28 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_12_07_30_02_Grex Vocalis_Ave Maris Stella.aac | 2023-12-12 09:25 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_12_07_30_02_Cologne Chamber Orchestra_Christmas Concerto, Opus 6-8- Pastorale.aac | 2023-12-12 09:22 | 2.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_12_07_30_02_Chamber Orchestra Kremlin_The Seasons- December- Christmas.aac | 2023-12-12 09:18 | 3.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_12_07_30_02_Chicago Symphony_Messiah- -I know that my Redeemer liveth-.aac | 2023-12-12 09:14 | 4.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_12_07_30_02_RIAS Chamber Choir_Let us rock the little child.aac | 2023-12-12 09:08 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_12_07_30_02_Vasari Singers_Sing Lullaby.aac | 2023-12-12 09:06 | 2.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_12_07_30_02_Musica Sacra_Patapan.aac | 2023-12-12 09:02 | 938K | |
![[ ]](/icons/unknown.gif) | 2023_12_12_07_30_02_Lahti Symphony Orchestra_The Bells of Christmas.aac | 2023-12-12 08:57 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_12_07_30_02_St. Paul's Cathedral Choir_O Come, All Ye Faithful (arr. David Willcocks).aac | 2023-12-12 08:53 | 2.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_12_07_30_02_24 Cellos of the London Sound_White Christmas.aac | 2023-12-12 08:49 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_12_07_30_02_Heartstrings (Oregon-based ens.)_Joy To The World.aac | 2023-12-12 08:29 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_12_07_30_02_La Pieta_The Bells of Christmas (adapt. Antoine Bareil).aac | 2023-12-12 08:28 | 2.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_12_07_30_02_Katherine Murdock, viola; Nathaniel Rosen, cello_When Christmas Morn Was Dawning.aac | 2023-12-12 08:23 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_12_07_30_02_Anonymous 4_Greene growith the holy.aac | 2023-12-12 08:21 | 2.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_12_07_30_02_Seattle Pro Musica_Marias Kirchgang (Mary's trip to the church).aac | 2023-12-12 08:18 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_12_07_30_02_24 Cellos of the London Sound_Introit- Once in Royal David's City.aac | 2023-12-12 08:15 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_12_07_30_02_Ensemble 94_O nous dites Marie (Now tell us, Mary).aac | 2023-12-12 08:12 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_12_07_30_02_Bengt Forsberg, piano_The Three Mummers.aac | 2023-12-12 08:10 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_12_07_30_02_Polyphony_O Magnum Mysterium.aac | 2023-12-12 08:04 | 4.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_12_07_30_02_University of Portland Singers_The Wexford Carol.aac | 2023-12-12 07:57 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_12_07_30_02_Gabrieli Consort & Players_Christmas Mass- Sonata.aac | 2023-12-12 07:54 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_12_07_30_02_Baltimore Consort_The Cherry Tree Carol.aac | 2023-12-12 07:51 | 3.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_12_07_30_02_Eaken Piano Trio_Gesu Bambino (Piano Trio).aac | 2023-12-12 07:46 | 3.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_12_07_30_02_West Edge String Quartet_A La Media Noche-De Tierra Lajana Venimos.aac | 2023-12-12 07:41 | 3.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_12_07_30_02_Prague Philharmonic Orchestra_Bethlehem Down.aac | 2023-12-12 07:36 | 2.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_11_18_30_01_City of London Sinfonia_Nativity Carol.aac | 2023-12-11 21:29 | 3.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_11_18_30_01_The Cambridge Singers_All My Heart This Night Rejoices.aac | 2023-12-11 21:24 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_11_18_30_01_Piano4te_For Unto Us a Child is Born (after Handel's Messiah).aac | 2023-12-11 21:22 | 2.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_11_18_30_01_Lords of the Chords_Zu Bethlehem geboren (A child born in Bethlehem).aac | 2023-12-11 21:19 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_11_18_30_01_Canadian Brass_Short Fantasy on a Catalan Carol.aac | 2023-12-11 21:17 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_11_18_30_01_Aulos Ensemble_Ich Esse mit Freuden, BWV 84.aac | 2023-12-11 21:13 | 3.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_11_18_30_01_Chanticleer_Suo Gan (Welsh Lullaby).aac | 2023-12-11 21:05 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_11_18_30_01_Katherine Murdock, viola; Nathaniel Rosen, cello_The Golden Carol.aac | 2023-12-11 20:57 | 634K | |
![[ ]](/icons/unknown.gif) | 2023_12_11_18_30_01_La Pieta_Christmas Song- Give Me No Splendour, Gold or Pomp.aac | 2023-12-11 20:56 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_11_18_30_01_Les Arts Florissants_Noels Sur Les Instruments- Joseph est bien marie.aac | 2023-12-11 20:53 | 906K | |
![[ ]](/icons/unknown.gif) | 2023_12_11_18_30_01_The Carillon Brass_Carols from the British Isles- Medley (arr. Don Hart).aac | 2023-12-11 20:52 | 3.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_11_18_30_01_Schwerin Brass Player Collegium_Freude, Freude, grosse Freude (Joy, Joy, o great Joy).aac | 2023-12-11 20:47 | 2.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_11_18_30_01_BBC Singers_Here is the Little Door.aac | 2023-12-11 20:43 | 2.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_11_18_30_01_The American Boychoir_In the Bleak Midwinter.aac | 2023-12-11 20:40 | 3.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_11_18_30_01_The Choral Project_The Wassail Song.aac | 2023-12-11 20:35 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_11_18_30_01_The Toronto Consort_All you that are good fellows.aac | 2023-12-11 20:32 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_11_18_30_01_La Pieta_Laissez Paitre Vos Betes (Noel Bressan) (arr. Claude Gagnon).aac | 2023-12-11 20:27 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_11_18_30_01_Renaissonics_Joseph, lieber Joseph mein.aac | 2023-12-11 20:25 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_11_18_30_01_Portland State Chamber Choir_O Salutaris Hostia.aac | 2023-12-11 20:21 | 2.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_11_18_30_01_Capricorn_Jesu, Joy Of Man's Desiring.aac | 2023-12-11 20:17 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_11_18_30_01_Orpheus Vocal Ensemble; Ars Antiqua Austria_Ave maris stella (Hail, queen of the stars).aac | 2023-12-11 20:14 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_11_18_30_01_St. Paul's Cathedral Choir_I Sing of a Maiden.aac | 2023-12-11 20:11 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_11_18_30_01_West Edge String Quartet_Today in Bethlehem.aac | 2023-12-11 20:09 | 2.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_11_18_30_01_Synergy Brass Quintet_Ding Dong Merrily On High.aac | 2023-12-11 20:05 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_11_18_30_01_Rome Sinfonietta Orchestra_Maria, che dolce nome (Mary, how sweet a name).aac | 2023-12-11 20:02 | 2.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_11_18_30_01_Eaken Piano Trio_The Sussex Mummers' Christmas Carol.aac | 2023-12-11 19:59 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_11_18_30_01_Renaissonics_Gaytas.aac | 2023-12-11 19:56 | 798K | |
![[ ]](/icons/unknown.gif) | 2023_12_11_18_30_01_New York Polyphony_Quem Pastores Laudavere (arr. Susan LaBarr).aac | 2023-12-11 19:54 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_11_18_30_01_Choir of Gonville & Caius College, Cambridge_Rocking (Czech Carol, arr. Edward Higginbottom).aac | 2023-12-11 19:52 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_11_18_30_01_Christopher Parkening, guitar_Sheep May Safely Graze.aac | 2023-12-11 19:50 | 3.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_11_18_30_01_Billy Oskay, harmonium; Dagny Regan, oboe_Il est ne le divin enfant (the Divine Infant is Born).aac | 2023-12-11 19:45 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_11_18_30_01_Sonos Handbell Choir_Austrian Carol.aac | 2023-12-11 19:41 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_11_18_30_01_Pioneer Brass_I Wonder As I Wander.aac | 2023-12-11 19:38 | 3.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_11_18_30_01_Vienna Boys Choir_O Tannenbaum (O Christmas Tree).aac | 2023-12-11 19:28 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_11_18_30_01_Brent Mason, guitar; Mark Casstevens, guitar; John Jarvis, p_We Wish You a Merry Christmas (arr. O'Connor).aac | 2023-12-11 19:26 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_11_18_30_01_Aulos Ensemble_Noel Etranger.aac | 2023-12-11 19:22 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_11_18_30_01_In Mulieribus (Portland ens.)_There is no rose of such virtue.aac | 2023-12-11 19:17 | 3.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_11_18_30_01_The American Boychoir_Candlelight Carol.aac | 2023-12-11 19:12 | 2.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_11_17_08_47_Pittsburgh Symphony Brass_Bring a Torch, Jeanette, Isabella.aac | 2023-12-11 19:05 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_11_17_08_47_Grex Vocalis_Kling no klokka (The bells ring, they sound).aac | 2023-12-11 19:03 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_11_17_08_47_Kampin Laulu Chamber Choir_Ecce novum gaudium (Behold the new Joy).aac | 2023-12-11 19:01 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_11_17_08_47_Synergy Brass Quintet_Joy To The World.aac | 2023-12-11 18:59 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_11_17_08_47_Seraphic Fire_Once As I Remember (arr. Charles Wood).aac | 2023-12-11 18:56 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_11_17_08_47_Pavao String Quartet_Carol (arr. Carlo Martelli).aac | 2023-12-11 18:54 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_11_17_08_47_Christopher Parkening, guitar_El Noi de la Mare (Son of the Virgin).aac | 2023-12-11 18:51 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_11_17_08_47_Triad Ensemble Berlin_Greensleeves (for recorders).aac | 2023-12-11 18:46 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_11_17_08_47_RIAS Chamber Choir_O freudenreicher Tag (O Joyous Day).aac | 2023-12-11 18:44 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_11_17_08_47_Portland Revels_The Holly and the Ivy (Herefordshire variant).aac | 2023-12-11 18:42 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_11_17_08_47_London Symphony Brass_Canzon septimi e octavi toni, a 12.aac | 2023-12-11 18:39 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_11_17_08_47_Renaissonics_Piva.aac | 2023-12-11 18:37 | 1.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_11_17_08_47_West Edge String Quartet_Lo, How A Rose E'er Bloming.aac | 2023-12-11 18:35 | 2.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_11_17_08_47_Eaken Piano Trio_The Nutcracker- Waltz of the Flowers.aac | 2023-12-11 18:32 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_11_17_08_47_Cantus_Nowell! Nowell! This is the Salutacion.aac | 2023-12-11 18:30 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_11_17_08_47_Hamburg Soloists_Christmas Aria.aac | 2023-12-11 18:27 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_11_17_08_47_Baltimore Consort_Drive the Cold Winter Away.aac | 2023-12-11 18:24 | 2.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_11_17_08_47_Canadian Brass_The Holly and the Ivy.aac | 2023-12-11 18:21 | 1.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_11_17_08_47_Katherine Murdock, viola; Nathaniel Rosen, cello_Deck the Hall.aac | 2023-12-11 18:07 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_11_17_08_47_St. Paul's Cathedral Choir_A New Year Carol.aac | 2023-12-11 18:05 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_11_17_08_47_Slovak Philharmonic Orchestra_Lieutenant Kije Suite- Troika.aac | 2023-12-11 18:02 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_11_17_08_47_Joshua Bell, violin; Thomas Bartlett, piano; Rob Moose, guit_I Want an Old Fashioned Christmas.aac | 2023-12-11 17:59 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_11_17_08_47_Pittsburgh Symphony Low Brass_Petites Litanies de Jesus.aac | 2023-12-11 17:56 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_11_17_08_47_Westminster Choir, Rider University, NY_Dans cette etable.aac | 2023-12-11 17:54 | 1.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_11_17_08_47_Etherea Vocal Ensemble_Gabriel's Message (arr. John Rutter).aac | 2023-12-11 17:52 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_11_17_08_47_In Mulieribus (Portland ens.)_Verbum patris umanatur (Today is born a Savior).aac | 2023-12-11 17:49 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_11_17_08_47_Bournemouth Sinfonietta_St. Paul's Suite, Opus 29 no 2- Mvmt 4 Finale (The Dargason).aac | 2023-12-11 17:47 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_11_17_08_47_Portland Revels_Comes the Morning.aac | 2023-12-11 17:44 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_11_17_08_47_Toronto Chamber Orchestra_The Four Seasons- Winter- Largo.aac | 2023-12-11 17:39 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_11_17_08_47_King's College Choir, Cambridge_Mille churubini in coro (A Thousand Cherubs in Chorus).aac | 2023-12-11 17:34 | 2.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_11_17_08_47_Barenaked Ladies_Hanukkah, Oh Hanukkah.aac | 2023-12-11 17:30 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_11_07_30_02_Sinfonia Cymru_Lullaby for Ana Gwen.aac | 2023-12-11 09:22 | 3.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_11_07_30_02_Christopher Parkening, guitar_Infant Holy, Infant Lowly (Polish Carol).aac | 2023-12-11 09:18 | 2.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_11_07_30_02_Oklahoma Woodwind Quintet_Rise, Come and See The King.aac | 2023-12-11 09:15 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_11_07_30_02_Malle Babbe Women's Choir_Maria durch ein Dornwald ging.aac | 2023-12-11 09:12 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_11_07_30_02_Cappella SF (San Francisco)_Psallite unigenito (Sing Psalms).aac | 2023-12-11 09:10 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_11_07_30_02_Pioneer Brass_The Holly and the Ivy.aac | 2023-12-11 09:08 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_11_07_30_02_Pittsburgh Symphony Brass_Volte.aac | 2023-12-11 09:06 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_11_07_30_02_Slovak Radio Symphony Orchestra_The Seasons- Winter- Ice.aac | 2023-12-11 08:58 | 926K | |
![[ ]](/icons/unknown.gif) | 2023_12_11_07_30_02_St. Paul's Cathedral Choir_All Bells in Paradise.aac | 2023-12-11 08:23 | 3.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_11_07_30_02_New York Pops_Carol of the Drum.aac | 2023-12-11 08:18 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_11_07_30_02_Bengt Forsberg, piano_English Folk Song- So Blest A Sight.aac | 2023-12-11 08:14 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_11_07_30_02_Canadian Brass_Little Fantasy on -The Twelve Days of Christmas-.aac | 2023-12-11 08:12 | 2.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_11_07_30_02_Cherwell Singers_A Child This Day Is Born.aac | 2023-12-11 08:08 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_11_07_30_02_Taverner Choir_Chant- Antiphon from Chester Processional.aac | 2023-12-11 08:06 | 694K | |
![[ ]](/icons/unknown.gif) | 2023_12_11_07_30_02_Vienna Boys Choir_O du stille Zeit.aac | 2023-12-11 07:57 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_11_07_30_02_City of London Sinfonia_There is a Flower.aac | 2023-12-11 07:56 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_11_07_30_02_The American Boychoir_I sing of a maiden.aac | 2023-12-11 07:52 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_11_07_30_02_Foothills Brass Quintet_Noel Nouvolet..Sing We Now Of Christmas.aac | 2023-12-11 07:49 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_11_07_30_02_Les Boreades de Montreal_Bon Joseph ecoute moy (Good Joseph Listen to Me).aac | 2023-12-11 07:47 | 3.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_11_07_30_02_Chamber Orchestra Kremlin_The Seasons- December- Christmas.aac | 2023-12-11 07:42 | 3.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_11_07_30_02_Schola Cantorum of Saint Peter's in the Loop_Gloria.aac | 2023-12-11 07:37 | 5.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_10_18_30_02_Drottningholm Baroque Orchestra_Trumpet Concerto in D- Allegro.aac | 2023-12-10 21:25 | 1.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_10_18_30_02_The American Boychoir_This Christmastide (Jessye's Carol).aac | 2023-12-10 21:23 | 4.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_10_18_30_02_Paul O'Dette, lute_Wachet auf, ruft uns die Stimme.aac | 2023-12-10 21:17 | 2.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_10_18_30_02_Cappella SF (San Francisco)_Psallite unigenito (Sing Psalms).aac | 2023-12-10 21:13 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_10_18_30_02_Die Singphoniker_Venid cantad (Come, sing the sweet Christmas songs).aac | 2023-12-10 21:12 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_10_18_30_02_Renaissonics_Gaytas.aac | 2023-12-10 21:06 | 798K | |
![[ ]](/icons/unknown.gif) | 2023_12_10_18_30_02_The King's Singers_Jingle Bells (a cappella).aac | 2023-12-10 21:05 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_10_18_30_02_Battalia_Mystery Sonata No. 2- The Visitation.aac | 2023-12-10 21:00 | 3.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_10_18_30_02_Academy of St Martin in the Fields_The Skaters Waltz (Les Patineurs), Opus 183.aac | 2023-12-10 20:55 | 5.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_10_18_30_02_Oregon Repertory Singers_Da droben vom Berge (From the mountain blows a cooling wind).aac | 2023-12-10 20:47 | 1.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_10_18_30_02_Cherwell Singers_'Twas In The Winter Cold.aac | 2023-12-10 20:45 | 2.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_10_18_30_02_The American Boychoir_A Hymn to the Virgin.aac | 2023-12-10 20:41 | 2.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_10_18_30_02_Solid Brass_Suite of Medieval Carols.aac | 2023-12-10 20:38 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_10_18_30_02_The Toronto Consort_Now Candlemas is come at last.aac | 2023-12-10 20:35 | 2.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_10_18_30_02_La Pieta_Noel Nouvelet (arr. Claude Gagnon).aac | 2023-12-10 20:31 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_10_18_30_02_Nicolaus Esterhazy Sinfonia_Angels We Have Heard on High.aac | 2023-12-10 20:29 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_10_18_30_02_Anonymous 4_A Virgin Unspotted.aac | 2023-12-10 20:26 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_10_18_30_02_Chanticleer_Beautiful Star of Bethlehem.aac | 2023-12-10 20:23 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_10_18_30_02_St. Paul's Cathedral Choir_Gaudete! (medieval melody).aac | 2023-12-10 20:20 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_10_18_30_02_Baltimore Consort_In dir ist Freude (In you is Joy).aac | 2023-12-10 20:18 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_10_18_30_02_Bengt Forsberg, piano_English Folk Song- So Blest A Sight.aac | 2023-12-10 20:11 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_10_18_30_02_Singscape_Quem pastores.aac | 2023-12-10 20:08 | 1.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_10_18_30_02_Royal Philharmonic_El Noi de la Mare (Son of the Virgin).aac | 2023-12-10 20:06 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_10_18_30_02_The Carillon Brass_European Carol Medley (arr. Arthur Frackenpohl).aac | 2023-12-10 20:03 | 2.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_10_18_30_02_The Cambridge Singers_Once As I Remember (Italian Carol).aac | 2023-12-10 19:54 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_10_18_30_02_Seattle Pro Musica_Das Roslein, das ich meine.aac | 2023-12-10 19:52 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_10_18_30_02_Vienna Boys Choir_Stille, Stille, Stille (Austrian).aac | 2023-12-10 19:50 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_10_18_30_02_City of Prague Orchestra_O Holy Night.aac | 2023-12-10 19:48 | 2.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_10_18_30_02_West Edge String Quartet_Carol of the Bells.aac | 2023-12-10 19:44 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_10_18_30_02_Aleksey Igudesman, violin; Hyung-ki Joo, piano_Christmas Confusion (Christmas & Hanukkah tunes).aac | 2023-12-10 19:42 | 2.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_10_18_30_02_Renaissonics_Fum, Fum, Fum.aac | 2023-12-10 19:37 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_10_18_30_02_24 Cellos of the London Sound_Introit- Once in Royal David's City.aac | 2023-12-10 19:35 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_10_18_30_02_Die Singphoniker_Still, o Himmel (Hush o Heaven - Bavarian carol).aac | 2023-12-10 19:32 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_10_18_30_02_Musica Sacra_Did Mary Know-.aac | 2023-12-10 19:29 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_10_18_30_02_Portland Brass Quintet_Il est bel et bon (French chanson).aac | 2023-12-10 19:19 | 842K | |
![[ ]](/icons/unknown.gif) | 2023_12_10_18_30_02_Aulos Ensemble_When Christ Was Born On Earth.aac | 2023-12-10 19:14 | 2.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_10_18_30_02_City of London Sinfonia_Christmas Night (French Carol).aac | 2023-12-10 19:04 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_10_18_30_02_The Choir of Royal Holloway_Coventry Carol (arr. Ola Gjeilo).aac | 2023-12-10 19:00 | 2.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_10_18_30_02_Lahti Symphony Orchestra_The Bells of Christmas.aac | 2023-12-10 18:57 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_10_18_30_02_Brent Mason, guitar; Mark Casstevens, guitar_The Cherry Tree Carol (arr. O'Connor).aac | 2023-12-10 18:53 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_10_18_30_02_St. Paul's Cathedral Choir_O Come, All Ye Faithful (arr. David Willcocks).aac | 2023-12-10 18:46 | 2.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_10_18_30_02_Oregon Bach Festival Chorus_Lo, How A Rose E'er Blooming.aac | 2023-12-10 18:42 | 3.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_10_18_30_02_London Baroque_Canzona - Aria.aac | 2023-12-10 18:37 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_10_18_30_02_Christopher Parkening, guitar_Infant Holy, Infant Lowly (Polish Carol).aac | 2023-12-10 18:34 | 2.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_10_07_30_01_Die Singphoniker_Nu zijt wellekome (You are Welcome).aac | 2023-12-10 09:23 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_10_07_30_01_Taverner Consort, Choir & Players_O Jesulein suss (O Sweet Jesus).aac | 2023-12-10 09:21 | 2.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_10_07_30_01_Oklahoma Woodwind Quintet_Christmas Carol Medley.aac | 2023-12-10 09:17 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_10_07_30_01_Royal Philharmonic Orchestra with London Voices_He shall feed His flock.aac | 2023-12-10 09:14 | 3.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_10_07_30_01_London Symphony Brass_Canzon II a 4 for brass.aac | 2023-12-10 09:09 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_10_07_30_01_Canadian Brass_Joy to the World.aac | 2023-12-10 09:06 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_10_07_30_01_The American Boychoir_Missa Brevis- Veni Redemptor.aac | 2023-12-10 09:04 | 1.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_10_07_30_01_Arion_Noels- Amoroso.aac | 2023-12-10 09:03 | 1.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_10_07_30_01_Santa Fe Guitar Quartet_Terpsichore- Ballet (Guitar Quartet).aac | 2023-12-10 09:01 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_10_07_30_01_Bengt Forsberg, piano_Villancico Vasco (Basque Carol).aac | 2023-12-10 08:58 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_10_07_30_01_The Sixteen_Salve Regina (Plainchant).aac | 2023-12-10 08:57 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_10_07_30_01_Monteverdi Choir_Gloria in excelsis Deo (16th century).aac | 2023-12-10 08:54 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_10_07_30_01_Musica Fiata_Jubiliret Frohlich (Canzona in 8 parts).aac | 2023-12-10 08:51 | 3.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_10_07_30_01_BBC Concert Orchestra_Patapan (for Woodwinds).aac | 2023-12-10 08:47 | 1.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_10_07_30_01_Eduard Laurel, piano_Toy Soldier March.aac | 2023-12-10 08:45 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_10_07_30_01_Taverner Consort_Christmas Eve.aac | 2023-12-10 08:44 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_10_07_30_01_Taverner Consort_Blessed Be That Maid Mary.aac | 2023-12-10 08:26 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_10_07_30_01_St. George's Chapel Choir, Windsor_The Shepherd Men (Choral music).aac | 2023-12-10 08:24 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_10_07_30_01_Phoenix Chorale_A Spotless Rose.aac | 2023-12-10 08:21 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_10_07_30_01_Boston Baroque_Ich danke Dir ewiglich.aac | 2023-12-10 08:18 | 1.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_10_07_30_01_West Edge String Quartet_A La Nanita Nana (Lullaby).aac | 2023-12-10 08:16 | 2.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_10_07_30_01_Canadian Brass_Or Let the Merry Bells Ring 'Round.aac | 2023-12-10 08:12 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_10_07_30_01_The Muddy River Morris Team_Constant Billy.aac | 2023-12-10 08:09 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_10_07_30_01_Los Angeles Guitar Quartet_Nutcracker Suite, Opus 71a- Waltz of the Flowers.aac | 2023-12-10 08:07 | 3.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_10_07_30_01_Robert Shaw Festival Singers_Four Motets for Christmas- Seeing the Star.aac | 2023-12-10 08:02 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_10_07_30_01_Musica Intima_Huron Carol.aac | 2023-12-10 07:59 | 2.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_10_07_30_01_Seattle Pro Musica_Ave Maria.aac | 2023-12-10 07:56 | 2.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_10_07_30_01_Members of the Vienna Philharmonic_It Came Upon a Midnight Clear.aac | 2023-12-10 07:52 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_10_07_30_01_De Organographia_Hark! The Herald Angels Sing (4 trombones).aac | 2023-12-10 07:50 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_10_07_30_01_Royal Ballet Sinfonia_Waltz for Strings.aac | 2023-12-10 07:48 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_10_07_30_01_Bournemouth Symphony Orchestra_Traditional Slavic Christmas Music.aac | 2023-12-10 07:46 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_10_07_30_01_City of London Choir_There is no Rose, Opus 14.aac | 2023-12-10 07:43 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_10_07_30_01_SarahZ_Mindful Moment- Scent Meditation.aac | 2023-12-10 07:34 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_09_18_30_01_Sonos Handbell Choir_Bring a Torch, Jeanette, Isabella.aac | 2023-12-09 21:27 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_09_18_30_01_St. Paul's Cathedral Choir_I Sing of a Maiden.aac | 2023-12-09 21:25 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_09_18_30_01_Kansas City Chorale_Sweet Was the Song the Virgin Sung.aac | 2023-12-09 21:22 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_09_18_30_01_Schubert Academy_Joy to the world.aac | 2023-12-09 21:20 | 1.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_09_18_30_01_Aulos Ensemble_Noel en Trio et en Dialogue.aac | 2023-12-09 21:18 | 2.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_09_18_30_01_Philharmonia Virtuosi_Or Let the Merry Bells Ring 'Round.aac | 2023-12-09 21:14 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_09_18_30_01_The Carillon Brass_Fum, Fum, Fum.aac | 2023-12-09 21:13 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_09_18_30_01_Synergy Brass Quintet_Deck the Hall.aac | 2023-12-09 21:10 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_09_18_30_01_Hilary Field, guitar_Guitar Suite- For an Old Friend at Christmas- III. Lento.aac | 2023-12-09 21:08 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_09_18_30_01_Oregon Repertory Singers_Ave Maria.aac | 2023-12-09 21:06 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_09_18_30_01_The Sixteen_Faire is the heaven.aac | 2023-12-09 21:03 | 3.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_09_18_30_01_The Cambridge Singers_Adam Lay Ybounden.aac | 2023-12-09 20:58 | 822K | |
![[ ]](/icons/unknown.gif) | 2023_12_09_18_30_01_Utah Symphony Orchestra_Ave Maria.aac | 2023-12-09 20:56 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_09_18_30_01_Portland Symphonic Choir_Vespers, Op 37- The Troparion- Today Salvation Has Come.aac | 2023-12-09 20:53 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_09_18_30_01_Dale Warland Singers_Simple Gifts (version for guitar, flute, chorus).aac | 2023-12-09 20:50 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_09_18_30_01_Epic Brass_Ding Dong Merrily On High.aac | 2023-12-09 20:45 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_09_18_30_01_Prague Philharmonic Orchestra_Bethlehem Down.aac | 2023-12-09 20:42 | 2.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_09_18_30_01_Eaken Piano Trio_The Sussex Mummers' Christmas Carol.aac | 2023-12-09 20:37 | 2.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_09_18_30_01_Baltimore Consort_The Cherry Tree Carol.aac | 2023-12-09 20:34 | 3.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_09_18_30_01_Robert Shaw Chamber Singers_Alleluia.aac | 2023-12-09 20:29 | 3.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_09_18_30_01_The Choir of Queens College, Cambridge_The Holly And The Ivy.aac | 2023-12-09 20:24 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_09_18_30_01_Eric Robertson, organ_O Come, All Ye Faithful & Joy to the World.aac | 2023-12-09 20:15 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_09_18_30_01_Mainstreet Brass_Joseph lieber, Joseph mein (Brass Quintet).aac | 2023-12-09 20:13 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_09_18_30_01_Royal Philharmonic Orchestra with London Voices_He shall feed His flock.aac | 2023-12-09 20:06 | 4.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_09_18_30_01_The Cambridge Singers_Blessed Be That Maid Mary.aac | 2023-12-09 19:58 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_09_18_30_01_City of London Sinfonia_Love Came Down At Christmas.aac | 2023-12-09 19:56 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_09_18_30_01_University of Portland Singers_Austrian Carol Medley (arr. Michael Connolly).aac | 2023-12-09 19:53 | 5.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_09_18_30_01_24 Cellos of the London Sound_The Nutcracker - Pas de Deux.aac | 2023-12-09 19:45 | 3.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_09_18_30_01_Pittsburgh Symphony Brass_Volte.aac | 2023-12-09 19:41 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_09_18_30_01_Empire Brass_Sheep May Safely Graze (Cantata BWV 208).aac | 2023-12-09 19:38 | 3.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_09_18_30_01_Young People's Chorus of New York_Silent Night.aac | 2023-12-09 19:33 | 2.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_09_18_30_01_The King's Singers_Lux Aurumque (Light and Gold).aac | 2023-12-09 19:30 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_09_18_30_01_Vienna Boys Choir_Auf dem Berge, da wehet der Wind (Wind Blows on the Mountain.aac | 2023-12-09 19:26 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_09_18_30_01_Oregon Ballet Theatre Orchestr_The Nutcracker- Overture.aac | 2023-12-09 19:24 | 2.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_09_18_30_01_Capella Istropolitana_German Dances, K.605- No.3 -Sleigh Ride-.aac | 2023-12-09 19:21 | 2.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_09_18_30_01_Los Angeles Guitar Quartet_Nutcracker Suite, Opus 71a- Waltz of the Flowers.aac | 2023-12-09 19:18 | 3.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_09_18_30_01_Pro Arte Singers_Give good gifts to one another.aac | 2023-12-09 19:12 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_09_18_30_01_Empire Brass_Make a Joyful Noise.aac | 2023-12-09 19:11 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_09_18_30_01_Portland Symphonic Choir_Vespers, Op 37- (6) Rejoice, O Virgin.aac | 2023-12-09 19:07 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_09_18_30_01_Vasari Singers_The Christ-child.aac | 2023-12-09 19:04 | 3.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_09_18_30_01_Katherine Murdock, viola; Nathaniel Rosen, cello_Angels' Carol.aac | 2023-12-09 18:59 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_09_18_30_01_Seattle Pro Musica_Deustches (German) Magnificat.aac | 2023-12-09 18:55 | 4.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_09_18_30_01_New York Pops_Carol of the Drum.aac | 2023-12-09 18:48 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_09_18_30_01_Baltimore Consort_Drive the Cold Winter Away.aac | 2023-12-09 18:45 | 2.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_09_18_30_01_Chicago Symphony_Messiah- -I know that my Redeemer liveth-.aac | 2023-12-09 18:42 | 4.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_09_18_30_01_The Queen's Six_Gabriel's Message.aac | 2023-12-09 18:35 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_09_18_30_01_The Cambridge Singers_All My Heart This Night Rejoices.aac | 2023-12-09 18:33 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_09_07_30_01_Schwerin Brass Player Collegium_Kommet, ihr Hirten (Come, ye shepherds).aac | 2023-12-09 09:28 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_09_07_30_01_Trinity Cathedral Choir, Portland_The Cherry Tree Carol.aac | 2023-12-09 09:22 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_09_07_30_01_City of London Sinfonia_Candlelight Carol.aac | 2023-12-09 09:20 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_09_07_30_01_Arthur Haas, harpsichord_Coventry Carol.aac | 2023-12-09 09:15 | 5.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_09_07_30_01_Billband_Sparkle.aac | 2023-12-09 08:05 | 3.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_09_07_30_01_Les Boreades de Montreal_Bon Joseph ecoute moy (Good Joseph Listen to Me).aac | 2023-12-09 07:56 | 3.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_09_07_30_01_Philharmonia Orchestra_O Holy Night.aac | 2023-12-09 07:51 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_09_07_30_01_Monteverdi Choir_O Maria vernans rosa.aac | 2023-12-09 07:47 | 3.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_09_07_30_01_Vienna Boys Choir_Huron Carol.aac | 2023-12-09 07:41 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_08_18_30_17_Drottningholm Baroque Orchestra_Trumpet Concerto in D- Allegro.aac | 2023-12-08 21:25 | 1.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_08_18_30_17_The American Boychoir_This Christmastide (Jessye's Carol).aac | 2023-12-08 21:23 | 4.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_08_18_30_17_Battalia_Mystery Sonata No. 2- The Visitation.aac | 2023-12-08 21:16 | 3.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_08_18_30_17_Paul O'Dette, lute_Wachet auf, ruft uns die Stimme.aac | 2023-12-08 21:12 | 2.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_08_18_30_17_Cappella SF (San Francisco)_Psallite unigenito (Sing Psalms).aac | 2023-12-08 21:08 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_08_18_30_17_Die Singphoniker_Venid cantad (Come, sing the sweet Christmas songs).aac | 2023-12-08 21:07 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_08_18_30_17_Renaissonics_Gaytas.aac | 2023-12-08 21:01 | 798K | |
![[ ]](/icons/unknown.gif) | 2023_12_08_18_30_17_Academy of St Martin in the Fields_The Skaters Waltz (Les Patineurs), Opus 183.aac | 2023-12-08 20:56 | 5.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_08_18_30_17_Oregon Repertory Singers_Da droben vom Berge (From the mountain blows a cooling wind).aac | 2023-12-08 20:48 | 1.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_08_18_30_17_Cherwell Singers_'Twas In The Winter Cold.aac | 2023-12-08 20:46 | 2.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_08_18_30_17_The American Boychoir_A Hymn to the Virgin.aac | 2023-12-08 20:43 | 2.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_08_18_30_17_Solid Brass_Suite of Medieval Carols.aac | 2023-12-08 20:35 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_08_18_30_17_The Toronto Consort_Now Candlemas is come at last.aac | 2023-12-08 20:32 | 2.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_08_18_30_17_La Pieta_Noel Nouvelet (arr. Claude Gagnon).aac | 2023-12-08 20:28 | 1.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_08_18_30_17_Nicolaus Esterhazy Sinfonia_Angels We Have Heard on High.aac | 2023-12-08 20:26 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_08_18_30_17_Chanticleer_Beautiful Star of Bethlehem.aac | 2023-12-08 20:23 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_08_18_30_17_St. Paul's Cathedral Choir_Gaudete! (medieval melody).aac | 2023-12-08 20:20 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_08_18_30_17_Baltimore Consort_In dir ist Freude (In you is Joy).aac | 2023-12-08 20:18 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_08_18_30_17_Bengt Forsberg, piano_English Folk Song- So Blest A Sight.aac | 2023-12-08 20:11 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_08_18_30_17_City of Prague Orchestra_O Holy Night.aac | 2023-12-08 20:08 | 2.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_08_18_30_17_The Queen's Six_Corpus Christi Carol.aac | 2023-12-08 20:04 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_08_18_30_17_Singscape_Quem pastores.aac | 2023-12-08 20:01 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_08_18_30_17_Royal Philharmonic_El Noi de la Mare (Son of the Virgin).aac | 2023-12-08 19:59 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_08_18_30_17_The Carillon Brass_European Carol Medley (arr. Arthur Frackenpohl).aac | 2023-12-08 19:56 | 2.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_08_18_30_17_The Cambridge Singers_Once As I Remember (Italian Carol).aac | 2023-12-08 19:47 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_08_18_30_17_Seattle Pro Musica_Das Roslein, das ich meine.aac | 2023-12-08 19:44 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_08_18_30_17_Vienna Boys Choir_Stille, Stille, Stille (Austrian).aac | 2023-12-08 19:43 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_08_18_30_17_West Edge String Quartet_Carol of the Bells.aac | 2023-12-08 19:41 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_08_18_30_17_Renaissonics_Fum, Fum, Fum.aac | 2023-12-08 19:38 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_08_18_30_17_24 Cellos of the London Sound_Introit- Once in Royal David's City.aac | 2023-12-08 19:36 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_08_18_30_17_Die Singphoniker_Still, o Himmel (Hush o Heaven - Bavarian carol).aac | 2023-12-08 19:33 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_08_18_30_17_Musica Sacra_Did Mary Know-.aac | 2023-12-08 19:30 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_08_18_30_17_Portland Brass Quintet_Il est bel et bon (French chanson).aac | 2023-12-08 19:21 | 858K | |
![[ ]](/icons/unknown.gif) | 2023_12_08_18_30_17_Aulos Ensemble_When Christ Was Born On Earth.aac | 2023-12-08 19:16 | 2.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_08_18_30_17_City of London Sinfonia_Christmas Night (French Carol).aac | 2023-12-08 19:12 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_08_18_30_17_Lahti Symphony Orchestra_The Bells of Christmas.aac | 2023-12-08 19:08 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_08_18_30_17_Brent Mason, guitar; Mark Casstevens, guitar_The Cherry Tree Carol (arr. O'Connor).aac | 2023-12-08 19:04 | 2.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_08_18_30_17_St. Paul's Cathedral Choir_O Come, All Ye Faithful (arr. David Willcocks).aac | 2023-12-08 18:57 | 2.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_08_18_30_17_Oregon Bach Festival Chorus_Lo, How A Rose E'er Blooming.aac | 2023-12-08 18:53 | 3.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_08_18_30_17_London Baroque_Canzona - Aria.aac | 2023-12-08 18:48 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_08_18_30_17_Christopher Parkening, guitar_Infant Holy, Infant Lowly (Polish Carol).aac | 2023-12-08 18:45 | 2.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_08_18_30_17_Oklahoma Woodwind Quintet_Good Christian Men Rejoice.aac | 2023-12-08 18:42 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_08_18_30_17_Gloriae Dei Cantores_A Child's Welcome (From A Celebration Of Carols).aac | 2023-12-08 18:37 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_08_07_30_01_Robert Groslot, piano_Children's Suite- Romance- Andantino.aac | 2023-12-08 09:26 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_08_07_30_01_Piano4te_Merry Christmas Mr. Lawrence (arr. H. Otakara).aac | 2023-12-08 09:24 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_08_07_30_01_Die Singphoniker_Nu zijt wellekome (You are Welcome).aac | 2023-12-08 09:17 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_08_07_30_01_Taverner Consort, Choir & Players_O Jesulein suss (O Sweet Jesus).aac | 2023-12-08 09:14 | 2.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_08_07_30_01_Oklahoma Woodwind Quintet_Christmas Carol Medley.aac | 2023-12-08 09:11 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_08_07_30_01_Royal Philharmonic Orchestra with London Voices_He shall feed His flock.aac | 2023-12-08 09:08 | 3.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_08_07_30_01_London Symphony Brass_Canzon II a 4 for brass.aac | 2023-12-08 09:03 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_08_07_30_01_Canadian Brass_Joy to the World.aac | 2023-12-08 09:00 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_08_07_30_01_The American Boychoir_Missa Brevis- Veni Redemptor.aac | 2023-12-08 08:58 | 1.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_08_07_30_01_Pittsburgh Symphony Low Brass_Petites Litanies de Jesus.aac | 2023-12-08 08:57 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_08_07_30_01_University of British Columbia Singers_Lo in a Manger.aac | 2023-12-08 08:54 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_08_07_30_01_Arion_Noels- Amoroso.aac | 2023-12-08 08:51 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_08_07_30_01_Santa Fe Guitar Quartet_Terpsichore- Ballet (Guitar Quartet).aac | 2023-12-08 08:49 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_08_07_30_01_Bengt Forsberg, piano_Villancico Vasco (Basque Carol).aac | 2023-12-08 08:47 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_08_07_30_01_The Sixteen_Salve Regina (Plainchant).aac | 2023-12-08 08:45 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_08_07_30_01_West Edge String Quartet_A La Nanita Nana (Lullaby).aac | 2023-12-08 08:09 | 2.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_08_07_30_01_Canadian Brass_Or Let the Merry Bells Ring 'Round.aac | 2023-12-08 08:05 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_08_07_30_01_The Muddy River Morris Team_Constant Billy.aac | 2023-12-08 08:02 | 1.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_08_07_30_01_Los Angeles Guitar Quartet_Nutcracker Suite, Opus 71a- Waltz of the Flowers.aac | 2023-12-08 08:00 | 3.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_08_07_30_01_Robert Shaw Festival Singers_Four Motets for Christmas- Seeing the Star.aac | 2023-12-08 07:55 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_08_07_30_01_Musica Intima_Huron Carol.aac | 2023-12-08 07:52 | 2.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_08_07_30_01_Seattle Pro Musica_Ave Maria.aac | 2023-12-08 07:49 | 2.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_08_07_30_01_Members of the Vienna Philharmonic_It Came Upon a Midnight Clear.aac | 2023-12-08 07:45 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_08_07_30_01_De Organographia_Hark! The Herald Angels Sing (4 trombones).aac | 2023-12-08 07:43 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_08_07_30_01_Royal Ballet Sinfonia_Waltz for Strings.aac | 2023-12-08 07:42 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_08_07_30_01_Bournemouth Symphony Orchestra_Traditional Slavic Christmas Music.aac | 2023-12-08 07:39 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_08_07_30_01_City of London Choir_There is no Rose, Opus 14.aac | 2023-12-08 07:34 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_07_18_30_02_The Bekova Sisters_The Christmas Tree- Waltz.aac | 2023-12-07 21:27 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_07_18_30_02_In Mulieribus (Portland ens.)_Ave Maria.aac | 2023-12-07 21:24 | 1.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_07_18_30_02_The Cambridge Singers_Away in a manger.aac | 2023-12-07 21:21 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_07_18_30_02_Arsys Bourgogne_Les anges dans nos campagnes.aac | 2023-12-07 21:19 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_07_18_30_02_Chanticleer_Spanish Carol.aac | 2023-12-07 21:16 | 2.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_07_18_30_02_Baltimore Consort_Ding, Dong! merrily on high.aac | 2023-12-07 21:12 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_07_18_30_02_London Festival Orchestra_Shepherd's Music for Christmas.aac | 2023-12-07 21:10 | 3.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_07_18_30_02_BBC Concert Orchestra_Carols for Woodwinds- Angels in our Fields.aac | 2023-12-07 21:06 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_07_18_30_02_St. Paul's Cathedral Choir_O Holy Night (arr. John Rutter).aac | 2023-12-07 21:02 | 4.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_07_18_30_02_Orchestra_We Thank Thee, Lord (Cantata 29).aac | 2023-12-07 20:53 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_07_18_30_02_New York Polyphony_Sleep Now.aac | 2023-12-07 20:48 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_07_18_30_02_Cologne Radio Orchestra_Hansel and Gretel- Evening Prayer.aac | 2023-12-07 20:46 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_07_18_30_02_Trinity Cathedral Choir, Portland_Jesus Christ the Apple Tree.aac | 2023-12-07 20:44 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_07_18_30_02_Schwerin Brass Player Collegium_Kommet, ihr Hirten (Come, ye shepherds).aac | 2023-12-07 20:41 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_07_18_30_02_Kay Johannsen, organ_Morgen kommt der Weihnachtsmann.aac | 2023-12-07 20:39 | 858K | |
![[ ]](/icons/unknown.gif) | 2023_12_07_18_30_02_Academy of St Martin in Fields_Four Seasons- -Winter-- 2nd Mvmt (by the hearth).aac | 2023-12-07 20:38 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_07_18_30_02_Pro Arte Singers_To Bethlem did they go.aac | 2023-12-07 20:36 | 3.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_07_18_30_02_Vasari Singers_The Stable Door.aac | 2023-12-07 20:32 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_07_18_30_02_Seattle Pro Musica_Puer natus in Bethlehem (A child is born in Bethlehem).aac | 2023-12-07 20:29 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_07_18_30_02_Rome Sinfonietta Orchestra_Ave Maria.aac | 2023-12-07 20:26 | 2.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_07_18_30_02_Schwerin Brass Collegium_Quem pastores laudavere (The shepherds praised).aac | 2023-12-07 20:23 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_07_18_30_02_Oklahoma Woodwind Quintet_What Child Is This-.aac | 2023-12-07 20:20 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_07_18_30_02_Sinfonia Cymru_Lullaby for Pegi.aac | 2023-12-07 20:16 | 2.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_07_18_30_02_Debra Torok & Marylene Dosse, piano_Christmas Music for piano 4-hands- Silent Night.aac | 2023-12-07 20:12 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_07_18_30_02_University of Portland Singers_Austrian Carol Medley (arr. Michael Connolly).aac | 2023-12-07 20:10 | 5.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_07_18_30_02_Copley Singers_Shepherd's Carol.aac | 2023-12-07 20:02 | 2.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_07_18_30_02_Brent Mason, guitar; Mark Casstevens, guitar; John Jarvis, p_Carol of the Bells (arr. O'Connor).aac | 2023-12-07 19:55 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_07_18_30_02_West Edge String Quartet_Coventry Carol.aac | 2023-12-07 19:52 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_07_18_30_02_Christopher Parkening, guitar_El Noi de la Mare (Son of the Virgin).aac | 2023-12-07 19:48 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_07_18_30_02_Arsys Bourgogne_Tebe pojem.aac | 2023-12-07 19:45 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_07_18_30_02_RIAS Chamber Choir_Lasset uns frohlocken (Let Us Rejoice).aac | 2023-12-07 19:40 | 834K | |
![[ ]](/icons/unknown.gif) | 2023_12_07_18_30_02_True North Brass_Hodie, Christus Natus Est (brass ensemble).aac | 2023-12-07 19:34 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_07_18_30_02_Bach Trumpet Ensemble of Munich_Sonata 'Ad Festum Paschatis'.aac | 2023-12-07 19:32 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_07_18_30_02_Emory Symphonic Winds_Symphonic Prelude on -Adeste Fideles-.aac | 2023-12-07 19:30 | 2.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_07_18_30_02_Paul O'Dette, lute_Es ist ein Ros entsprungen.aac | 2023-12-07 19:27 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_07_18_30_02_In Mulieribus (Portland ens.)_Angelus ad virginem.aac | 2023-12-07 19:24 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_07_18_30_02_Pomerium_In dulci jubilo a 2.aac | 2023-12-07 19:21 | 626K | |
![[ ]](/icons/unknown.gif) | 2023_12_07_18_30_02_Voces 8_Locus iste.aac | 2023-12-07 19:20 | 2.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_07_18_30_02_Ensemble 94_Ou s'en vont ces gays bergers.aac | 2023-12-07 19:16 | 846K | |
![[ ]](/icons/unknown.gif) | 2023_12_07_18_30_02_24 Cellos of the London Sound_Troika - O Little Town of Bethlehem (cellos).aac | 2023-12-07 19:12 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_07_18_30_02_Yolanda Kondonassis, harp_O Sleep, My Pretty Baby.aac | 2023-12-07 19:09 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_07_18_30_02_BBC Singers_Sing Lullaby.aac | 2023-12-07 19:07 | 2.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_07_18_30_02_Oregon Bach Festival Chorus_Christmas Day is Come.aac | 2023-12-07 19:03 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_07_18_30_02_Choir of Magdalen College, Oxford_Sweet was the Song.aac | 2023-12-07 19:01 | 2.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_07_18_30_02_The Cambridge Singers_Lute-Book Lullaby.aac | 2023-12-07 18:57 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_07_18_30_02_Epic Brass_Sleigh Ride.aac | 2023-12-07 18:55 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_07_18_30_02_Carsten Linck, guitar_Morgen, Kinder, wird's was geben.aac | 2023-12-07 18:53 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_07_18_30_02_Trinity Cathedral Choir, Portland_The Cherry Tree Carol.aac | 2023-12-07 18:48 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_07_18_30_02_St. Paul's Cathedral Choir_Once In Royal David's City (arr. Mann).aac | 2023-12-07 18:45 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_07_18_30_02_Eaken Piano Trio_The Nutcracker- Waltz of the Flowers.aac | 2023-12-07 18:39 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_07_18_30_02_Gerold Huber, piano_Inmitten der nacht.aac | 2023-12-07 18:36 | 1.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_07_07_30_01_Rome Sinfonietta Orchestra_Maria, che dolce nome (Mary, how sweet a name).aac | 2023-12-07 09:27 | 2.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_07_07_30_01_Prague Philharmonic Orchestra_Bethlehem Down.aac | 2023-12-07 09:23 | 2.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_07_07_30_01_Grex Vocalis_Kling no klokka (The bells ring, they sound).aac | 2023-12-07 09:19 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_07_07_30_01_Kampin Laulu Chamber Choir_Ecce novum gaudium (Behold the new Joy).aac | 2023-12-07 09:17 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_07_07_30_01_New York Polyphony_Nowell- Arise and Wake.aac | 2023-12-07 09:15 | 2.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_07_07_30_01_Carolina Chamber Chorale_Hannerot Hallalu (Hanukkah song).aac | 2023-12-07 09:07 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_07_07_30_01_Oregon Ballet Theatre Orchestra_The Nutcracker- Waltz of the Flowers.aac | 2023-12-07 09:02 | 4.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_07_07_30_01_Schwerin Brass Player Collegium_Schlaf wohl, du Himmelsknabe (Sleep well, Child from Heaven).aac | 2023-12-07 08:55 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_07_07_30_01_The Choral Project_A Christmas Carol.aac | 2023-12-07 08:53 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_07_07_30_01_Seraphic Fire_Once As I Remember (arr. Charles Wood).aac | 2023-12-07 08:49 | 1.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_07_07_30_01_Die Singphoniker_Canco de hadal (Catalan Christmas song).aac | 2023-12-07 08:47 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_07_07_30_01_Debra Torok & Marylene Dosse, piano_Christmas Music for piano 4-hands- God Rest You Merry....aac | 2023-12-07 08:45 | 1.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_07_07_30_01_West Edge String Quartet_The Bells of Christmas- A Medley of Two Modern Carols.aac | 2023-12-07 08:44 | 4.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_07_07_30_01_Eaken Piano Trio_Winter Wonderland.aac | 2023-12-07 08:38 | 1.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_07_07_30_01_Czech Radio Symphony Orchestra_The Seasons- Winter- Frost, snow, ice.aac | 2023-12-07 08:36 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_07_07_30_01_Claude Gagnon, guitar; David Jacques, guitar; Nicole Trotier_O Joyful Children (arr. Claude Gagnon).aac | 2023-12-07 08:28 | 2.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_07_07_30_01_RIAS Chamber Choir_O freudenreicher Tag (O Joyous Day).aac | 2023-12-07 08:22 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_07_07_30_01_Malle Babbe Women's Choir_Der Englische Gruss (The Annunciation).aac | 2023-12-07 08:20 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_07_07_30_01_The Choral Project_The Wassail Song.aac | 2023-12-07 08:16 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_07_07_30_01_Choir of Gonville & Caius College, Cambridge_Rocking (Czech Carol, arr. Edward Higginbottom).aac | 2023-12-07 08:13 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_07_07_30_01_Amsterdam Baroque Orchestra_The Four Seasons- Winter- By the Hearth.aac | 2023-12-07 08:03 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_07_07_30_01_Taverner Choir_Chant- Antiphon from Chester Processional.aac | 2023-12-07 08:02 | 1.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_07_07_30_01_Portland Brass Quintet_Deck the Hall.aac | 2023-12-07 07:58 | 682K | |
![[ ]](/icons/unknown.gif) | 2023_12_07_07_30_01_Etherea Vocal Ensemble_Gabriel's Message (arr. John Rutter).aac | 2023-12-07 07:57 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_07_07_30_01_Royal Philharmonic Orchestra with London Voices_He shall feed His flock.aac | 2023-12-07 07:54 | 3.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_07_07_30_01_St. Thomas Choir, Leipzig_Ich Steh An Deiner Krippen Hier.aac | 2023-12-07 07:44 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_07_07_30_01_The Queen's Six_Gabriel's Message.aac | 2023-12-07 07:42 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_07_07_30_01_Baltimore Consort_Chestnut (A Wassail Tune).aac | 2023-12-07 07:36 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_05_08_30_01_Utah Symphony Orchestra_Ave Maria.aac | 2023-12-05 10:26 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_05_08_30_01_Baltimore Consort_Wir singen dir, Immanuel (We sing unto You, Emmanuel).aac | 2023-12-05 10:23 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_05_08_30_01_Boston Pops Orchestra_Sleigh Ride.aac | 2023-12-05 10:20 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_05_08_30_01_Harrington String Quartet; Phoenix Chorale_The Ground (adapted from Sunrise Mass).aac | 2023-12-05 10:18 | 3.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_05_08_30_01_Sistine Chapel Choir_Adoramus te, Christe (We Adore Thee, Christ).aac | 2023-12-05 10:13 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_05_08_30_01_Monteverdi Choir_Alma Redemptoris Mater (16th century).aac | 2023-12-05 10:11 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_05_08_30_01_New York Pops_Merry Christmas.aac | 2023-12-05 10:07 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_05_08_30_01_Scholars Baroque Ensemble_Messiah- Pifa (Pastoral Symphony).aac | 2023-12-05 10:04 | 718K | |
![[ ]](/icons/unknown.gif) | 2023_12_05_08_30_01_Paul O'Dette, lute_Tous les bourgeois de Chartres.aac | 2023-12-05 10:03 | 2.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_05_08_30_01_Luc Beausejour, organ_Trumpet Sonata in D- Third Movement- Allegro.aac | 2023-12-05 09:59 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_05_08_30_01_St. Paul's Cathedral Choir_There Is No Rose.aac | 2023-12-05 09:57 | 1.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_05_08_30_01_Dallas Wind Symphony_Deck the Hall.aac | 2023-12-05 09:55 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_05_08_30_01_RIAS Chamber Choir_Ich lag in tiefster Todesnacht.aac | 2023-12-05 09:53 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_05_08_30_01_Westminster Choir College of Rider University_O Magnum Mysterium.aac | 2023-12-05 09:50 | 3.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_05_08_30_01_De Organographia_God Rest You Merry, Gentlemen.aac | 2023-12-05 09:43 | 846K | |
![[ ]](/icons/unknown.gif) | 2023_12_05_08_30_01_Sinfonia Cymru_A Gaelic Blessing- Meditation.aac | 2023-12-05 09:42 | 3.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_05_08_30_01_Anonymous 4_A New Year Carol.aac | 2023-12-05 09:37 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_05_08_30_01_Vienna Boys Choir_Heiligste Nacht (Holiest Night).aac | 2023-12-05 09:35 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_05_08_30_01_Robert Shaw Festival Singers_Glory to God in the Highest.aac | 2023-12-05 09:33 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_05_08_30_01_Musica Intima_Venez, mes enfants (Come, my children).aac | 2023-12-05 09:30 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_05_08_30_01_Netherlands Bach Society_Christmas Oratorio (Pt. 2)- Sinfonia.aac | 2023-12-05 09:28 | 3.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_05_08_30_01_Robert Groslot, piano_Children's Suite- Romance- Andantino.aac | 2023-12-05 09:23 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_05_08_30_01_Piano4te_Merry Christmas Mr. Lawrence (arr. H. Otakara).aac | 2023-12-05 09:21 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_05_08_30_01_Die Singphoniker_Nu zijt wellekome (You are Welcome).aac | 2023-12-05 09:14 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_05_08_30_01_Taverner Consort, Choir & Players_O Jesulein suss (O Sweet Jesus).aac | 2023-12-05 09:12 | 1.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_05_08_30_01_Oklahoma Woodwind Quintet_Christmas Carol Medley.aac | 2023-12-05 09:10 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_05_08_30_01_Royal Philharmonic Orchestra with London Voices_He shall feed His flock.aac | 2023-12-05 09:07 | 3.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_05_08_30_01_London Symphony Brass_Canzon II a 4 for brass.aac | 2023-12-05 09:02 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_05_08_30_01_Canadian Brass_Joy to the World.aac | 2023-12-05 08:59 | 2.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_05_08_30_01_Tafelmusik Baroque Chorus & Orchestra_Messiah- Hallelujah Chorus.aac | 2023-12-05 08:55 | 2.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_05_08_30_01_The American Boychoir_Missa Brevis- Veni Redemptor.aac | 2023-12-05 08:51 | 1.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_05_08_30_01_Pittsburgh Symphony Low Brass_Petites Litanies de Jesus.aac | 2023-12-05 08:50 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_04_08_30_02_Katherine Murdock, viola; Nathaniel Rosen, cello_When Christmas Morn Was Dawning.aac | 2023-12-04 10:27 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_04_08_30_02_Brent Mason, guitar; Mark Casstevens, guitar_The Cherry Tree Carol (arr. O'Connor).aac | 2023-12-04 10:25 | 2.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_04_08_30_02_London Baroque_Canon in D.aac | 2023-12-04 10:22 | 2.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_04_08_30_02_24 Cellos of the London Sound_Introit- Once in Royal David's City.aac | 2023-12-04 10:18 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_04_08_30_02_Stuttgart Chamber Choir_Und unser lieben Frauen (And our Blessed Lady).aac | 2023-12-04 10:15 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_04_08_30_02_Lords of the Chords_Zu Bethlehem geboren (A child born in Bethlehem).aac | 2023-12-04 10:12 | 1.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_04_08_30_02_Westminster Choir, Rider University, NY_Dans cette etable.aac | 2023-12-04 10:10 | 1.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_04_08_30_02_BBC Singers_Here is the Little Door.aac | 2023-12-04 10:08 | 2.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_04_08_30_02_Orpheus Vocal Ensemble_Freu dich, Erd und Sternenzelt (Rejoice, Earth & Firmament).aac | 2023-12-04 10:05 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_04_08_30_02_Portland Revels_Comes the Morning.aac | 2023-12-04 10:02 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_04_08_30_02_Gabrieli Consort & Players_Christmas Mass- Sonata.aac | 2023-12-04 09:58 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_04_08_30_02_Slovak State Philharmonic Orchestra_The Skaters Waltz (Les Patineurs), Opus 183.aac | 2023-12-04 09:55 | 5.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_04_08_30_02_Philharmonia Virtuosi_A Musical Sleigh Ride.aac | 2023-12-04 09:47 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_04_08_30_02_Portland State Chamber Choir_O Salutaris Hostia.aac | 2023-12-04 09:45 | 2.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_04_08_30_02_Orpheus Vocal Ensemble; Ars Antiqua Austria_Ave maris stella (Hail, queen of the stars).aac | 2023-12-04 09:41 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_04_08_30_02_The Choral Project_Caroling, Caroling.aac | 2023-12-04 09:38 | 1.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_04_08_30_02_West Edge String Quartet_A La Media Noche-De Tierra Lajana Venimos.aac | 2023-12-04 09:36 | 3.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_04_08_30_02_Chanticleer_The Three Kings.aac | 2023-12-04 09:31 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_04_08_30_02_Rome Sinfonietta Orchestra_Maria, che dolce nome (Mary, how sweet a name).aac | 2023-12-04 09:28 | 2.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_04_08_30_02_Prague Philharmonic Orchestra_Bethlehem Down.aac | 2023-12-04 09:24 | 2.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_04_08_30_02_Grex Vocalis_Kling no klokka (The bells ring, they sound).aac | 2023-12-04 09:20 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_04_08_30_02_Kampin Laulu Chamber Choir_Ecce novum gaudium (Behold the new Joy).aac | 2023-12-04 09:18 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_04_08_30_02_Carolina Chamber Chorale_Hannerot Hallalu (Hanukkah song).aac | 2023-12-04 09:11 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_04_08_30_02_Taverner Choir_Chant- Antiphon from Chester Processional.aac | 2023-12-04 09:07 | 682K | |
![[ ]](/icons/unknown.gif) | 2023_12_03_08_30_02_Oregon Chorale_In Dulci Jubilo (Good Christian Men, Rejoice).aac | 2023-12-03 10:27 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_03_08_30_02_Oklahoma Woodwind Quintet_Rise, Come and See The King.aac | 2023-12-03 10:24 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_03_08_30_02_Les Arts Florissants_Noels Sur Les Instruments- Laissez paitre vos betes.aac | 2023-12-03 10:21 | 1.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_03_08_30_02_Christopher Parkening, guitar_Carol of the Birds.aac | 2023-12-03 10:20 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_03_08_30_02_Hilary Field, guitar_Guitar Suite- For an Old Friend at Christmas- III. Lento.aac | 2023-12-03 10:18 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_03_08_30_02_Voices of Ascension_Missa Papae Marcelli- Agnus Dei.aac | 2023-12-03 10:16 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_03_08_30_02_Trinity Coll. Cambr. Choir_Hodie Christus natus est.aac | 2023-12-03 10:13 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_03_08_30_02_Anonymous 4_Behold, here is the best morning.aac | 2023-12-03 10:10 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_03_08_30_02_Hollywood Bowl Orchestra_Away In A Manger.aac | 2023-12-03 10:04 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_03_08_30_02_Pro Arte Singers_Sweete was the song the Virgine soong.aac | 2023-12-03 10:00 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_03_08_30_02_Seattle Pro Musica_Ave Maria.aac | 2023-12-03 09:58 | 2.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_03_08_30_02_Katherine Murdock, viola; Nathaniel Rosen, cello_Angels' Carol.aac | 2023-12-03 09:54 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_03_08_30_02_Singscape_O Little Town of Bethlehem.aac | 2023-12-03 09:51 | 3.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_03_08_30_02_Camerata Vocale Freiburg_Schlaf mein Kindelein (Sleep, My Child).aac | 2023-12-03 09:46 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_03_08_30_02_Ensemble Galilei_What is This Lovely Fragrance-.aac | 2023-12-03 09:43 | 2.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_03_08_30_02_Royal Philharmonic Orchestra with London Voices_Hansel and Gretel- 'Abends will ich schlafen gehn'.aac | 2023-12-03 09:39 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_03_08_30_02_Aulos Ensemble_Noel en Trio et en Dialogue.aac | 2023-12-03 09:35 | 2.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_03_08_30_02_City of London Sinfonia_Dormi Jesu.aac | 2023-12-03 09:29 | 3.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_03_08_30_02_University of British Columbia Singers_Little Child in a Manger.aac | 2023-12-03 09:25 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_03_08_30_02_Grex Vocalis_Ave Maris Stella.aac | 2023-12-03 09:22 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_03_08_30_02_Cologne Chamber Orchestra_Christmas Concerto, Opus 6-8- Pastorale.aac | 2023-12-03 09:19 | 2.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_03_08_30_02_Chamber Orchestra Kremlin_The Seasons- December- Christmas.aac | 2023-12-03 09:15 | 3.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_03_08_30_02_Chicago Symphony_Messiah- -I know that my Redeemer liveth-.aac | 2023-12-03 09:10 | 4.0M | |
![[ ]](/icons/unknown.gif) | 2023_12_03_08_30_02_RIAS Chamber Choir_Let us rock the little child.aac | 2023-12-03 09:05 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_03_08_30_02_Vasari Singers_Sing Lullaby.aac | 2023-12-03 09:02 | 2.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_03_08_30_02_Musica Sacra_Patapan.aac | 2023-12-03 08:59 | 918K | |
![[ ]](/icons/unknown.gif) | 2023_12_03_08_30_02_Lahti Symphony Orchestra_The Bells of Christmas.aac | 2023-12-03 08:54 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_03_08_30_02_St. Paul's Cathedral Choir_O Come, All Ye Faithful (arr. David Willcocks).aac | 2023-12-03 08:49 | 2.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_02_08_30_02_Chanticleer_Beautiful Star of Bethlehem.aac | 2023-12-02 10:28 | 2.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_02_08_30_02_Oklahoma Woodwind Quintet_Stille, Stille, Stille.aac | 2023-12-02 10:20 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_02_08_30_02_Foothills Brass Quintet_Il est ne le divin enfant (the Divine Infant is Born).aac | 2023-12-02 10:17 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_02_08_30_02_Royal Ballet Sinfonia_Old Christmas Music- The First Mercy (after Peter Warlock).aac | 2023-12-02 10:15 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_02_08_30_02_Musica Sacra_I Wonder As I Wander.aac | 2023-12-02 10:09 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_02_08_30_02_La Pieta_Sleep Holy Infant - Lullaby.aac | 2023-12-02 10:06 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_02_08_30_02_Arthur Haas, harpsichord_Coventry Carol.aac | 2023-12-02 10:02 | 2.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_02_08_30_02_1st Presb. Ft. Thomas Bell Choir_Angels We Have Heard on High.aac | 2023-12-02 09:57 | 670K | |
![[ ]](/icons/unknown.gif) | 2023_12_02_08_30_02_The Cambridge Singers_Blessed Be That Maid Mary.aac | 2023-12-02 09:56 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_02_08_30_02_Choir of King's College, Cambridge_Quem pastores laudevere.aac | 2023-12-02 09:53 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_02_08_30_02_Sonos Handbell Choir_Bring a Torch, Jeanette, Isabella.aac | 2023-12-02 09:49 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_02_08_30_02_Smithsonian Chamber Players_Von Himmel hoch.aac | 2023-12-02 09:47 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_02_08_30_02_Westminster Concert Bell Choir_We Three Kings.aac | 2023-12-02 09:45 | 1.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_02_08_30_02_St. Paul's Cathedral Choir_Silent Night.aac | 2023-12-02 09:43 | 2.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_02_08_30_02_The Queen's Six_Corpus Christi Carol.aac | 2023-12-02 09:40 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_02_08_30_02_Royal Philharmonic Orchestra with London Voices_L'Enfance du Christ, Opus 25- 'L'adieu des bergers'.aac | 2023-12-02 09:36 | 2.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_02_08_30_02_Emory Symphonic Winds_Greensleaves (arr. Alfred Reed).aac | 2023-12-02 09:32 | 3.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_02_08_30_02_Eaken Piano Trio_El Noi de la Mare (The Song of Mary).aac | 2023-12-02 09:26 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_02_08_30_02_West Edge String Quartet_Carol of the Bells.aac | 2023-12-02 09:23 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_02_08_30_02_City of London Sinfonia_Candlelight Carol.aac | 2023-12-02 09:21 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_02_08_30_02_American Boy Choir_Lullay, Lullay- As I lay on Yoolis Night.aac | 2023-12-02 09:17 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_02_08_30_02_In Mulieribus_Es ist ein' Ros' entsprungen.aac | 2023-12-02 09:14 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_02_08_30_02_Los Angeles Guitar Quartet_Nutcracker Suite, Opus 71a- Waltz of the Flowers.aac | 2023-12-02 09:11 | 3.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_02_08_30_02_Sinfonia Cymru_Lullaby for Ana Gwen.aac | 2023-12-02 09:04 | 3.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_02_08_30_02_Christopher Parkening, guitar_Infant Holy, Infant Lowly (Polish Carol).aac | 2023-12-02 09:00 | 2.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_02_08_30_02_Malle Babbe Women's Choir_Maria durch ein Dornwald ging.aac | 2023-12-02 08:57 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_02_08_30_02_Cappella SF (San Francisco)_Psallite unigenito (Sing Psalms).aac | 2023-12-02 08:54 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_02_08_30_02_Oklahoma Woodwind Quintet_Rise, Come and See The King.aac | 2023-12-02 08:53 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_02_08_30_02_Pioneer Brass_The Holly and the Ivy.aac | 2023-12-02 08:50 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_02_08_30_02_Pittsburgh Symphony Brass_Volte.aac | 2023-12-02 08:48 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_02_08_30_02_Slovak Radio Symphony Orchestra_The Seasons- Winter- Ice.aac | 2023-12-02 08:40 | 926K | |
![[ ]](/icons/unknown.gif) | 2023_12_01_08_30_01_Oklahoma Woodwind Quintet_Stille, Stille, Stille.aac | 2023-12-01 10:28 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_01_08_30_01_Foothills Brass Quintet_Il est ne le divin enfant (the Divine Infant is Born).aac | 2023-12-01 10:25 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_01_08_30_01_Royal Ballet Sinfonia_Old Christmas Music- The First Mercy (after Peter Warlock).aac | 2023-12-01 10:23 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_01_08_30_01_Musica Sacra_I Wonder As I Wander.aac | 2023-12-01 10:17 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_12_01_08_30_01_La Pieta_Sleep Holy Infant - Lullaby.aac | 2023-12-01 10:14 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_01_08_30_01_Arthur Haas, harpsichord_Coventry Carol.aac | 2023-12-01 10:10 | 2.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_01_08_30_01_1st Presb. Ft. Thomas Bell Choir_Angels We Have Heard on High.aac | 2023-12-01 10:05 | 658K | |
![[ ]](/icons/unknown.gif) | 2023_12_01_08_30_01_The Cambridge Singers_Blessed Be That Maid Mary.aac | 2023-12-01 10:04 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_01_08_30_01_Choir of King's College, Cambridge_Quem pastores laudevere.aac | 2023-12-01 10:01 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_01_08_30_01_Sonos Handbell Choir_Bring a Torch, Jeanette, Isabella.aac | 2023-12-01 09:57 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_01_08_30_01_Smithsonian Chamber Players_Von Himmel hoch.aac | 2023-12-01 09:55 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_01_08_30_01_Westminster Concert Bell Choir_We Three Kings.aac | 2023-12-01 09:53 | 1.4M | |
![[ ]](/icons/unknown.gif) | 2023_12_01_08_30_01_St. Paul's Cathedral Choir_Silent Night.aac | 2023-12-01 09:51 | 2.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_01_08_30_01_The Queen's Six_Corpus Christi Carol.aac | 2023-12-01 09:48 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_01_08_30_01_Royal Philharmonic Orchestra with London Voices_L'Enfance du Christ, Opus 25- 'L'adieu des bergers'.aac | 2023-12-01 09:44 | 2.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_01_08_30_01_Emory Symphonic Winds_Greensleaves (arr. Alfred Reed).aac | 2023-12-01 09:39 | 3.9M | |
![[ ]](/icons/unknown.gif) | 2023_12_01_08_30_01_Eaken Piano Trio_El Noi de la Mare (The Song of Mary).aac | 2023-12-01 09:34 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_01_08_30_01_West Edge String Quartet_Carol of the Bells.aac | 2023-12-01 09:31 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_01_08_30_01_City of London Sinfonia_Candlelight Carol.aac | 2023-12-01 09:29 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2023_12_01_08_30_01_American Boy Choir_Lullay, Lullay- As I lay on Yoolis Night.aac | 2023-12-01 09:25 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_01_08_30_01_In Mulieribus_Es ist ein' Ros' entsprungen.aac | 2023-12-01 09:22 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_01_08_30_01_Los Angeles Guitar Quartet_Nutcracker Suite, Opus 71a- Waltz of the Flowers.aac | 2023-12-01 09:19 | 3.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_01_08_30_01_Sinfonia Cymru_Lullaby for Ana Gwen.aac | 2023-12-01 09:12 | 3.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_01_08_30_01_Christopher Parkening, guitar_Infant Holy, Infant Lowly (Polish Carol).aac | 2023-12-01 09:08 | 2.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_01_08_30_01_Malle Babbe Women's Choir_Maria durch ein Dornwald ging.aac | 2023-12-01 09:05 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_12_01_08_30_01_Cappella SF (San Francisco)_Psallite unigenito (Sing Psalms).aac | 2023-12-01 09:02 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_12_01_08_30_01_Oklahoma Woodwind Quintet_Rise, Come and See The King.aac | 2023-12-01 09:00 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_12_01_08_30_01_Pioneer Brass_The Holly and the Ivy.aac | 2023-12-01 08:58 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_12_01_08_30_01_Pittsburgh Symphony Brass_Volte.aac | 2023-12-01 08:56 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_12_01_08_30_01_Slovak Radio Symphony Orchestra_The Seasons- Winter- Ice.aac | 2023-12-01 08:48 | 926K | |
![[ ]](/icons/unknown.gif) | 2023_11_30_08_30_01_The American Boychoir_Chorale after an old French Carol.aac | 2023-11-30 10:29 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_11_30_08_30_01_Utah Symphony Orchestra_Ave Maria.aac | 2023-11-30 10:22 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_11_30_08_30_01_Baltimore Consort_Wir singen dir, Immanuel (We sing unto You, Emmanuel).aac | 2023-11-30 10:19 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_11_30_08_30_01_Boston Pops Orchestra_Sleigh Ride.aac | 2023-11-30 10:17 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_11_30_08_30_01_Sistine Chapel Choir_Adoramus te, Christe (We Adore Thee, Christ).aac | 2023-11-30 10:08 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_11_30_08_30_01_Monteverdi Choir_Alma Redemptoris Mater (16th century).aac | 2023-11-30 10:06 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2023_11_30_08_30_01_Scholars Baroque Ensemble_Messiah- Pifa (Pastoral Symphony).aac | 2023-11-30 10:02 | 738K | |
![[ ]](/icons/unknown.gif) | 2023_11_30_08_30_01_Paul O'Dette, lute_Tous les bourgeois de Chartres.aac | 2023-11-30 10:01 | 2.9M | |
![[ ]](/icons/unknown.gif) | 2023_11_30_08_30_01_Luc Beausejour, organ_Trumpet Sonata in D- Third Movement- Allegro.aac | 2023-11-30 09:57 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_11_30_08_30_01_RIAS Chamber Choir_Ich lag in tiefster Todesnacht.aac | 2023-11-30 09:55 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_11_30_08_30_01_New York Pops_Merry Christmas.aac | 2023-11-30 09:52 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_11_30_08_30_01_Sinfonia Cymru_A Gaelic Blessing- Meditation.aac | 2023-11-30 09:47 | 3.3M | |
![[ ]](/icons/unknown.gif) | 2023_11_30_08_30_01_Anonymous 4_A New Year Carol.aac | 2023-11-30 09:43 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_11_30_08_30_01_Vienna Boys Choir_Heiligste Nacht (Holiest Night).aac | 2023-11-30 09:41 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_11_30_08_30_01_Robert Shaw Festival Singers_Glory to God in the Highest.aac | 2023-11-30 09:38 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_11_30_08_30_01_Netherlands Bach Society_Christmas Oratorio (Pt. 2)- Sinfonia.aac | 2023-11-30 09:36 | 3.8M | |
![[ ]](/icons/unknown.gif) | 2023_11_30_08_30_01_Robert Groslot, piano_Children's Suite- Romance- Andantino.aac | 2023-11-30 09:30 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_11_30_08_30_01_Piano4te_Merry Christmas Mr. Lawrence (arr. H. Otakara).aac | 2023-11-30 09:28 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_11_30_08_30_01_Die Singphoniker_Nu zijt wellekome (You are Welcome).aac | 2023-11-30 09:21 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_11_30_08_30_01_Taverner Consort, Choir & Players_O Jesulein suss (O Sweet Jesus).aac | 2023-11-30 09:19 | 2.6M | |
![[ ]](/icons/unknown.gif) | 2023_11_30_08_30_01_Oklahoma Woodwind Quintet_Christmas Carol Medley.aac | 2023-11-30 09:15 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_11_30_08_30_01_Royal Philharmonic Orchestra with London Voices_He shall feed His flock.aac | 2023-11-30 09:12 | 3.6M | |
![[ ]](/icons/unknown.gif) | 2023_11_30_08_30_01_London Symphony Brass_Canzon II a 4 for brass.aac | 2023-11-30 09:07 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_11_30_08_30_01_Canadian Brass_Joy to the World.aac | 2023-11-30 09:04 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2023_11_30_08_30_01_The American Boychoir_Missa Brevis- Veni Redemptor.aac | 2023-11-30 09:02 | 1.0M | |
![[ ]](/icons/unknown.gif) | 2023_11_30_08_30_01_Arion_Noels- Amoroso.aac | 2023-11-30 09:01 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_11_30_08_30_01_Santa Fe Guitar Quartet_Terpsichore- Ballet (Guitar Quartet).aac | 2023-11-30 08:59 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_11_30_08_30_01_Bengt Forsberg, piano_Villancico Vasco (Basque Carol).aac | 2023-11-30 08:57 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2023_11_30_08_30_01_The Sixteen_Salve Regina (Plainchant).aac | 2023-11-30 08:55 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_11_30_08_30_01_Monteverdi Choir_Gloria in excelsis Deo (16th century).aac | 2023-11-30 08:52 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_11_30_08_30_01_Musica Fiata_Jubiliret Frohlich (Canzona in 8 parts).aac | 2023-11-30 08:50 | 3.3M | |
![[ ]](/icons/unknown.gif) | 2023_11_30_08_30_01_BBC Concert Orchestra_Patapan (for Woodwinds).aac | 2023-11-30 08:45 | 962K | |
![[ ]](/icons/unknown.gif) | 2023_11_30_08_30_01_Eduard Laurel, piano_Toy Soldier March.aac | 2023-11-30 08:43 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2023_11_30_08_30_01_Taverner Consort_Christmas Eve.aac | 2023-11-30 08:42 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_11_29_08_30_02_Trinity Cathedral Choir, Portland_The Cherry Tree Carol.aac | 2023-11-29 10:25 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_11_29_08_30_02_City of London Sinfonia_Candlelight Carol.aac | 2023-11-29 10:22 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2023_11_29_08_30_02_Arthur Haas, harpsichord_Coventry Carol.aac | 2023-11-29 10:18 | 5.3M | |
![[ ]](/icons/unknown.gif) | 2023_11_29_08_30_02_Baroque Players of Hamilton_Third Symphony of Noels.aac | 2023-11-29 10:10 | 3.4M | |
![[ ]](/icons/unknown.gif) | 2023_11_29_08_30_02_Synergy Brass Quintet_Joy To The World.aac | 2023-11-29 10:05 | 2.6M | |
![[ ]](/icons/unknown.gif) | 2023_11_29_08_30_02_Katherine Murdock, viola; Nathaniel Rosen, cello_Gaudeamus (string quartet).aac | 2023-11-29 10:01 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_11_29_08_30_02_American Boy Choir_Lullay, Thou Tiny Little Child.aac | 2023-11-29 09:56 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_11_29_08_30_02_Capricorn_Jesu, Joy Of Man's Desiring.aac | 2023-11-29 09:54 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_11_29_08_30_02_Voces 8_Lux Aeterna- O Nata Lux.aac | 2023-11-29 09:51 | 3.1M | |
![[ ]](/icons/unknown.gif) | 2023_11_29_08_30_02_BBC Concert Orchestra_A Musical Sleigh Ride.aac | 2023-11-29 09:47 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_11_29_08_30_02_Royal Philharmonic Orchestra_Ave Maria.aac | 2023-11-29 09:42 | 3.0M | |
![[ ]](/icons/unknown.gif) | 2023_11_29_08_30_02_Royal Ballet Sinfonia_Waltz for Strings.aac | 2023-11-29 09:37 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_11_29_08_30_02_Vienna Boys Choir_Entre le boeuf et l'ane gris.aac | 2023-11-29 09:35 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_11_29_08_30_02_Ola Gjeilo, piano, and 12 Ensemble_Away in a Manger (arr. Ola Gjeilo).aac | 2023-11-29 09:32 | 2.7M | |
![[ ]](/icons/unknown.gif) | 2023_11_29_08_30_02_Stuttgart Chamber Choir_Es ist ein Ros entsprungen.aac | 2023-11-29 09:28 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_11_29_08_30_02_Eteri Andjaparidze, piano_Weihnachtsbaum (Christmas Tree)- In dulci jubilo.aac | 2023-11-29 09:22 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_11_29_08_30_02_Bournemouth Symphony Orchestra_Traditional Slavic Christmas Music.aac | 2023-11-29 09:19 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_11_29_08_30_02_The King's Noyse_The New Year's gift.aac | 2023-11-29 09:15 | 750K | |
![[ ]](/icons/unknown.gif) | 2023_11_29_08_30_02_Empire Brass_Sleepers Wake (Cantata BWV 140).aac | 2023-11-29 09:14 | 3.0M | |
![[ ]](/icons/unknown.gif) | 2023_11_29_08_30_02_In Mulieribus (Portland ens.)_Ave Maria.aac | 2023-11-29 09:08 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_11_29_08_30_02_Tafelmusik Baroque Orchestra_Messiah- Rejoice greatly, O daughter of Zion.aac | 2023-11-29 09:05 | 3.5M | |
![[ ]](/icons/unknown.gif) | 2023_11_29_08_30_02_New York Polyphony_There is no Rose.aac | 2023-11-29 09:00 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_11_29_08_30_02_Pavao String Quartet_Christmas Medley (arr. Carlo Martelli).aac | 2023-11-29 08:49 | 4.3M | |
![[ ]](/icons/unknown.gif) | 2023_11_29_08_30_02_Malle Babbe Women's Choir_Ave Maria (16th century setting).aac | 2023-11-29 08:43 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_11_29_08_30_02_RIAS Chamber Choir_Schlaf, mein Kindelein (Sleep, my little child).aac | 2023-11-29 08:42 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_11_29_08_30_02_The American Boychoir_Missa Brevis- Gloria.aac | 2023-11-29 08:39 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_11_28_08_30_02_Utah Symphony Orchestra_Ave Maria.aac | 2023-11-28 10:24 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_11_28_08_30_02_Baltimore Consort_Wir singen dir, Immanuel (We sing unto You, Emmanuel).aac | 2023-11-28 10:21 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_11_28_08_30_02_Boston Pops Orchestra_Sleigh Ride.aac | 2023-11-28 10:19 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_11_28_08_30_02_Sistine Chapel Choir_Adoramus te, Christe (We Adore Thee, Christ).aac | 2023-11-28 10:11 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_11_28_08_30_02_Monteverdi Choir_Alma Redemptoris Mater (16th century).aac | 2023-11-28 10:09 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2023_11_28_08_30_02_New York Pops_Merry Christmas.aac | 2023-11-28 10:05 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_11_28_08_30_02_Scholars Baroque Ensemble_Messiah- Pifa (Pastoral Symphony).aac | 2023-11-28 10:02 | 738K | |
![[ ]](/icons/unknown.gif) | 2023_11_28_08_30_02_Paul O'Dette, lute_Tous les bourgeois de Chartres.aac | 2023-11-28 10:01 | 2.9M | |
![[ ]](/icons/unknown.gif) | 2023_11_28_08_30_02_Luc Beausejour, organ_Trumpet Sonata in D- Third Movement- Allegro.aac | 2023-11-28 09:57 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_11_28_08_30_02_St. Paul's Cathedral Choir_There Is No Rose.aac | 2023-11-28 09:55 | 1.4M | |
![[ ]](/icons/unknown.gif) | 2023_11_28_08_30_02_RIAS Chamber Choir_Ich lag in tiefster Todesnacht.aac | 2023-11-28 09:53 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_11_28_08_30_02_Westminster Choir College of Rider University_O Magnum Mysterium.aac | 2023-11-28 09:50 | 3.5M | |
![[ ]](/icons/unknown.gif) | 2023_11_28_08_30_02_De Organographia_God Rest You Merry, Gentlemen.aac | 2023-11-28 09:43 | 858K | |
![[ ]](/icons/unknown.gif) | 2023_11_28_08_30_02_Sinfonia Cymru_A Gaelic Blessing- Meditation.aac | 2023-11-28 09:42 | 3.3M | |
![[ ]](/icons/unknown.gif) | 2023_11_28_08_30_02_Anonymous 4_A New Year Carol.aac | 2023-11-28 09:37 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_11_28_08_30_02_Vienna Boys Choir_Heiligste Nacht (Holiest Night).aac | 2023-11-28 09:35 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_11_28_08_30_02_Robert Shaw Festival Singers_Glory to God in the Highest.aac | 2023-11-28 09:33 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_11_28_08_30_02_Musica Intima_Venez, mes enfants (Come, my children).aac | 2023-11-28 09:30 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_11_28_08_30_02_Netherlands Bach Society_Christmas Oratorio (Pt. 2)- Sinfonia.aac | 2023-11-28 09:28 | 3.6M | |
![[ ]](/icons/unknown.gif) | 2023_11_28_08_30_02_Robert Groslot, piano_Children's Suite- Romance- Andantino.aac | 2023-11-28 09:23 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_11_28_08_30_02_Piano4te_Merry Christmas Mr. Lawrence (arr. H. Otakara).aac | 2023-11-28 09:20 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_11_28_08_30_02_Die Singphoniker_Nu zijt wellekome (You are Welcome).aac | 2023-11-28 09:14 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_11_28_08_30_02_Oklahoma Woodwind Quintet_Christmas Carol Medley.aac | 2023-11-28 09:11 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2023_11_28_08_30_02_Royal Philharmonic Orchestra with London Voices_He shall feed His flock.aac | 2023-11-28 09:07 | 3.6M | |
![[ ]](/icons/unknown.gif) | 2023_11_28_08_30_02_London Symphony Brass_Canzon II a 4 for brass.aac | 2023-11-28 09:02 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_11_28_08_30_02_Canadian Brass_Joy to the World.aac | 2023-11-28 08:59 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2023_11_28_08_30_02_Taverner Consort, Choir & Players_O Jesulein suss (O Sweet Jesus).aac | 2023-11-28 08:57 | 1.4M | |
![[ ]](/icons/unknown.gif) | 2023_11_28_08_30_02_The American Boychoir_Missa Brevis- Veni Redemptor.aac | 2023-11-28 08:55 | 1.0M | |
![[ ]](/icons/unknown.gif) | 2023_11_28_08_30_02_Pittsburgh Symphony Low Brass_Petites Litanies de Jesus.aac | 2023-11-28 08:53 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_11_28_08_30_02_University of British Columbia Singers_Lo in a Manger.aac | 2023-11-28 08:51 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_11_28_08_30_02_Bournemouth Sinfonietta_St. Paul's Suite, Opus 29 no 2- Mvmt 4 Finale (The Dargason).aac | 2023-11-28 08:48 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_11_28_08_30_02_Arion_Noels- Amoroso.aac | 2023-11-28 08:45 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_11_28_08_30_02_Santa Fe Guitar Quartet_Terpsichore- Ballet (Guitar Quartet).aac | 2023-11-28 08:43 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_11_28_08_30_02_Bengt Forsberg, piano_Villancico Vasco (Basque Carol).aac | 2023-11-28 08:41 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2023_11_27_08_30_02_Katherine Murdock, viola; Nathaniel Rosen, cello_When Christmas Morn Was Dawning.aac | 2023-11-27 10:27 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_11_27_08_30_02_Brent Mason, guitar; Mark Casstevens, guitar_The Cherry Tree Carol (arr. O'Connor).aac | 2023-11-27 10:25 | 2.6M | |
![[ ]](/icons/unknown.gif) | 2023_11_27_08_30_02_London Baroque_Canon in D.aac | 2023-11-27 10:21 | 2.6M | |
![[ ]](/icons/unknown.gif) | 2023_11_27_08_30_02_24 Cellos of the London Sound_Introit- Once in Royal David's City.aac | 2023-11-27 10:17 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_11_27_08_30_02_Stuttgart Chamber Choir_Und unser lieben Frauen (And our Blessed Lady).aac | 2023-11-27 10:14 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_11_27_08_30_02_Lords of the Chords_Zu Bethlehem geboren (A child born in Bethlehem).aac | 2023-11-27 10:12 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_11_27_08_30_02_Westminster Choir, Rider University, NY_Dans cette etable.aac | 2023-11-27 10:10 | 1.4M | |
![[ ]](/icons/unknown.gif) | 2023_11_27_08_30_02_BBC Singers_Here is the Little Door.aac | 2023-11-27 10:08 | 2.3M | |
![[ ]](/icons/unknown.gif) | 2023_11_27_08_30_02_Orpheus Vocal Ensemble_Freu dich, Erd und Sternenzelt (Rejoice, Earth & Firmament).aac | 2023-11-27 10:04 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_11_27_08_30_02_Portland Revels_Comes the Morning.aac | 2023-11-27 10:02 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_11_27_08_30_02_Gabrieli Consort & Players_Christmas Mass- Sonata.aac | 2023-11-27 09:57 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_11_27_08_30_02_Slovak State Philharmonic Orchestra_The Skaters Waltz (Les Patineurs), Opus 183.aac | 2023-11-27 09:54 | 5.4M | |
![[ ]](/icons/unknown.gif) | 2023_11_27_08_30_02_Philharmonia Virtuosi_A Musical Sleigh Ride.aac | 2023-11-27 09:46 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_11_27_08_30_02_Portland State Chamber Choir_O Salutaris Hostia.aac | 2023-11-27 09:44 | 2.6M | |
![[ ]](/icons/unknown.gif) | 2023_11_27_08_30_02_Orpheus Vocal Ensemble; Ars Antiqua Austria_Ave maris stella (Hail, queen of the stars).aac | 2023-11-27 09:41 | 2.4M | |
![[ ]](/icons/unknown.gif) | 2023_11_27_08_30_02_The Choral Project_Caroling, Caroling.aac | 2023-11-27 09:37 | 1.0M | |
![[ ]](/icons/unknown.gif) | 2023_11_27_08_30_02_West Edge String Quartet_A La Media Noche-De Tierra Lajana Venimos.aac | 2023-11-27 09:36 | 3.5M | |
![[ ]](/icons/unknown.gif) | 2023_11_27_08_30_02_Chanticleer_The Three Kings.aac | 2023-11-27 09:30 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_11_27_08_30_02_Rome Sinfonietta Orchestra_Maria, che dolce nome (Mary, how sweet a name).aac | 2023-11-27 09:27 | 2.7M | |
![[ ]](/icons/unknown.gif) | 2023_11_27_08_30_02_Prague Philharmonic Orchestra_Bethlehem Down.aac | 2023-11-27 09:23 | 2.9M | |
![[ ]](/icons/unknown.gif) | 2023_11_27_08_30_02_Grex Vocalis_Kling no klokka (The bells ring, they sound).aac | 2023-11-27 09:19 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_11_27_08_30_02_Kampin Laulu Chamber Choir_Ecce novum gaudium (Behold the new Joy).aac | 2023-11-27 09:17 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_11_27_08_30_02_Carolina Chamber Chorale_Hannerot Hallalu (Hanukkah song).aac | 2023-11-27 09:11 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_11_26_08_30_02_Les Arts Florissants_Noels Sur Les Instruments- Laissez paitre vos betes.aac | 2023-11-26 10:29 | 1.0M | |
![[ ]](/icons/unknown.gif) | 2023_11_26_08_30_02_Christopher Parkening, guitar_Carol of the Birds.aac | 2023-11-26 10:27 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_11_26_08_30_02_Hilary Field, guitar_Guitar Suite- For an Old Friend at Christmas- III. Lento.aac | 2023-11-26 10:25 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_11_26_08_30_02_Voices of Ascension_Missa Papae Marcelli- Agnus Dei.aac | 2023-11-26 10:23 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_11_26_08_30_02_Trinity Coll. Cambr. Choir_Hodie Christus natus est.aac | 2023-11-26 10:20 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_11_26_08_30_02_Anonymous 4_Behold, here is the best morning.aac | 2023-11-26 10:17 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_11_26_08_30_02_Hollywood Bowl Orchestra_Away In A Manger.aac | 2023-11-26 10:11 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_11_26_08_30_02_Pro Arte Singers_Sweete was the song the Virgine soong.aac | 2023-11-26 10:08 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_11_26_08_30_02_Seattle Pro Musica_Ave Maria.aac | 2023-11-26 10:05 | 2.4M | |
![[ ]](/icons/unknown.gif) | 2023_11_26_08_30_02_Katherine Murdock, viola; Nathaniel Rosen, cello_Angels' Carol.aac | 2023-11-26 10:01 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_11_26_08_30_02_Singscape_O Little Town of Bethlehem.aac | 2023-11-26 09:58 | 3.1M | |
![[ ]](/icons/unknown.gif) | 2023_11_26_08_30_02_Camerata Vocale Freiburg_Schlaf mein Kindelein (Sleep, My Child).aac | 2023-11-26 09:53 | 2.4M | |
![[ ]](/icons/unknown.gif) | 2023_11_26_08_30_02_Ensemble Galilei_What is This Lovely Fragrance-.aac | 2023-11-26 09:50 | 2.6M | |
![[ ]](/icons/unknown.gif) | 2023_11_26_08_30_02_Royal Philharmonic Orchestra with London Voices_Hansel and Gretel- 'Abends will ich schlafen gehn'.aac | 2023-11-26 09:46 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_11_26_08_30_02_Aulos Ensemble_Noel en Trio et en Dialogue.aac | 2023-11-26 09:42 | 2.4M | |
![[ ]](/icons/unknown.gif) | 2023_11_26_08_30_02_City of London Sinfonia_Dormi Jesu.aac | 2023-11-26 09:36 | 3.1M | |
![[ ]](/icons/unknown.gif) | 2023_11_26_08_30_02_University of British Columbia Singers_Little Child in a Manger.aac | 2023-11-26 09:32 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_11_26_08_30_02_Grex Vocalis_Ave Maris Stella.aac | 2023-11-26 09:29 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_11_26_08_30_02_Cologne Chamber Orchestra_Christmas Concerto, Opus 6-8- Pastorale.aac | 2023-11-26 09:26 | 2.6M | |
![[ ]](/icons/unknown.gif) | 2023_11_26_08_30_02_Chamber Orchestra Kremlin_The Seasons- December- Christmas.aac | 2023-11-26 09:22 | 3.1M | |
![[ ]](/icons/unknown.gif) | 2023_11_26_08_30_02_Chicago Symphony_Messiah- -I know that my Redeemer liveth-.aac | 2023-11-26 09:18 | 4.0M | |
![[ ]](/icons/unknown.gif) | 2023_11_26_08_30_02_RIAS Chamber Choir_Let us rock the little child.aac | 2023-11-26 09:12 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_11_26_08_30_02_Vasari Singers_Sing Lullaby.aac | 2023-11-26 09:10 | 2.4M | |
![[ ]](/icons/unknown.gif) | 2023_11_26_08_30_02_Musica Sacra_Patapan.aac | 2023-11-26 09:06 | 902K | |
![[ ]](/icons/unknown.gif) | 2023_11_26_08_30_02_Lahti Symphony Orchestra_The Bells of Christmas.aac | 2023-11-26 09:01 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2023_11_26_08_30_02_St. Paul's Cathedral Choir_O Come, All Ye Faithful (arr. David Willcocks).aac | 2023-11-26 08:57 | 2.7M | |
![[ ]](/icons/unknown.gif) | 2023_11_26_08_30_02_Heartstrings (Oregon-based ens.)_Joy To The World.aac | 2023-11-26 08:35 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2023_11_25_08_30_02_Oklahoma Woodwind Quintet_Stille, Stille, Stille.aac | 2023-11-25 10:27 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_11_25_08_30_02_Foothills Brass Quintet_Il est ne le divin enfant (the Divine Infant is Born).aac | 2023-11-25 10:24 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_11_25_08_30_02_Royal Ballet Sinfonia_Old Christmas Music- The First Mercy (after Peter Warlock).aac | 2023-11-25 10:22 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_11_25_08_30_02_Musica Sacra_I Wonder As I Wander.aac | 2023-11-25 10:16 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2023_11_25_08_30_02_La Pieta_Sleep Holy Infant - Lullaby.aac | 2023-11-25 10:13 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2023_11_25_08_30_02_Arthur Haas, harpsichord_Coventry Carol.aac | 2023-11-25 10:09 | 2.3M | |
![[ ]](/icons/unknown.gif) | 2023_11_25_08_30_02_1st Presb. Ft. Thomas Bell Choir_Angels We Have Heard on High.aac | 2023-11-25 10:04 | 670K | |
![[ ]](/icons/unknown.gif) | 2023_11_25_08_30_02_The Cambridge Singers_Blessed Be That Maid Mary.aac | 2023-11-25 10:03 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_11_25_08_30_02_Choir of King's College, Cambridge_Quem pastores laudevere.aac | 2023-11-25 10:00 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_11_25_08_30_02_Sonos Handbell Choir_Bring a Torch, Jeanette, Isabella.aac | 2023-11-25 09:56 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_11_25_08_30_02_Smithsonian Chamber Players_Von Himmel hoch.aac | 2023-11-25 09:54 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_11_25_08_30_02_Westminster Concert Bell Choir_We Three Kings.aac | 2023-11-25 09:52 | 1.4M | |
![[ ]](/icons/unknown.gif) | 2023_11_25_08_30_02_St. Paul's Cathedral Choir_Silent Night.aac | 2023-11-25 09:50 | 2.3M | |
![[ ]](/icons/unknown.gif) | 2023_11_25_08_30_02_The Queen's Six_Corpus Christi Carol.aac | 2023-11-25 09:47 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_11_25_08_30_02_Royal Philharmonic Orchestra with London Voices_L'Enfance du Christ, Opus 25- 'L'adieu des bergers'.aac | 2023-11-25 09:43 | 2.9M | |
![[ ]](/icons/unknown.gif) | 2023_11_25_08_30_02_Emory Symphonic Winds_Greensleaves (arr. Alfred Reed).aac | 2023-11-25 09:39 | 3.9M | |
![[ ]](/icons/unknown.gif) | 2023_11_25_08_30_02_Eaken Piano Trio_El Noi de la Mare (The Song of Mary).aac | 2023-11-25 09:33 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_11_25_08_30_02_West Edge String Quartet_Carol of the Bells.aac | 2023-11-25 09:30 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_11_25_08_30_02_City of London Sinfonia_Candlelight Carol.aac | 2023-11-25 09:28 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2023_11_25_08_30_02_American Boy Choir_Lullay, Lullay- As I lay on Yoolis Night.aac | 2023-11-25 09:24 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_11_25_08_30_02_In Mulieribus_Es ist ein' Ros' entsprungen.aac | 2023-11-25 09:21 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_11_25_08_30_02_Los Angeles Guitar Quartet_Nutcracker Suite, Opus 71a- Waltz of the Flowers.aac | 2023-11-25 09:18 | 3.6M | |
![[ ]](/icons/unknown.gif) | 2023_11_25_08_30_02_Sinfonia Cymru_Lullaby for Ana Gwen.aac | 2023-11-25 09:11 | 3.1M | |
![[ ]](/icons/unknown.gif) | 2023_11_25_08_30_02_Christopher Parkening, guitar_Infant Holy, Infant Lowly (Polish Carol).aac | 2023-11-25 09:07 | 2.3M | |
![[ ]](/icons/unknown.gif) | 2023_11_25_08_30_02_Malle Babbe Women's Choir_Maria durch ein Dornwald ging.aac | 2023-11-25 09:04 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_11_25_08_30_02_Cappella SF (San Francisco)_Psallite unigenito (Sing Psalms).aac | 2023-11-25 09:01 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_11_25_08_30_02_Oklahoma Woodwind Quintet_Rise, Come and See The King.aac | 2023-11-25 09:00 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_11_25_08_30_02_Pioneer Brass_The Holly and the Ivy.aac | 2023-11-25 08:57 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2023_11_25_08_30_02_Pittsburgh Symphony Brass_Volte.aac | 2023-11-25 08:55 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2023_11_25_08_30_02_Slovak Radio Symphony Orchestra_The Seasons- Winter- Ice.aac | 2023-11-25 08:47 | 926K | |
![[ ]](/icons/unknown.gif) | 2023_11_24_08_30_01_Ensemble Galilei_God Rest Ye Merry, Gentlemen; Good King Wenceslas.aac | 2023-11-24 10:27 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_11_24_08_30_01_Vienna Boys Choir_O du stille Zeit.aac | 2023-11-24 10:21 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_11_24_08_30_01_Die Singphoniker_Vom Himmel hoch (From Heaven on High I come to you).aac | 2023-11-24 10:20 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_11_24_08_30_01_Royal Ballet Sinfonia_Old Christmas Music- The First Mercy (after Peter Warlock).aac | 2023-11-24 10:17 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_11_24_08_30_01_National Philharmonic Orchestra_Ave Maria.aac | 2023-11-24 10:15 | 3.3M | |
![[ ]](/icons/unknown.gif) | 2023_11_24_08_30_01_Rose Ensemble_The Babe of Bethlehem.aac | 2023-11-24 10:10 | 482K | |
![[ ]](/icons/unknown.gif) | 2023_11_24_08_30_01_The Queen's Six_Out of Your Sleep.aac | 2023-11-24 10:08 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_11_24_08_30_01_Schola Cantorum of Saint Peter's in the Loop_Gloria.aac | 2023-11-24 09:57 | 3.0M | |
![[ ]](/icons/unknown.gif) | 2023_11_24_08_30_01_Musica Sacra_Saw You Never In The Twilight.aac | 2023-11-24 09:52 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2023_11_24_08_30_01_Portland Brass Quintet_Canzona per Sonare No. 4.aac | 2023-11-24 09:51 | 1.6M | |
![[ ]](/icons/unknown.gif) | 2023_11_24_08_30_01_Lahti Symphony Orchestra_Hosianna.aac | 2023-11-24 09:46 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_11_24_08_30_01_Aulos Ensemble_Noel Etranger.aac | 2023-11-24 09:44 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2023_11_24_08_30_01_Kansas City Chorale_The Holy Infant's Lullaby.aac | 2023-11-24 09:41 | 3.2M | |
![[ ]](/icons/unknown.gif) | 2023_11_24_08_30_01_Sistine Chapel Choir_Jubilate Deo (Sing Joyfully to God).aac | 2023-11-24 09:36 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2023_11_24_08_30_01_St. Paul's Cathedral Choir_Coventry Carol (Lully, Lulla, Lullay).aac | 2023-11-24 09:34 | 3.2M | |
![[ ]](/icons/unknown.gif) | 2023_11_24_08_30_01_West Edge String Quartet_A La Media Noche-De Tierra Lajana Venimos.aac | 2023-11-24 09:30 | 3.5M | |
![[ ]](/icons/unknown.gif) | 2023_11_24_08_30_01_Renaissonics_Quando nascette Ninno.aac | 2023-11-24 09:23 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2023_11_24_08_30_01_Raymond Mase, trumpet; Fred Sherry, cello; Anne-Marie McDerm_A Christmas Medley (Joy to the World, & more).aac | 2023-11-24 09:20 | 4.3M | |
![[ ]](/icons/unknown.gif) | 2023_11_24_08_30_01_Choir of King's College, Cambridge_I Saw a Maiden.aac | 2023-11-24 09:14 | 2.1M | |
![[ ]](/icons/unknown.gif) | 2023_11_24_08_30_01_In Mulieribus (Portland ens.)_Ther is no rose of swych vertu (15th c.).aac | 2023-11-24 09:11 | 2.7M | |
![[ ]](/icons/unknown.gif) | 2023_11_24_08_30_01_City of London Sinfonia_Dormi Jesu.aac | 2023-11-24 09:07 | 3.2M | |
![[ ]](/icons/unknown.gif) | 2023_11_24_08_30_01_Les Escapades_Num komm, der Heiden Heiland (Now come the Savior).aac | 2023-11-24 09:02 | 1.9M | |
![[ ]](/icons/unknown.gif) | 2023_11_24_08_30_01_Westminster Concert Bell Choir_We Three Kings.aac | 2023-11-24 08:59 | 1.4M | |
![[ ]](/icons/unknown.gif) | 2023_11_24_08_30_01_Katherine Murdock, viola; Nathaniel Rosen, cello_Angels' Carol.aac | 2023-11-24 08:57 | 2.5M | |
![[ ]](/icons/unknown.gif) | 2023_11_24_08_30_01_Piano4te_For Unto Us a Child is Born (after Handel's Messiah).aac | 2023-11-24 08:54 | 2.4M | |
![[ ]](/icons/unknown.gif) | 2023_11_24_08_30_01_The American Boychoir_Watts's Cradle Hymn.aac | 2023-11-24 08:50 | 2.9M | |
![[ ]](/icons/unknown.gif) | 2023_11_24_08_30_01_Vasari Singers_Sweet was the song.aac | 2023-11-24 08:46 | 2.9M | |
![[ ]](/icons/unknown.gif) | 2023_11_24_08_30_01_Seattle Pro Musica_Meine Seele erhebt Gott, den Herren.aac | 2023-11-24 08:42 | 1.7M | |
![[ ]](/icons/unknown.gif) | 2023_11_24_08_30_01_The Carillon Brass_Salvation Is Created (arr. Vernon M. Whaley).aac | 2023-11-24 08:39 | 1.8M | |
|